Index of /mirror/archlinux/community/os/x86_64

[ICO]NameLast modifiedSize

[PARENTDIR]Parent Directory  -
[DIR]local/2017-11-15 13:18 -
[PGP]cardinal-vst-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 118
[PGP]cgit-aurweb-1.2.3-2-x86_64.pkg.tar.zst.sig2021-06-28 22:26 118
[PGP]juce-docs-7.0.2-1-x86_64.pkg.tar.zst.sig2022-08-16 18:55 118
[PGP]kodi-addon-screensaver-asteroids-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:55 118
[PGP]lv2-1.18.10-1-x86_64.pkg.tar.zst.sig2022-09-10 10:28 118
[PGP]python-cerberus-1.3.4-4-any.pkg.tar.zst.sig2022-04-16 22:04 118
[PGP]python-puremagic-1.14-2-any.pkg.tar.zst.sig2022-09-23 11:06 118
[PGP]a2jmidid-9-3-x86_64.pkg.tar.zst.sig2020-11-29 23:21 119
[PGP]aardvark-dns-1.1.0-1-x86_64.pkg.tar.zst.sig2022-07-31 12:35 119
[PGP]abduco-0.6-6-x86_64.pkg.tar.zst.sig2020-12-31 00:25 119
[PGP]abletonlink-3.0.5-1-any.pkg.tar.zst.sig2022-09-15 12:20 119
[PGP]abseil-cpp-20220623.1-1-x86_64.pkg.tar.zst.sig2022-09-04 12:19 119
[PGP]acpi_call-dkms-1.2.2-1-any.pkg.tar.zst.sig2021-12-03 15:27 119
[PGP]adljack-1.2.0-3-x86_64.pkg.tar.zst.sig2021-11-19 00:10 119
[PGP]adlplug-1.0.2-5-x86_64.pkg.tar.zst.sig2022-08-09 13:21 119
[PGP]adrdox-2.5.3-1-x86_64.pkg.tar.zst.sig2022-07-24 16:38 119
[PGP]adriconf-2.5.0-1-x86_64.pkg.tar.zst.sig2022-02-05 13:47 119
[PGP]aeolus-0.10.4-1-x86_64.pkg.tar.zst.sig2022-05-10 17:27 119
[PGP]agordejo-0.4.1-1-any.pkg.tar.zst.sig2022-07-20 11:48 119
[PGP]alot-0.10-4-any.pkg.tar.zst.sig2022-07-12 18:57 119
[PGP]alsa-scarlett-gui-0.2-2-x86_64.pkg.tar.zst.sig2022-08-05 02:10 119
[PGP]alsa-tools-1.2.5-1-x86_64.pkg.tar.zst.sig2021-05-31 20:33 119
[PGP]ambix-0.2.10-3-x86_64.pkg.tar.zst.sig2020-11-23 20:35 119
[PGP]ams-2.2.0-1-x86_64.pkg.tar.zst.sig2021-03-04 17:09 119
[PGP]amsynth-1.13.0-1-x86_64.pkg.tar.zst.sig2022-07-20 09:36 119
[PGP]angband-4.2.4-1-x86_64.pkg.tar.zst.sig2022-02-22 07:34 119
[PGP]angle-grinder-0.18.0-2-x86_64.pkg.tar.zst.sig2022-04-13 11:03 119
[PGP]antlr4-4.11.1-1-any.pkg.tar.zst.sig2022-09-05 00:13 119
[PGP]antlr4-runtime-4.11.1-1-x86_64.pkg.tar.zst.sig2022-09-05 00:17 119
[PGP]anything-sync-daemon-6.0.0-1-any.pkg.tar.zst.sig2022-04-04 11:53 119
[PGP]appstream-generator-0.8.8-2-x86_64.pkg.tar.zst.sig2022-07-24 16:43 119
[PGP]apptainer-1.0.3-1-x86_64.pkg.tar.zst.sig2022-07-21 10:12 119
[PGP]arch-release-promotion-0.2.2-1-any.pkg.tar.zst.sig2022-04-14 19:27 119
[PGP]arch-wiki-docs-20220525-1-any.pkg.tar.zst.sig2022-05-25 10:07 119
[PGP]arch-wiki-lite-20220525-1-any.pkg.tar.zst.sig2022-05-25 10:18 119
[PGP]ardour-6.9-5-x86_64.pkg.tar.zst.sig2022-02-17 19:35 119
[PGP]arpack-3.8.0-3-x86_64.pkg.tar.zst.sig2022-06-12 17:35 119
[PGP]arrayfire-3.8.2-3-x86_64.pkg.tar.zst.sig2022-08-25 01:42 119
[PGP]arrow-8.0.1-1-x86_64.pkg.tar.zst.sig2022-07-20 14:39 119
[PGP]artyfx-1.3.1-1-x86_64.pkg.tar.zst.sig2021-01-16 18:32 119
[PGP]aspell-da-4.1-1-any.pkg.tar.zst.sig2022-08-25 15:59 119
[PGP]at-3.2.5-1-x86_64.pkg.tar.zst.sig2022-02-28 14:04 119
[PGP]at51-1.0.0-3-x86_64.pkg.tar.zst.sig2022-04-22 23:40 119
[PGP]atftp-0.8.0-3-x86_64.pkg.tar.zst.sig2022-09-08 10:47 119
[PGP]aubio-0.4.9-14-x86_64.pkg.tar.zst.sig2022-06-09 00:53 119
[PGP]autorandr-1.12.1-2-any.pkg.tar.zst.sig2022-04-28 09:39 119
[PGP]avisynthplus-3.7.2-1-x86_64.pkg.tar.zst.sig2022-03-20 20:04 119
[PGP]avldrums.lv2-0.5.0-1-x86_64.pkg.tar.zst.sig2022-07-03 12:05 119
[PGP]awxkit-21.6.0-1-any.pkg.tar.zst.sig2022-09-21 16:09 119
[PGP]bacon-2.2.3-1-x86_64.pkg.tar.zst.sig2022-09-19 00:55 119
[PGP]bat-extras-2022.07.27.r7.gabda988-1-any.pkg.tar.zst.sig2022-07-30 10:17 119
[PGP]bchoppr-1.10.10-1-x86_64.pkg.tar.zst.sig2021-09-10 23:51 119
[PGP]bear-3.0.20-2-x86_64.pkg.tar.zst.sig2022-08-10 09:42 119
[PGP]bearssl-0.6-5-x86_64.pkg.tar.zst.sig2022-05-21 00:20 119
[PGP]bemenu-0.6.10-1-x86_64.pkg.tar.zst.sig2022-07-06 12:41 119
[PGP]bemenu-ncurses-0.6.10-1-x86_64.pkg.tar.zst.sig2022-07-06 12:41 119
[PGP]bemenu-wayland-0.6.10-1-x86_64.pkg.tar.zst.sig2022-07-06 12:41 119
[PGP]bemenu-x11-0.6.10-1-x86_64.pkg.tar.zst.sig2022-07-06 12:41 119
[PGP]benchmark-1.7.0-1-x86_64.pkg.tar.zst.sig2022-08-02 14:09 119
[PGP]bespokesynth-1.1.0.r154.g0acb8ebf-1-x86_64.pkg.tar.zst.sig2022-09-15 23:00 119
[PGP]bibtool-2.68-5-x86_64.pkg.tar.zst.sig2022-03-19 09:47 119
[PGP]bibutils-7.2-2-x86_64.pkg.tar.zst.sig2022-01-16 09:31 119
[PGP]bin86-0.16.21-4-x86_64.pkg.tar.zst.sig2021-09-27 23:54 119
[PGP]bitsery-5.2.2-1-any.pkg.tar.zst.sig2021-12-19 17:13 119
[PGP]blop-0.2.8-4-x86_64.pkg.tar.zst.sig2020-03-31 20:34 119
[PGP]blop.lv2-1.0.4-1-x86_64.pkg.tar.zst.sig2022-09-13 15:32 119
[PGP]blosc-1.21.1-2-x86_64.pkg.tar.zst.sig2021-12-26 02:57 119
[PGP]bmake-20220726-1-x86_64.pkg.tar.zst.sig2022-07-28 23:04 119
[PGP]bootconfig-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]bottom-0.6.8-1-x86_64.pkg.tar.zst.sig2022-02-02 07:28 119
[PGP]bpf-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]browserpass-chromium-3.7.2-2-any.pkg.tar.zst.sig2022-02-24 22:11 119
[PGP]browserpass-firefox-3.7.2-2-any.pkg.tar.zst.sig2022-02-24 22:14 119
[PGP]bsequencer-1.8.10-1-x86_64.pkg.tar.zst.sig2021-09-10 23:51 119
[PGP]bshapr-0.13-1-x86_64.pkg.tar.zst.sig2021-06-07 20:46 119
[PGP]bslizr-1.2.16-1-x86_64.pkg.tar.zst.sig2021-06-07 20:48 119
[PGP]budgie-control-center-1.1.1-2-x86_64.pkg.tar.zst.sig2022-09-14 22:11 119
[PGP]budgie-desktop-10.6.4-3-x86_64.pkg.tar.zst.sig2022-09-15 00:41 119
[PGP]budgie-desktop-view-1.2-2-x86_64.pkg.tar.zst.sig2022-09-15 00:55 119
[PGP]buildah-1.27.2-1-x86_64.pkg.tar.zst.sig2022-09-23 02:36 119
[PGP]buildbot-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]buildbot-common-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]buildbot-docs-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]buildbot-worker-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]buildkit-0.10.4-1-x86_64.pkg.tar.zst.sig2022-08-23 04:50 119
[PGP]bupstash-0.11.1-1-x86_64.pkg.tar.zst.sig2022-09-12 02:59 119
[PGP]byacc-20220128-1-x86_64.pkg.tar.zst.sig2022-07-29 21:22 119
[PGP]cacti-1.2.22-1-any.pkg.tar.zst.sig2022-08-23 17:26 119
[PGP]cadence-0.9.2-1-x86_64.pkg.tar.zst.sig2022-06-19 11:46 119
[PGP]calf-0.90.3-5-x86_64.pkg.tar.zst.sig2021-07-26 19:40 119
[PGP]camlp-streams-5.0.1-1-x86_64.pkg.tar.zst.sig2022-08-09 22:25 119
[PGP]camlp4-4.14+1-3-x86_64.pkg.tar.zst.sig2022-08-09 22:24 119
[PGP]camlp5-8.0-4-x86_64.pkg.tar.zst.sig2022-08-09 22:24 119
[PGP]capitaine-cursors-4-1-any.pkg.tar.zst.sig2020-02-20 17:07 119
[PGP]capnproto-0.10.2-1-x86_64.pkg.tar.zst.sig2022-08-31 09:54 119
[PGP]cardinal-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 119
[PGP]cardinal-data-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 119
[PGP]cardinal-jack-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 119
[PGP]cardinal-lv2-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 119
[PGP]cardinal-vst3-22.09-1-x86_64.pkg.tar.zst.sig2022-09-21 22:05 119
[PGP]cargo-c-0.9.12-1-x86_64.pkg.tar.zst.sig2022-08-19 00:53 119
[PGP]cargo-pgx-0.4.5-1-x86_64.pkg.tar.zst.sig2022-08-27 01:40 119
[PGP]cargo-sort-1.0.7-1-x86_64.pkg.tar.zst.sig2021-12-22 04:55 119
[PGP]cargo-supply-chain-0.3.1-1-x86_64.pkg.tar.zst.sig2022-03-19 07:56 119
[PGP]carla-2.5.0-1-x86_64.pkg.tar.zst.sig2022-07-20 10:04 119
[PGP]catatonit-0.1.7-2-x86_64.pkg.tar.zst.sig2022-07-26 20:03 119
[PGP]ccid-1.5.0-1-x86_64.pkg.tar.zst.sig2022-01-31 20:25 119
[PGP]cern-vdt-0.4.4-1-x86_64.pkg.tar.zst.sig2022-03-23 12:40 119
[PGP]certbot-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:13 119
[PGP]certbot-apache-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:15 119
[PGP]certbot-dns-cloudflare-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:16 119
[PGP]certbot-dns-digitalocean-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:17 119
[PGP]certbot-dns-dnsimple-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:18 119
[PGP]certbot-dns-dnsmadeeasy-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:19 119
[PGP]certbot-dns-gehirn-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:20 119
[PGP]certbot-dns-google-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:21 119
[PGP]certbot-dns-linode-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:22 119
[PGP]certbot-dns-luadns-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:23 119
[PGP]certbot-dns-nsone-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:24 119
[PGP]certbot-dns-ovh-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:25 119
[PGP]certbot-dns-rfc2136-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:25 119
[PGP]certbot-dns-route53-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:26 119
[PGP]certbot-dns-sakuracloud-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:27 119
[PGP]certbot-nginx-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 01:28 119
[PGP]cgit-1.2.3-3-x86_64.pkg.tar.zst.sig2021-03-14 23:02 119
[PGP]cgit-archweb-1.2.3-2-x86_64.pkg.tar.zst.sig2021-06-28 22:26 119
[PGP]cgroup_event_listener-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]charm-0.12.4-1-x86_64.pkg.tar.zst.sig2022-08-16 04:59 119
[PGP]check-sieve-0.8-1-x86_64.pkg.tar.zst.sig2022-05-25 09:57 119
[PGP]checkbashisms-2.22.2-1-any.pkg.tar.zst.sig2022-09-04 21:22 119
[PGP]chewing-editor-0.1.1-8-x86_64.pkg.tar.zst.sig2021-03-27 14:17 119
[PGP]choose-1.3.4-1-x86_64.pkg.tar.zst.sig2022-04-25 00:54 119
[PGP]chrono-date-3.0.1-3-x86_64.pkg.tar.zst.sig2022-02-25 14:49 119
[PGP]cl-alexandria-1.4.r17.g2f39fbf-1-any.pkg.tar.zst.sig2022-05-20 11:08 119
[PGP]cl-asdf-flv-2.1-2-any.pkg.tar.zst.sig2022-05-20 23:46 119
[PGP]cl-babel-0.5.0.r20.gf892d05-2-any.pkg.tar.zst.sig2022-05-25 04:39 119
[PGP]cl-bordeaux-threads-0.8.8-6-any.pkg.tar.zst.sig2022-05-25 04:44 119
[PGP]cl-cffi-0.24.1.r23.gac07d76-1-any.pkg.tar.zst.sig2022-09-05 04:10 119
[PGP]cl-clx-0.7.5.r71.gf5bc0ab-1-any.pkg.tar.zst.sig2022-09-05 04:08 119
[PGP]cl-fiveam-1.4.2.r12.ge11dee7-2-any.pkg.tar.zst.sig2022-05-20 23:50 119
[PGP]cl-flexi-streams-1.0.19.r4.g74a1027-1-any.pkg.tar.zst.sig2022-05-11 05:35 119
[PGP]cl-global-vars-1.0.0.r2.gc749f32-2-any.pkg.tar.zst.sig2022-05-25 04:30 119
[PGP]cl-hu-dwim-stefil-r257.g7a17248-2-any.pkg.tar.zst.sig2022-05-24 23:55 119
[PGP]cl-json-0.6.0-2-any.pkg.tar.zst.sig2022-05-25 04:35 119
[PGP]cl-lift-1.7.1.r47.ge08e84e-3-any.pkg.tar.zst.sig2022-05-30 06:07 119
[PGP]cl-ppcre-2.1.1.r3.gb4056c5-1-any.pkg.tar.zst.sig2022-05-11 05:40 119
[PGP]cl-rt-1990.12.19.r19.ga6a7503-2-any.pkg.tar.zst.sig2022-05-20 11:01 119
[PGP]cl-swank-2.27-1-any.pkg.tar.zst.sig2022-05-18 00:03 119
[PGP]cl-trivial-backtrace-1.1.0.r20.g6eb65bd-1-any.pkg.tar.zst.sig2022-05-20 23:42 119
[PGP]cl-trivial-features-1.0.r3.g35c5eeb-2-any.pkg.tar.zst.sig2022-05-25 04:54 119
[PGP]cl-trivial-garbage-0.21.r8.gb3af9c0-2-any.pkg.tar.zst.sig2022-05-25 04:32 119
[PGP]cl-trivial-gray-streams-2.0.0.r47.g2b3823e-1-any.pkg.tar.zst.sig2022-05-13 04:14 119
[PGP]cl-unicode-0.1.6.r11.g2790a6b-1-any.pkg.tar.zst.sig2022-05-11 05:45 119
[PGP]clonezilla-3.35.2-4-any.pkg.tar.zst.sig2022-07-11 22:32 119
[PGP]cloud-init-22.3.3-1-any.pkg.tar.zst.sig2022-09-21 15:08 119
[PGP]cloudflared-2022.9.1-1-x86_64.pkg.tar.zst.sig2022-09-23 02:25 119
[PGP]cm256cc-1.1.0-2-x86_64.pkg.tar.zst.sig2022-04-22 23:43 119
[PGP]cmt-1.18-1-x86_64.pkg.tar.zst.sig2021-09-05 20:13 119
[PGP]cni-plugins-1.1.1-2-x86_64.pkg.tar.zst.sig2022-05-06 19:30 119
[PGP]cockpit-277-1-x86_64.pkg.tar.zst.sig2022-09-22 19:25 119
[PGP]cockpit-machines-275-1-x86_64.pkg.tar.zst.sig2022-09-22 19:28 119
[PGP]cockpit-packagekit-277-1-x86_64.pkg.tar.zst.sig2022-09-22 19:25 119
[PGP]cockpit-pcp-277-1-x86_64.pkg.tar.zst.sig2022-09-22 19:25 119
[PGP]cockpit-podman-54-1-x86_64.pkg.tar.zst.sig2022-09-22 19:29 119
[PGP]cockpit-storaged-277-1-x86_64.pkg.tar.zst.sig2022-09-22 19:25 119
[PGP]code-1.71.2-1-x86_64.pkg.tar.zst.sig2022-09-19 17:01 119
[PGP]codec2-1:1.0.5-1-x86_64.pkg.tar.zst.sig2022-07-17 14:08 119
[PGP]confuse-3.3-3-x86_64.pkg.tar.zst.sig2021-01-05 18:24 119
[PGP]containers-common-1:0.49.1-2-any.pkg.tar.zst.sig2022-09-08 09:05 119
[PGP]copyq-6.3.0-1-x86_64.pkg.tar.zst.sig2022-09-21 16:09 119
[PGP]coq-8.16.0-2-x86_64.pkg.tar.zst.sig2022-09-07 11:23 119
[PGP]coq-doc-8.16.0-2-x86_64.pkg.tar.zst.sig2022-09-07 11:23 119
[PGP]coqide-8.16.0-2-x86_64.pkg.tar.zst.sig2022-09-07 11:23 119
[PGP]cppcheck-2.9-1-x86_64.pkg.tar.zst.sig2022-08-29 10:21 119
[PGP]cpptoml-0.1.1-2-any.pkg.tar.zst.sig2020-07-19 10:31 119
[PGP]cpupower-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]cri-o-1.25.0-1-x86_64.pkg.tar.zst.sig2022-08-29 22:53 119
[PGP]crictl-1.25.0-1-x86_64.pkg.tar.zst.sig2022-08-27 10:15 119
[PGP]critest-1.25.0-1-x86_64.pkg.tar.zst.sig2022-08-27 10:15 119
[PGP]criu-3.17.1-1-x86_64.pkg.tar.zst.sig2022-06-24 09:14 119
[PGP]croc-9.6.0-1-x86_64.pkg.tar.zst.sig2022-07-20 01:14 119
[PGP]csound-6.17.0-1-x86_64.pkg.tar.zst.sig2022-02-03 20:40 119
[PGP]csound-doc-6.17.0-1-x86_64.pkg.tar.zst.sig2022-02-03 20:41 119
[PGP]csoundqt-1:1.1.0-1-x86_64.pkg.tar.zst.sig2022-01-20 22:02 119
[PGP]cuda-11.7.1-3-x86_64.pkg.tar.zst.sig2022-08-22 14:45 119
[PGP]cuda-tools-11.7.1-3-x86_64.pkg.tar.zst.sig2022-08-22 14:46 119
[PGP]cxxopts-3.0.0-1-any.pkg.tar.zst.sig2021-11-07 15:54 119
[PGP]cycfx2prog-0.47-3-x86_64.pkg.tar.zst.sig2022-04-22 23:44 119
[PGP]d-containers-0.8.0-8-x86_64.pkg.tar.zst.sig2022-07-24 16:43 119
[PGP]d-mir-core-1.1.14-10-x86_64.pkg.tar.zst.sig2022-07-24 16:42 119
[PGP]d-stdx-allocator-3.0.2-20-x86_64.pkg.tar.zst.sig2022-07-24 16:43 119
[PGP]dagger-0.2.34-1-x86_64.pkg.tar.zst.sig2022-09-14 10:14 119
[PGP]darkhttpd-1.13-1-x86_64.pkg.tar.zst.sig2021-02-28 13:14 119
[PGP]darkstat-3.0.721-2-x86_64.pkg.tar.zst.sig2022-01-22 21:40 119
[PGP]dart-sass-1.55.0-1-x86_64.pkg.tar.zst.sig2022-09-24 09:54 119
[PGP]datamash-1.8-1-x86_64.pkg.tar.zst.sig2022-07-24 11:26 119
[PGP]dbmate-1.15.0-2-x86_64.pkg.tar.zst.sig2022-04-28 09:48 119
[PGP]dcd-1:0.13.6-2-x86_64.pkg.tar.zst.sig2022-01-23 02:00 119
[PGP]deja-dup-43.4-1-x86_64.pkg.tar.zst.sig2022-07-07 02:06 119
[PGP]deteriorate-lv2-1.0.7-3-x86_64.pkg.tar.zst.sig2021-06-28 20:34 119
[PGP]dev86-0.16.21-6-x86_64.pkg.tar.zst.sig2021-12-25 22:15 119
[PGP]devilspie-0.23-4-x86_64.pkg.tar.zst.sig2020-10-28 10:18 119
[PGP]dexed-0.9.6.r89.g2c03631-1-x86_64.pkg.tar.zst.sig2022-09-19 10:14 119
[PGP]dfmt-0.14.2-1-x86_64.pkg.tar.zst.sig2022-02-20 13:39 119
[PGP]diffstat-1.64-2-x86_64.pkg.tar.zst.sig2022-07-29 21:27 119
[PGP]difftastic-0.36.1-1-x86_64.pkg.tar.zst.sig2022-09-19 00:38 119
[PGP]din-55-1-x86_64.pkg.tar.zst.sig2022-09-24 11:22 119
[PGP]direnv-2.32.1-1-x86_64.pkg.tar.zst.sig2022-06-24 00:48 119
[PGP]distrho-ports-2021.03.15-2-x86_64.pkg.tar.zst.sig2022-01-23 11:53 119
[PGP]distrobuilder-2.1-2-x86_64.pkg.tar.zst.sig2022-07-22 03:21 119
[PGP]dmd-1:2.100.1-1-x86_64.pkg.tar.zst.sig2022-08-20 12:18 119
[PGP]dmd-docs-1:2.100.1-1-x86_64.pkg.tar.zst.sig2022-08-20 12:18 119
[PGP]dmtcp-2.6.1rc1-1-x86_64.pkg.tar.zst.sig2022-06-12 17:52 119
[PGP]dnscrypt-proxy-2.1.2-1-x86_64.pkg.tar.zst.sig2022-08-02 17:30 119
[PGP]dnsperf-2.9.0-2-x86_64.pkg.tar.zst.sig2022-03-06 13:30 119
[PGP]dopewars-1.6.2-2-x86_64.pkg.tar.zst.sig2022-07-05 07:12 119
[PGP]doublecmd-gtk2-1.0.8-1-x86_64.pkg.tar.zst.sig2022-09-21 16:09 119
[PGP]doublecmd-qt5-1.0.8-1-x86_64.pkg.tar.zst.sig2022-09-21 16:09 119
[PGP]dpf-plugins-1.5-1-x86_64.pkg.tar.zst.sig2022-01-16 17:13 119
[PGP]dragonfly-reverb-3.2.6-1-x86_64.pkg.tar.zst.sig2022-04-04 19:02 119
[PGP]drbl-2.30.5-2-any.pkg.tar.zst.sig2022-07-11 22:32 119
[PGP]drone-2.13.0-1-x86_64.pkg.tar.zst.sig2022-09-24 02:05 119
[PGP]drone-cli-1.5.0-2-x86_64.pkg.tar.zst.sig2022-04-28 09:53 119
[PGP]drone-oss-2.13.0-1-x86_64.pkg.tar.zst.sig2022-09-24 02:05 119
[PGP]drone-runner-docker-1.8.2-1-x86_64.pkg.tar.zst.sig2022-06-15 09:42 119
[PGP]drone-runner-exec-1.0.0.beta.10-1-x86_64.pkg.tar.zst.sig2022-06-24 01:18 119
[PGP]drone-runner-ssh-1.0.1-4-x86_64.pkg.tar.zst.sig2022-04-28 19:50 119
[PGP]drumgizmo-0.9.20-1-x86_64.pkg.tar.zst.sig2022-09-08 22:36 119
[PGP]drumkv1-0.9.26-2-x86_64.pkg.tar.zst.sig2022-06-07 17:51 119
[PGP]drumstick-2.7.1-2-x86_64.pkg.tar.zst.sig2022-09-05 18:30 119
[PGP]dscanner-0.12.2-2-x86_64.pkg.tar.zst.sig2022-07-24 16:39 119
[PGP]dtools-2.100.0-1-x86_64.pkg.tar.zst.sig2022-05-16 23:26 119
[PGP]dub-1.29.1-1-x86_64.pkg.tar.zst.sig2022-07-24 16:39 119
[PGP]dune-3.4.1-2-x86_64.pkg.tar.zst.sig2022-08-09 22:26 119
[PGP]duperemove-0.11.3-2-x86_64.pkg.tar.zst.sig2022-07-11 22:22 119
[PGP]duplicity-0.8.23-1-x86_64.pkg.tar.zst.sig2022-07-06 19:54 119
[PGP]dvgrab-3.5-12-x86_64.pkg.tar.zst.sig2022-02-05 00:02 119
[PGP]earlyoom-1.7-1-x86_64.pkg.tar.zst.sig2022-03-06 17:22 119
[PGP]easy-pdk-1.3-2-x86_64.pkg.tar.zst.sig2022-04-22 23:46 119
[PGP]ecasound-2.9.3-7-x86_64.pkg.tar.zst.sig2021-12-29 15:17 119
[PGP]editline-1.17.1-2-x86_64.pkg.tar.zst.sig2021-07-01 01:36 119
[PGP]efifs-1.9-1-any.pkg.tar.zst.sig2022-09-06 06:08 119
[PGP]element-0.46.6-1-x86_64.pkg.tar.zst.sig2022-07-20 14:19 119
[PGP]emacs-slime-2.27-1-any.pkg.tar.zst.sig2022-05-18 00:03 119
[PGP]endless-sky-0.9.14-1-x86_64.pkg.tar.zst.sig2021-07-12 00:30 119
[PGP]endless-sky-high-dpi-0.9.14-1-any.pkg.tar.zst.sig2021-07-12 00:45 119
[PGP]eq10q-2.2-4-x86_64.pkg.tar.zst.sig2021-08-01 14:00 119
[PGP]espeakup-0.90-1-x86_64.pkg.tar.zst.sig2021-06-20 20:58 119
[PGP]etckeeper-1.18.18-1-any.pkg.tar.zst.sig2022-09-08 21:13 119
[PGP]eteroj.lv2-0.10.0-1-x86_64.pkg.tar.zst.sig2021-04-15 16:17 119
[PGP]fabla-1.3.2-3-x86_64.pkg.tar.zst.sig2020-05-21 16:28 119
[PGP]fabric-2.7.1-1-any.pkg.tar.zst.sig2022-07-17 11:25 119
[PGP]fastd-22-1-x86_64.pkg.tar.zst.sig2021-06-28 10:55 119
[PGP]faust-2.41.1-2-x86_64.pkg.tar.zst.sig2022-06-29 20:26 119
[PGP]fcitx-chewing-0.2.3-4-x86_64.pkg.tar.zst.sig2020-05-10 10:45 119
[PGP]fennel-1.2.0-1-any.pkg.tar.zst.sig2022-08-30 11:48 119
[PGP]fig2dev-3.2.8.b-1-x86_64.pkg.tar.zst.sig2021-08-24 14:45 119
[PGP]firecracker-1.1.1-1-x86_64.pkg.tar.zst.sig2022-07-30 10:44 119
[PGP]firecracker-docs-1.1.1-1-x86_64.pkg.tar.zst.sig2022-07-30 10:44 119
[PGP]firejail-0.9.70-4-x86_64.pkg.tar.zst.sig2022-08-27 12:42 119
[PGP]firetools-0.9.64-2-x86_64.pkg.tar.zst.sig2022-01-29 12:54 119
[PGP]fisher-4.4.2-1-any.pkg.tar.zst.sig2022-07-03 20:53 119
[PGP]flterm-2.4-2-x86_64.pkg.tar.zst.sig2022-04-22 23:47 119
[PGP]fltk-1.3.8-1-x86_64.pkg.tar.zst.sig2021-12-28 17:19 119
[PGP]fltk-docs-1.3.8-1-x86_64.pkg.tar.zst.sig2021-12-28 17:19 119
[PGP]fluajho-1.7.3-1-any.pkg.tar.zst.sig2022-07-20 11:51 119
[PGP]flyspray-1.0rc10-1-any.pkg.tar.zst.sig2021-05-14 20:13 119
[PGP]fnlfmt-0.2.3-1-any.pkg.tar.zst.sig2022-05-11 11:08 119
[PGP]fomp.lv2-1.2.4-1-x86_64.pkg.tar.zst.sig2022-09-13 14:37 119
[PGP]fontobene-qt5-0.2.0-2-x86_64.pkg.tar.zst.sig2022-04-22 23:48 119
[PGP]fortune-mod-3.14.1-1-x86_64.pkg.tar.zst.sig2022-08-12 22:41 119
[PGP]fpc-3.2.2-6-x86_64.pkg.tar.zst.sig2022-09-01 07:58 119
[PGP]freeipmi-1.6.10-1-x86_64.pkg.tar.zst.sig2022-09-01 09:22 119
[PGP]freewheeling-0.6.6-3-x86_64.pkg.tar.zst.sig2021-07-26 19:43 119
[PGP]fs-uae-3.1.66-2-x86_64.pkg.tar.zst.sig2022-01-29 13:17 119
[PGP]fs-uae-launcher-3.1.68-1-any.pkg.tar.zst.sig2022-01-29 13:18 119
[PGP]fst-0.122.0-1-any.pkg.tar.zst.sig2022-08-23 17:21 119
[PGP]function2-4.2.1-1-any.pkg.tar.zst.sig2022-06-07 13:54 119
[PGP]furnace-0.6pre1-1-x86_64.pkg.tar.zst.sig2022-09-20 10:10 119
[PGP]gammastep-2.0.9-1-x86_64.pkg.tar.zst.sig2022-09-12 13:51 119
[PGP]ganv-1.8.2-1-x86_64.pkg.tar.zst.sig2022-08-23 16:39 119
[PGP]gcc11-11.3.0-4-x86_64.pkg.tar.zst.sig2022-05-31 10:38 119
[PGP]gcc11-fortran-11.3.0-4-x86_64.pkg.tar.zst.sig2022-05-31 10:38 119
[PGP]gcc11-libs-11.3.0-4-x86_64.pkg.tar.zst.sig2022-05-31 10:38 119
[PGP]gcin-2.9.0-4-x86_64.pkg.tar.zst.sig2022-03-05 09:51 119
[PGP]gentium-plus-font-6.101-1-any.pkg.tar.zst.sig2022-03-03 21:03 119
[PGP]geoipupdate-4.9.0-3-x86_64.pkg.tar.zst.sig2022-07-28 22:21 119
[PGP]geonkick-2.9.1-1-x86_64.pkg.tar.zst.sig2022-05-18 15:58 119
[PGP]gephi-0.9.7-1-x86_64.pkg.tar.zst.sig2022-08-06 16:50 119
[PGP]gflags-2.2.2-4-x86_64.pkg.tar.zst.sig2022-02-07 16:17 119
[PGP]ghc-filesystem-1.5.12-2-any.pkg.tar.zst.sig2022-06-10 16:56 119
[PGP]gifsicle-1.93-2-x86_64.pkg.tar.zst.sig2022-01-29 13:27 119
[PGP]gigedit-1.2.0-1-x86_64.pkg.tar.zst.sig2021-06-03 21:49 119
[PGP]gimp-nufraw-0.43.3-4-x86_64.pkg.tar.zst.sig2022-05-12 21:03 119
[PGP]gir-to-d-0.22.0-8-x86_64.pkg.tar.zst.sig2022-07-24 16:41 119
[PGP]git-delta-0.14.0-2-x86_64.pkg.tar.zst.sig2022-09-01 09:38 119
[PGP]gitolite-3.6.12-2-any.pkg.tar.zst.sig2022-03-07 15:16 119
[PGP]glibd-2.3.0-7-x86_64.pkg.tar.zst.sig2022-07-24 16:42 119
[PGP]glow-1.4.1-3-x86_64.pkg.tar.zst.sig2022-04-28 21:54 119
[PGP]gmm-5.4.2-1-any.pkg.tar.zst.sig2022-07-09 12:20 119
[PGP]gmni-1.0-1-x86_64.pkg.tar.zst.sig2022-05-21 00:24 119
[PGP]gmsynth.lv2-0.5.0-2-x86_64.pkg.tar.zst.sig2021-07-26 19:44 119
[PGP]gnuchess-6.2.9-2-x86_64.pkg.tar.zst.sig2022-07-11 22:34 119
[PGP]goattracker-2.76-2-x86_64.pkg.tar.zst.sig2022-09-21 11:08 119
[PGP]gobby-1:0.6.0-1-x86_64.pkg.tar.zst.sig2021-02-15 19:41 119
[PGP]gocryptfs-2.3-1-x86_64.pkg.tar.zst.sig2022-08-29 01:22 119
[PGP]gron-0.7.1-2-x86_64.pkg.tar.zst.sig2022-04-28 21:55 119
[PGP]grpc-1.48.0-1-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]grpc-cli-1.48.0-1-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]grub-btrfs-4.11-2-any.pkg.tar.zst.sig2022-02-24 22:42 119
[PGP]grub-customizer-5.2.2-1-x86_64.pkg.tar.zst.sig2022-07-31 13:06 119
[PGP]gscan2pdf-2.12.6-2-any.pkg.tar.zst.sig2022-07-11 23:52 119
[PGP]gtkd-3.10.0-4-x86_64.pkg.tar.zst.sig2022-07-24 16:40 119
[PGP]gtkimageview-1.6.4-7-x86_64.pkg.tar.zst.sig2020-12-31 00:24 119
[PGP]gum-0.6.0-1-x86_64.pkg.tar.zst.sig2022-09-12 01:47 119
[PGP]gxplugins.lv2-0.9-1-x86_64.pkg.tar.zst.sig2021-04-24 15:40 119
[PGP]haproxy-2.6.6-1-x86_64.pkg.tar.zst.sig2022-09-22 19:46 119
[PGP]harvid-0.9.0-1-x86_64.pkg.tar.zst.sig2022-04-04 14:31 119
[PGP]haskell-mtl-prelude-2.0.3.1-2-x86_64.pkg.tar.zst.sig2022-06-09 11:17 119
[PGP]hck-0.7.5-1-x86_64.pkg.tar.zst.sig2022-06-08 04:07 119
[PGP]helix-22.08.1-1-x86_64.pkg.tar.zst.sig2022-09-02 23:01 119
[PGP]helm-synth-0.9.0-9-x86_64.pkg.tar.zst.sig2020-04-05 16:35 119
[PGP]hepmc-3.2.5-1-x86_64.pkg.tar.zst.sig2022-03-06 15:31 119
[PGP]hepmc-docs-3.2.5-1-x86_64.pkg.tar.zst.sig2022-03-06 15:31 119
[PGP]hevea-2.36-1-x86_64.pkg.tar.zst.sig2022-08-06 16:51 119
[PGP]hexter-1.1.1-1-x86_64.pkg.tar.zst.sig2021-01-07 09:17 119
[PGP]hidapi-0.12.0-1-x86_64.pkg.tar.zst.sig2022-05-26 23:47 119
[PGP]highway-1.0.1-1-x86_64.pkg.tar.zst.sig2022-09-21 20:40 119
[PGP]hivex-1.3.21-7-x86_64.pkg.tar.zst.sig2022-08-09 22:27 119
[PGP]hm-16.24-3-x86_64.pkg.tar.zst.sig2022-03-12 04:47 119
[PGP]hostapd-2.10-1-x86_64.pkg.tar.zst.sig2022-01-17 00:07 119
[PGP]hound-0.6.0-1-x86_64.pkg.tar.zst.sig2022-09-15 10:08 119
[PGP]html-xml-utils-8.4-1-x86_64.pkg.tar.zst.sig2022-04-01 22:30 119
[PGP]htmldoc-1.9.16-1-x86_64.pkg.tar.zst.sig2022-05-22 18:52 119
[PGP]htmlq-0.4.0-1-x86_64.pkg.tar.zst.sig2022-04-15 00:03 119
[PGP]hut-0.2.0-1-x86_64.pkg.tar.zst.sig2022-07-27 01:03 119
[PGP]hy-1.0a4-2-any.pkg.tar.zst.sig2022-01-14 10:03 119
[PGP]hydrogen-1.1.1-1-x86_64.pkg.tar.zst.sig2021-12-06 14:25 119
[PGP]hyperkitty-1.3.5-4-any.pkg.tar.zst.sig2022-02-20 17:18 119
[PGP]hyperv-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]ibus-chewing-1.6.1+12+gc1e7f0d-3-x86_64.pkg.tar.zst.sig2021-02-07 16:36 119
[PGP]icecast-2.4.4-4-x86_64.pkg.tar.zst.sig2020-09-13 14:34 119
[PGP]icmake-10.03.01-2-x86_64.pkg.tar.zst.sig2022-09-23 18:02 119
[PGP]iempluginsuite-1.13.0-1-x86_64.pkg.tar.zst.sig2022-09-15 20:34 119
[PGP]incron-0.5.12-5-x86_64.pkg.tar.zst.sig2022-04-29 12:10 119
[PGP]infamousplugins-0.3.0-3-x86_64.pkg.tar.zst.sig2020-04-28 22:00 119
[PGP]intel-media-sdk-22.4.4-1-x86_64.pkg.tar.zst.sig2022-07-03 03:58 119
[PGP]intel-metee-3.1.3-1-x86_64.pkg.tar.zst.sig2022-04-18 19:21 119
[PGP]intel-metee-doc-3.1.3-1-x86_64.pkg.tar.zst.sig2022-04-18 19:21 119
[PGP]intel-oneapi-basekit-2022.2.0.262-1-x86_64.pkg.tar.zst.sig2022-08-27 01:59 119
[PGP]intel-oneapi-common-2022.1.0-3-any.pkg.tar.zst.sig2022-08-26 16:24 119
[PGP]intel-oneapi-compiler-dpcpp-cpp-runtime-2022.1.0-7-x86_64.pkg.tar.zst.sig2022-08-26 17:47 119
[PGP]intel-oneapi-compiler-shared-runtime-2022.1.0-8-x86_64.pkg.tar.zst.sig2022-08-27 00:32 119
[PGP]intel-oneapi-mkl-2022.1.0_223-4-x86_64.pkg.tar.zst.sig2022-08-27 00:50 119
[PGP]intel-oneapi-openmp-2022.1.0-8-x86_64.pkg.tar.zst.sig2022-08-26 17:42 119
[PGP]intel-oneapi-tbb-2021.6.0-4-x86_64.pkg.tar.zst.sig2022-08-27 00:57 119
[PGP]interception-tools-0.6.8-5-x86_64.pkg.tar.zst.sig2022-08-07 16:36 119
[PGP]ioping-1.3-1-x86_64.pkg.tar.zst.sig2022-08-25 20:16 119
[PGP]iperf-2.1.8-1-x86_64.pkg.tar.zst.sig2022-08-14 01:34 119
[PGP]ipv6calc-4.0.1-1-x86_64.pkg.tar.zst.sig2022-02-04 15:00 119
[PGP]ipxe-1.21.1-4-x86_64.pkg.tar.zst.sig2022-05-13 12:52 119
[PGP]ir.lv2-1.3.4-2-x86_64.pkg.tar.zst.sig2020-04-28 22:39 119
[PGP]irker-2.22-1-any.pkg.tar.zst.sig2022-03-15 22:52 119
[PGP]jack-stdio-1.6-1-x86_64.pkg.tar.zst.sig2020-08-09 09:20 119
[PGP]jack_delay-0.4.2-1-x86_64.pkg.tar.xz.sig2019-11-16 22:32 119
[PGP]jack_utils-0.0.1-1-x86_64.pkg.tar.zst.sig2020-04-13 00:42 119
[PGP]jackmeter-0.4-2-x86_64.pkg.tar.xz.sig2019-11-21 23:02 119
[PGP]jackminimix-0.2.1-2-x86_64.pkg.tar.xz.sig2019-11-21 21:03 119
[PGP]jacktrip-1.6.4-1-x86_64.pkg.tar.zst.sig2022-09-21 15:25 119
[PGP]jalv-1.6.8-1-x86_64.pkg.tar.zst.sig2022-09-13 14:53 119
[PGP]japa-0.9.4-1-x86_64.pkg.tar.zst.sig2022-01-02 12:24 119
[PGP]jc-1.21.2-1-any.pkg.tar.zst.sig2022-08-30 11:45 119
[PGP]jconvolver-1.1.0-2-x86_64.pkg.tar.zst.sig2021-07-16 19:33 119
[PGP]jitterentropy-3.4.1-1-x86_64.pkg.tar.zst.sig2022-09-02 12:10 119
[PGP]jo-1.6-2-x86_64.pkg.tar.zst.sig2022-04-14 23:59 119
[PGP]john-1.9.0.jumbo1-7-x86_64.pkg.tar.zst.sig2022-06-12 18:37 119
[PGP]juce-7.0.2-1-x86_64.pkg.tar.zst.sig2022-08-16 18:55 119
[PGP]jupyter_console-6.4.4-2-any.pkg.tar.zst.sig2022-07-11 13:05 119
[PGP]jwm-2.4.2-2-x86_64.pkg.tar.zst.sig2022-07-11 13:06 119
[PGP]kak-lsp-14.0.0-1-x86_64.pkg.tar.zst.sig2022-08-29 22:08 119
[PGP]kanshi-1.3.0-1-x86_64.pkg.tar.zst.sig2022-08-24 17:47 119
[PGP]keepalived-2.2.7-1-x86_64.pkg.tar.zst.sig2022-01-16 21:11 119
[PGP]kernelshark-2.1.1-1-x86_64.pkg.tar.zst.sig2022-04-27 11:01 119
[PGP]kicad-6.0.7-1-x86_64.pkg.tar.zst.sig2022-07-26 10:07 119
[PGP]kicad-library-3d-6.0.7-1-any.pkg.tar.zst.sig2022-07-26 10:04 119
[PGP]kicad-library-6.0.7-1-any.pkg.tar.zst.sig2022-07-26 10:04 119
[PGP]klystrack-plus-0.10.0.alpha1-1-x86_64.pkg.tar.zst.sig2022-09-21 10:13 119
[PGP]kodi-19.4-5-x86_64.pkg.tar.zst.sig2022-04-30 15:23 119
[PGP]kodi-addon-audioencoder-lame-1:19.1.2-6-x86_64.pkg.tar.zst.sig2022-04-28 16:48 119
[PGP]kodi-addon-audioencoder-vorbis-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:48 119
[PGP]kodi-addon-audioencoder-wav-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:48 119
[PGP]kodi-addon-game-libretro-19.0.2-5-x86_64.pkg.tar.zst.sig2022-04-28 16:51 119
[PGP]kodi-addon-game-libretro-beetle-psx-0.9.44.40-1-x86_64.pkg.tar.zst.sig2022-07-19 15:47 119
[PGP]kodi-addon-game-libretro-desmume-0.0.1.20-1-x86_64.pkg.tar.zst.sig2022-07-19 15:46 119
[PGP]kodi-addon-game-libretro-flycast-0.1.0.39-8-x86_64.pkg.tar.zst.sig2022-04-28 16:52 119
[PGP]kodi-addon-game-libretro-gambatte-0.5.0.33-1-x86_64.pkg.tar.zst.sig2022-07-19 15:46 119
[PGP]kodi-addon-game-libretro-melonds-0.9.3.29-1-x86_64.pkg.tar.zst.sig2022-07-19 15:46 119
[PGP]kodi-addon-game-libretro-mgba-0.10.0.35-1-x86_64.pkg.tar.zst.sig2022-07-19 15:46 119
[PGP]kodi-addon-game-libretro-mupen64plus-nx-1:2.2.0.22-8-x86_64.pkg.tar.zst.sig2022-04-28 16:53 119
[PGP]kodi-addon-game-libretro-nestopia-1.51.1.26-1-x86_64.pkg.tar.zst.sig2022-07-19 15:46 119
[PGP]kodi-addon-game-libretro-parallel-n64-2.0.0.23-1-x86_64.pkg.tar.zst.sig2022-07-19 15:45 119
[PGP]kodi-addon-game-libretro-scummvm-2.1.1.25-1-x86_64.pkg.tar.zst.sig2022-07-19 15:45 119
[PGP]kodi-addon-game-libretro-snes9x-1.61.0.34-1-x86_64.pkg.tar.zst.sig2022-07-19 15:45 119
[PGP]kodi-addon-game-libretro-yabause-0.9.15.39-1-x86_64.pkg.tar.zst.sig2022-07-19 15:45 119
[PGP]kodi-addon-inputstream-adaptive-19.0.7-1-x86_64.pkg.tar.zst.sig2022-07-06 12:16 119
[PGP]kodi-addon-inputstream-rtmp-19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:55 119
[PGP]kodi-addon-peripheral-joystick-19.0.2-1-x86_64.pkg.tar.zst.sig2022-04-30 15:16 119
[PGP]kodi-addon-screensaver-biogenesis-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:55 119
[PGP]kodi-addon-screensaver-greynetic-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:56 119
[PGP]kodi-addon-screensaver-matrixtrails-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:56 119
[PGP]kodi-addon-screensaver-pingpong-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:56 119
[PGP]kodi-addon-screensaver-pyro-1:19.0.1-6-x86_64.pkg.tar.zst.sig2022-04-28 16:57 119
[PGP]kodi-addon-screensaver-stars-1:19.0.0-10-x86_64.pkg.tar.zst.sig2022-04-28 16:57 119
[PGP]kodi-addon-visualization-projectm-1:19.0.2-6-x86_64.pkg.tar.zst.sig2022-04-28 16:57 119
[PGP]kodi-addon-visualization-shadertoy-1:19.1.2-6-x86_64.pkg.tar.zst.sig2022-04-28 16:57 119
[PGP]kodi-addon-visualization-spectrum-1:19.0.2-1-x86_64.pkg.tar.zst.sig2022-09-21 16:10 119
[PGP]kodi-addon-visualization-waveform-1:19.0.2-6-x86_64.pkg.tar.zst.sig2022-04-28 16:58 119
[PGP]kodi-dev-19.4-5-x86_64.pkg.tar.zst.sig2022-04-30 15:23 119
[PGP]kodi-eventclients-19.4-5-x86_64.pkg.tar.zst.sig2022-04-30 15:23 119
[PGP]kodi-platform-20190726.809c5e9-37-x86_64.pkg.tar.zst.sig2022-04-28 16:47 119
[PGP]kodi-tools-texturepacker-19.4-5-x86_64.pkg.tar.zst.sig2022-04-30 15:23 119
[PGP]kvazaar-2.1.0-3-x86_64.pkg.tar.zst.sig2022-03-12 04:51 119
[PGP]kxstudio-lv2-extensions-2022.02.19-2-any.pkg.tar.zst.sig2022-02-20 11:14 119
[PGP]lablgtk3-3.1.2-3-x86_64.pkg.tar.zst.sig2022-08-09 22:26 119
[PGP]laborejo-2.2.0-1-any.pkg.tar.zst.sig2022-08-02 17:47 119
[PGP]lazarus-2.2.2-3-x86_64.pkg.tar.zst.sig2022-08-02 10:58 119
[PGP]lazarus-gtk2-2.2.2-3-x86_64.pkg.tar.zst.sig2022-08-02 10:58 119
[PGP]lazarus-qt5-2.2.2-3-x86_64.pkg.tar.zst.sig2022-08-02 10:58 119
[PGP]ldc-3:1.30.0-1-x86_64.pkg.tar.zst.sig2022-07-24 16:38 119
[PGP]lego-4.8.0-1-x86_64.pkg.tar.zst.sig2022-07-01 02:10 119
[PGP]leocad-21.06-2-x86_64.pkg.tar.zst.sig2021-06-20 10:50 119
[PGP]lesspipe-2.06-1-any.pkg.tar.zst.sig2022-08-22 15:25 119
[PGP]lf-27-2-x86_64.pkg.tar.zst.sig2022-09-23 10:27 119
[PGP]lhapdf-6.5.3-1-x86_64.pkg.tar.zst.sig2022-09-04 18:14 119
[PGP]libaacs-0.11.1-2-x86_64.pkg.tar.zst.sig2022-03-04 15:10 119
[PGP]libabigail-2.0-2-x86_64.pkg.tar.zst.sig2022-04-09 23:00 119
[PGP]libad9361-0.2-7-x86_64.pkg.tar.zst.sig2022-07-11 17:50 119
[PGP]libbobcat-5.11.00-2-x86_64.pkg.tar.zst.sig2022-09-05 00:25 119
[PGP]libcalfbox-lss-1.1.0-1-x86_64.pkg.tar.zst.sig2022-07-20 11:45 119
[PGP]libcec-6.0.2-3-x86_64.pkg.tar.zst.sig2022-02-19 16:50 119
[PGP]libck-0.7.1-1-x86_64.pkg.tar.zst.sig2021-06-09 16:57 119
[PGP]libconfig-1.7.3-1-x86_64.pkg.tar.zst.sig2021-06-20 14:16 119
[PGP]libcpuid-0.5.1-2-x86_64.pkg.tar.zst.sig2021-11-02 02:37 119
[PGP]libdnet-1.16.1-1-x86_64.pkg.tar.zst.sig2022-05-18 09:09 119
[PGP]libdwarf-1:0.4.0-1-x86_64.pkg.tar.zst.sig2022-05-11 11:05 119
[PGP]libemf-1.0.13-2-x86_64.pkg.tar.zst.sig2022-01-29 16:05 119
[PGP]libffado-2.4.6-1-x86_64.pkg.tar.zst.sig2022-07-12 21:56 119
[PGP]libfixposix-0.4.3-1-x86_64.pkg.tar.zst.sig2022-04-16 09:30 119
[PGP]libgig-4.3.0-3-x86_64.pkg.tar.zst.sig2021-06-03 00:10 119
[PGP]libguestfs-1.48.4-2-x86_64.pkg.tar.zst.sig2022-08-09 22:28 119
[PGP]libiconv-1.17-1-x86_64.pkg.tar.zst.sig2022-05-25 02:59 119
[PGP]libiio-0.24-1-x86_64.pkg.tar.zst.sig2022-07-09 12:51 119
[PGP]libilbc-3.0.4-2-x86_64.pkg.tar.zst.sig2022-01-29 16:08 119
[PGP]libimagequant-4.0.1-1-x86_64.pkg.tar.zst.sig2022-08-08 09:42 119
[PGP]libiodbc-3.52.15-1-x86_64.pkg.tar.zst.sig2021-06-10 11:34 119
[PGP]libjxl-0.7.0-2-x86_64.pkg.tar.zst.sig2022-09-21 23:30 119
[PGP]libjxl-doc-0.7.0-2-x86_64.pkg.tar.zst.sig2022-09-21 23:31 119
[PGP]liblo-1:0.31-2-x86_64.pkg.tar.zst.sig2022-03-13 18:28 119
[PGP]liblphobos-3:1.30.0-1-x86_64.pkg.tar.zst.sig2022-07-24 16:38 119
[PGP]liblscp-0.9.6-1-x86_64.pkg.tar.zst.sig2022-04-04 14:28 119
[PGP]libltc-1.3.2-1-x86_64.pkg.tar.zst.sig2022-09-04 19:43 119
[PGP]liblxqt-1.1.0-3-x86_64.pkg.tar.zst.sig2022-05-08 14:14 119
[PGP]liblzf-3.6-3-x86_64.pkg.tar.zst.sig2021-10-11 18:46 119
[PGP]libmaxminddb-1.6.0-3-x86_64.pkg.tar.zst.sig2022-02-28 12:36 119
[PGP]libmediainfo-22.06-1-x86_64.pkg.tar.zst.sig2022-06-24 01:05 119
[PGP]libmfx-22.4.4-1-x86_64.pkg.tar.zst.sig2022-07-03 03:58 119
[PGP]libmilter-8.17.1-1-x86_64.pkg.tar.zst.sig2021-08-18 03:20 119
[PGP]libmodsecurity-1:3.0.8-1-x86_64.pkg.tar.zst.sig2022-09-09 01:34 119
[PGP]libmupdf-1.20.3-1-x86_64.pkg.tar.zst.sig2022-09-04 21:51 119
[PGP]libmusicxml-3.22-1-x86_64.pkg.tar.zst.sig2022-06-27 11:55 119
[PGP]libmysofa-1.2.1-2-x86_64.pkg.tar.zst.sig2022-01-29 16:11 119
[PGP]libnfs-5.0.2-1-x86_64.pkg.tar.zst.sig2022-08-11 13:22 119
[PGP]libopenshot-audio-0.2.2-1-x86_64.pkg.tar.zst.sig2021-09-13 22:33 119
[PGP]libp11-0.4.12-1-x86_64.pkg.tar.zst.sig2022-08-05 12:32 119
[PGP]libpackagekit-glib-1.2.5-1-x86_64.pkg.tar.zst.sig2022-02-17 21:16 119
[PGP]libperconaserverclient-8.0.29_21-2-x86_64.pkg.tar.zst.sig2022-09-21 12:58 119
[PGP]libphobos-1:2.100.1-1-x86_64.pkg.tar.zst.sig2022-08-20 12:18 119
[PGP]librecad-2.1.3-6-x86_64.pkg.tar.zst.sig2021-06-10 21:47 119
[PGP]libsbsms-2.3.0-3-x86_64.pkg.tar.zst.sig2022-07-24 01:34 119
[PGP]libspecbleach-0.1.6-1-x86_64.pkg.tar.zst.sig2022-05-19 22:49 119
[PGP]libspf2-1.2.11-1-x86_64.pkg.tar.zst.sig2021-11-22 07:23 119
[PGP]libsvm-3.25-4-x86_64.pkg.tar.zst.sig2022-01-29 16:20 119
[PGP]libsysstat-0.4.6-1-x86_64.pkg.tar.zst.sig2021-11-06 09:01 119
[PGP]libtermkey-0.22-2-x86_64.pkg.tar.zst.sig2020-06-07 21:16 119
[PGP]libtraceevent-1:1.6.3-1-x86_64.pkg.tar.zst.sig2022-09-24 10:34 119
[PGP]libtraceevent-docs-1:1.6.3-1-x86_64.pkg.tar.zst.sig2022-09-24 10:34 119
[PGP]libtracefs-1.5.0-1-x86_64.pkg.tar.zst.sig2022-09-24 10:42 119
[PGP]libtracefs-docs-1.5.0-1-x86_64.pkg.tar.zst.sig2022-09-24 10:42 119
[PGP]libusbsio-2.1.11-1-x86_64.pkg.tar.zst.sig2022-03-09 19:10 119
[PGP]libvarlink-23-1-x86_64.pkg.tar.zst.sig2022-01-19 10:11 119
[PGP]libvirt-dbus-1.4.1-2-x86_64.pkg.tar.zst.sig2022-02-28 12:30 119
[PGP]libvirt-glib-4.0.0-2-x86_64.pkg.tar.zst.sig2022-07-11 22:10 119
[PGP]libvterm01-0.1.4-2-x86_64.pkg.tar.zst.sig2022-04-18 14:38 119
[PGP]libzen-0.4.39-1-x86_64.pkg.tar.zst.sig2021-06-20 01:14 119
[PGP]light-1.2.2-3-x86_64.pkg.tar.zst.sig2022-02-24 22:44 119
[PGP]lightdm-webkit2-greeter-2.2.5-6-x86_64.pkg.tar.zst.sig2022-04-22 23:55 119
[PGP]lilv-0.24.20-1-x86_64.pkg.tar.zst.sig2022-09-12 17:13 119
[PGP]lilv-docs-0.24.20-1-x86_64.pkg.tar.zst.sig2022-09-12 17:13 119
[PGP]lilypond-2.22.2-2-x86_64.pkg.tar.zst.sig2022-02-24 12:42 119
[PGP]linux-tools-meta-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]linuxsampler-2.2.0-2-x86_64.pkg.tar.zst.sig2021-06-03 19:00 119
[PGP]liquidsfz-0.3.1-1-x86_64.pkg.tar.zst.sig2022-07-26 11:05 119
[PGP]livecd-sounds-1.0-1-any.pkg.tar.zst.sig2020-10-06 19:36 119
[PGP]lldpd-1.0.14-1-x86_64.pkg.tar.zst.sig2022-05-22 21:39 119
[PGP]lout-3.42.1-1-x86_64.pkg.tar.zst.sig2022-03-18 09:15 119
[PGP]lowdown-1.0.0-1-x86_64.pkg.tar.zst.sig2022-05-29 04:00 119
[PGP]lsp-plugins-1.2.3-1-x86_64.pkg.tar.zst.sig2022-09-07 13:37 119
[PGP]lsp-plugins-docs-1.2.3-1-x86_64.pkg.tar.zst.sig2022-09-07 13:37 119
[PGP]ltris-1.2.5-1-x86_64.pkg.tar.zst.sig2022-07-05 11:57 119
[PGP]luppp-1.2.1-3-x86_64.pkg.tar.zst.sig2022-04-13 13:48 119
[PGP]lv2-docs-1.18.10-1-x86_64.pkg.tar.zst.sig2022-09-10 10:28 119
[PGP]lv2-example-plugins-1.18.10-1-x86_64.pkg.tar.zst.sig2022-09-10 10:28 119
[PGP]lv2file-0.95-1-x86_64.pkg.tar.zst.sig2022-02-24 12:38 119
[PGP]lv2lint-0.16.2-1-x86_64.pkg.tar.zst.sig2022-04-16 01:36 119
[PGP]lvtk-1.2.0-3-x86_64.pkg.tar.zst.sig2021-12-29 14:17 119
[PGP]lxd-5.6-1-x86_64.pkg.tar.zst.sig2022-09-24 09:41 119
[PGP]lximage-qt-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:54 119
[PGP]lxqt-about-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:54 119
[PGP]lxqt-admin-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:54 119
[PGP]lxqt-archiver-0.6.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:54 119
[PGP]lxqt-build-tools-0.11.0-1-any.pkg.tar.zst.sig2022-04-16 16:48 119
[PGP]lxqt-config-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:55 119
[PGP]lxqt-globalkeys-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:55 119
[PGP]lxqt-notificationd-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:55 119
[PGP]lxqt-openssh-askpass-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:56 119
[PGP]lxqt-panel-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:58 119
[PGP]lxqt-policykit-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:56 119
[PGP]lxqt-powermanagement-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:58 119
[PGP]lxqt-qtplugin-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:53 119
[PGP]lxqt-runner-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:58 119
[PGP]lxqt-session-1.1.1-1-x86_64.pkg.tar.zst.sig2022-05-08 14:08 119
[PGP]lxqt-sudo-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:57 119
[PGP]lxqt-themes-1.1.0-1-any.pkg.tar.zst.sig2022-04-16 16:52 119
[PGP]mac-8.81-1-x86_64.pkg.tar.zst.sig2022-09-19 00:24 119
[PGP]mailman-web-0.0.5-5-any.pkg.tar.zst.sig2022-08-12 22:12 119
[PGP]mailman3-3.3.5-6-any.pkg.tar.zst.sig2022-08-04 00:09 119
[PGP]marsyas-0.5.0-9-x86_64.pkg.tar.zst.sig2021-12-29 14:08 119
[PGP]matrix-appservice-irc-0.35.1-1-x86_64.pkg.tar.zst.sig2022-09-26 21:49 119
[PGP]maturin-0.13.3-1-x86_64.pkg.tar.zst.sig2022-09-15 23:07 119
[PGP]maturin-0.13.5-1-x86_64.pkg.tar.zst.sig2022-09-27 12:27 119
[PGP]mc-4.8.28-1-x86_64.pkg.tar.zst.sig2022-03-27 20:28 119
[PGP]mda.lv2-1.2.10-1-x86_64.pkg.tar.zst.sig2022-08-14 19:15 119
[PGP]mdbook-linkcheck-0.7.6-2-x86_64.pkg.tar.zst.sig2022-03-30 23:42 119
[PGP]mdk4-4.2-1-x86_64.pkg.tar.zst.sig2021-07-08 23:47 119
[PGP]mediathekview-13.9.1-1-any.pkg.tar.zst.sig2022-07-20 10:20 119
[PGP]mellite-3.13.4-1-any.pkg.tar.zst.sig2022-09-04 19:20 119
[PGP]mephisto.lv2-0.18.2-1-x86_64.pkg.tar.zst.sig2022-04-16 01:34 119
[PGP]midi_matrix.lv2-0.28.0-1-x86_64.pkg.tar.zst.sig2021-01-15 10:36 119
[PGP]midimsg-lv2-0.0.5-1-x86_64.pkg.tar.xz.sig2019-12-28 12:52 119
[PGP]miller-6.4.0-1-x86_64.pkg.tar.zst.sig2022-08-21 09:44 119
[PGP]mimalloc-2.0.6-1-x86_64.pkg.tar.zst.sig2022-04-15 09:10 119
[PGP]mimir-2.3.0-1-x86_64.pkg.tar.zst.sig2022-09-24 10:08 119
[PGP]miniflux-2.0.38-1-x86_64.pkg.tar.zst.sig2022-08-14 09:41 119
[PGP]minitube-3.9.3-1-x86_64.pkg.tar.zst.sig2022-02-03 18:14 119
[PGP]mkinitcpio-systemd-tool-37-1-any.pkg.tar.zst.sig2021-11-13 22:40 119
[PGP]mkosi-13-1-any.pkg.tar.zst.sig2022-06-23 10:31 119
[PGP]mmdblookup-1.6.0-3-x86_64.pkg.tar.zst.sig2022-02-28 12:36 119
[PGP]mod-lv2-extensions-2022.09.25-1-any.pkg.tar.zst.sig2022-09-25 20:39 119
[PGP]mold-1.5.0-1-x86_64.pkg.tar.zst.sig2022-09-27 09:57 119
[PGP]molecule-4.0.1-1-any.pkg.tar.zst.sig2022-07-21 10:00 119
[PGP]molecule-docker-2.0.0-1-any.pkg.tar.zst.sig2022-07-19 23:54 119
[PGP]molecule-podman-2.0.1-1-any.pkg.tar.zst.sig2022-07-21 09:59 119
[PGP]molecule-vagrant-1.0.0-2-any.pkg.tar.zst.sig2022-02-21 16:31 119
[PGP]moony.lv2-0.40.0-1-x86_64.pkg.tar.zst.sig2021-07-16 19:38 119
[PGP]msgpack-c-4.0.0-1-x86_64.pkg.tar.zst.sig2021-09-01 13:55 119
[PGP]msgpack-cxx-4.1.2-1-any.pkg.tar.zst.sig2022-09-23 15:45 119
[PGP]mujs-1.2.0-2-x86_64.pkg.tar.zst.sig2022-01-29 16:23 119
[PGP]multimon-ng-1.1.9-2-x86_64.pkg.tar.zst.sig2022-04-23 00:08 119
[PGP]multipath-tools-0.9.1-1-x86_64.pkg.tar.zst.sig2022-09-07 15:03 119
[PGP]mupdf-1.20.3-1-x86_64.pkg.tar.zst.sig2022-09-04 21:51 119
[PGP]mupdf-gl-1.20.3-1-x86_64.pkg.tar.zst.sig2022-09-04 21:51 119
[PGP]mupdf-tools-1.20.3-1-x86_64.pkg.tar.zst.sig2022-09-04 21:51 119
[PGP]muse-4.1.0-1-x86_64.pkg.tar.zst.sig2022-04-17 22:15 119
[PGP]mustache-d-0.1.5-7-x86_64.pkg.tar.zst.sig2022-07-24 16:41 119
[PGP]mxml-3.3.1-1-x86_64.pkg.tar.zst.sig2022-07-26 11:56 119
[PGP]mxml-docs-3.3.1-1-x86_64.pkg.tar.zst.sig2022-07-26 11:56 119
[PGP]mysql-workbench-8.0.30-2-x86_64.pkg.tar.zst.sig2022-09-05 09:53 119
[PGP]nbd-3.24-1-x86_64.pkg.tar.zst.sig2022-03-07 14:48 119
[PGP]nbtscan-1.7.2-1-x86_64.pkg.tar.zst.sig2022-01-13 17:51 119
[PGP]nccl-2.14.3-1-x86_64.pkg.tar.zst.sig2022-08-22 15:13 119
[PGP]nerdctl-0.23.0-1-x86_64.pkg.tar.zst.sig2022-09-12 03:08 119
[PGP]netavark-1.1.0-1-x86_64.pkg.tar.zst.sig2022-07-31 12:58 119
[PGP]nethack-3.6.6-2-x86_64.pkg.tar.zst.sig2021-12-30 13:25 119
[PGP]new-session-manager-1.6.0-1-x86_64.pkg.tar.zst.sig2022-04-15 12:08 119
[PGP]nextcloud-24.0.5-1-any.pkg.tar.zst.sig2022-09-09 11:43 119
[PGP]nextcloud-app-bookmarks-1:11.0.3-1-any.pkg.tar.zst.sig2022-09-24 21:19 119
[PGP]nextcloud-app-contacts-4.2.1-1-any.pkg.tar.zst.sig2022-09-24 10:14 119
[PGP]nextcloud-app-deck-1:1.7.0-2-any.pkg.tar.zst.sig2022-05-08 22:06 119
[PGP]nextcloud-app-mail-1.13.8-1-any.pkg.tar.zst.sig2022-08-14 17:55 119
[PGP]nextcloud-app-news-18.1.1-1-any.pkg.tar.zst.sig2022-08-12 22:06 119
[PGP]nextcloud-app-notes-4.5.1-1-any.pkg.tar.zst.sig2022-09-04 20:04 119
[PGP]nextcloud-app-spreed-1:14.0.5-1-any.pkg.tar.zst.sig2022-09-15 23:24 119
[PGP]nextcloud-app-tasks-0.14.4-2-any.pkg.tar.zst.sig2022-05-08 22:40 119
[PGP]nginx-mod-geoip2-3.4-1-x86_64.pkg.tar.zst.sig2022-06-23 20:12 119
[PGP]nginx-mod-headers-more-0.34-1-x86_64.pkg.tar.zst.sig2022-07-20 09:39 119
[PGP]nginx-mod-naxsi-1.3-7-x86_64.pkg.tar.zst.sig2022-09-21 17:30 119
[PGP]nginx-mod-njs-0.7.7-1-x86_64.pkg.tar.zst.sig2022-08-31 12:48 119
[PGP]ngspice-37-2-x86_64.pkg.tar.zst.sig2022-07-11 13:09 119
[PGP]nikola-8.2.3-1-any.pkg.tar.zst.sig2022-08-02 17:36 119
[PGP]ninjas2-0.2.0-2-x86_64.pkg.tar.zst.sig2020-10-17 12:26 119
[PGP]nix-2.11.1-1-x86_64.pkg.tar.zst.sig2022-09-19 01:09 119
[PGP]nix-busybox-1.35.0-1-x86_64.pkg.tar.zst.sig2022-05-31 05:29 119
[PGP]nix-docs-2.11.1-1-x86_64.pkg.tar.zst.sig2022-09-19 01:09 119
[PGP]nlohmann-json-3.11.2-1-any.pkg.tar.zst.sig2022-08-12 22:10 119
[PGP]nmon-16n-2-x86_64.pkg.tar.zst.sig2022-02-28 12:31 119
[PGP]noise-repellent-0.2.3-1-x86_64.pkg.tar.zst.sig2022-05-20 19:38 119
[PGP]nomad-1.3.5-1-x86_64.pkg.tar.zst.sig2022-09-02 10:20 119
[PGP]nomad-driver-containerd-0.9.3-2-x86_64.pkg.tar.zst.sig2022-04-29 02:11 119
[PGP]nomad-driver-lxc-0.3.0-3-x86_64.pkg.tar.zst.sig2022-04-29 02:12 119
[PGP]nomad-driver-nspawn-0.9.1-1-x86_64.pkg.tar.zst.sig2022-06-21 04:25 119
[PGP]nomad-driver-podman-0.4.0-1-x86_64.pkg.tar.zst.sig2022-07-17 10:09 119
[PGP]non-mixer-1.3.0-4-x86_64.pkg.tar.zst.sig2022-03-13 12:11 119
[PGP]non-sequencer-1.10.0-2-x86_64.pkg.tar.zst.sig2022-03-13 12:07 119
[PGP]non-timeline-1.3.0-4-x86_64.pkg.tar.zst.sig2022-03-13 12:11 119
[PGP]ntk-1.3.1001-1-x86_64.pkg.tar.zst.sig2021-05-26 21:16 119
[PGP]nvchecker-2.9-2-any.pkg.tar.zst.sig2022-07-16 13:49 119
[PGP]nyxt-2.2.4-3-x86_64.pkg.tar.zst.sig2022-04-16 09:34 119
[PGP]oath-toolkit-2.6.7-1-x86_64.pkg.tar.zst.sig2021-05-02 22:33 119
[PGP]ob-xd-2.9-1-x86_64.pkg.tar.zst.sig2022-09-19 10:11 119
[PGP]obconf-qt-0.16.2-1-x86_64.pkg.tar.zst.sig2022-03-11 18:29 119
[PGP]obs-studio-27.2.4-2-x86_64.pkg.tar.zst.sig2022-07-11 22:38 119
[PGP]ocaml-base-0.15.0-2-x86_64.pkg.tar.zst.sig2022-08-09 22:29 119
[PGP]ocaml-cairo-0.6.3-2-x86_64.pkg.tar.zst.sig2022-08-09 22:30 119
[PGP]ocaml-csexp-1.5.1-5-x86_64.pkg.tar.zst.sig2022-08-09 22:30 119
[PGP]ocaml-findlib-1.9.5-2-x86_64.pkg.tar.zst.sig2022-08-09 22:30 119
[PGP]ocaml-hashcons-1.3-5-x86_64.pkg.tar.zst.sig2022-08-09 22:31 119
[PGP]ocaml-lablgl-1.06-12-x86_64.pkg.tar.zst.sig2022-08-09 22:31 119
[PGP]ocaml-num-1.4-6-x86_64.pkg.tar.zst.sig2022-08-09 22:31 119
[PGP]ocaml-pp-1.1.2-3-x86_64.pkg.tar.zst.sig2022-08-09 22:32 119
[PGP]ocaml-ppx_derivers-1.2.1-9-x86_64.pkg.tar.zst.sig2022-08-09 22:32 119
[PGP]ocaml-sexplib0-0.15.1-2-x86_64.pkg.tar.zst.sig2022-08-09 22:33 119
[PGP]ocaml-stdio-0.15.0-2-x86_64.pkg.tar.zst.sig2022-08-09 22:33 119
[PGP]ocaml-stdlib-shims-0.3.0-5-x86_64.pkg.tar.zst.sig2022-08-09 22:33 119
[PGP]ocaml-zarith-1.12-5-x86_64.pkg.tar.zst.sig2022-08-09 22:34 119
[PGP]ocamlbuild-0.14.1-2-x86_64.pkg.tar.zst.sig2022-08-09 22:29 119
[PGP]odin2-synthesizer-2.3.4-1-x86_64.pkg.tar.zst.sig2022-09-20 04:15 119
[PGP]oil-0.12.6-1-x86_64.pkg.tar.zst.sig2022-09-24 10:03 119
[PGP]oniguruma-6.9.8-1-x86_64.pkg.tar.zst.sig2022-04-29 14:24 119
[PGP]open-isns-0.102-1-x86_64.pkg.tar.zst.sig2022-09-08 21:13 119
[PGP]open-vm-tools-6:12.1.0-1-x86_64.pkg.tar.zst.sig2022-08-24 08:41 119
[PGP]openapi-diff-2.0.1-1-any.pkg.tar.zst.sig2021-12-29 22:29 119
[PGP]openapi-generator-6.2.0-1-any.pkg.tar.zst.sig2022-09-24 20:01 119
[PGP]openbox-3.6.1-8-x86_64.pkg.tar.zst.sig2021-09-19 06:59 119
[PGP]opencascade-1:7.5.3-3-x86_64.pkg.tar.zst.sig2022-04-04 10:24 119
[PGP]openfire-4.7.3-1-any.pkg.tar.zst.sig2022-08-02 14:14 119
[PGP]openh264-2.3.1-1-x86_64.pkg.tar.zst.sig2022-09-21 19:05 119
[PGP]openocd-1:0.11.0-2-x86_64.pkg.tar.zst.sig2022-04-23 00:18 119
[PGP]openshot-2.6.1-5-any.pkg.tar.zst.sig2021-12-18 14:08 119
[PGP]opensubdiv-3.4.4-11-x86_64.pkg.tar.zst.sig2022-05-17 23:10 119
[PGP]openui5-1.106.0-1-any.pkg.tar.zst.sig2022-09-23 16:34 119
[PGP]openvr-1.16.8-2-x86_64.pkg.tar.zst.sig2021-12-20 23:55 119
[PGP]opera-91.0.4516.20-1-x86_64.pkg.tar.zst.sig2022-09-21 16:11 119
[PGP]opera-ffmpeg-codecs-104.0.5112.102-1-x86_64.pkg.tar.zst.sig2022-08-23 16:51 119
[PGP]opnplug-1.0.2-5-x86_64.pkg.tar.zst.sig2022-08-09 13:21 119
[PGP]oscpack-1.1.0-2-x86_64.pkg.tar.zst.sig2020-07-10 21:48 119
[PGP]osmid-0.8.0-1-x86_64.pkg.tar.zst.sig2020-09-22 19:03 119
[PGP]ospray-2.10.0-4-x86_64.pkg.tar.zst.sig2022-08-02 14:09 119
[PGP]otf-cascadia-code-2111.01-1-any.pkg.tar.zst.sig2021-12-30 09:34 119
[PGP]otf-overpass-3.0.5-1-any.pkg.tar.zst.sig2022-01-06 11:45 119
[PGP]packagekit-1.2.5-1-x86_64.pkg.tar.zst.sig2022-02-17 21:16 119
[PGP]pacredir-0.4.6-1-x86_64.pkg.tar.zst.sig2022-09-26 10:37 119
[PGP]padthv1-0.9.26-1-x86_64.pkg.tar.zst.sig2022-06-07 17:53 119
[PGP]pam-krb5-4.11-2-x86_64.pkg.tar.zst.sig2022-07-11 22:41 119
[PGP]pam-u2f-1.2.1-1-x86_64.pkg.tar.zst.sig2022-05-23 15:58 119
[PGP]par2cmdline-0.8.1-2-x86_64.pkg.tar.zst.sig2022-03-04 15:19 119
[PGP]parallel-20220922-1-any.pkg.tar.zst.sig2022-09-24 01:48 119
[PGP]parallel-docs-20220922-1-any.pkg.tar.zst.sig2022-09-24 01:48 119
[PGP]partclone-0.3.20-2-x86_64.pkg.tar.zst.sig2022-07-11 22:39 119
[PGP]pass-1.7.4-3-any.pkg.tar.zst.sig2022-07-29 19:30 119
[PGP]pastel-0.9.0-1-x86_64.pkg.tar.zst.sig2022-05-29 04:16 119
[PGP]pastel-docs-0.9.0-1-x86_64.pkg.tar.zst.sig2022-05-29 04:16 119
[PGP]pasystray-0.8.0-2-x86_64.pkg.tar.zst.sig2022-04-23 00:21 119
[PGP]patchage-1.0.10-1-x86_64.pkg.tar.zst.sig2022-09-13 14:46 119
[PGP]patchmatrix-0.26.0-1-x86_64.pkg.tar.zst.sig2021-07-16 19:43 119
[PGP]patroneo-2.3.2-1-any.pkg.tar.zst.sig2022-04-17 21:30 119
[PGP]pavucontrol-qt-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:53 119
[PGP]pax-20201030-2-x86_64.pkg.tar.zst.sig2022-01-29 16:30 119
[PGP]pc-ble-driver-4.1.4-4-x86_64.pkg.tar.zst.sig2022-08-09 13:27 119
[PGP]pcmanfm-qt-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:57 119
[PGP]pcp-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-gui-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-activemq-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-bcc-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-bind2-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-bpftrace-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-libvirt-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-mysql-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-nginx-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-nutcracker-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-openmetrics-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-podman-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-postgresql-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcp-pmda-snmp-6.0.0-1-x86_64.pkg.tar.zst.sig2022-09-02 13:28 119
[PGP]pcsc-tools-1.6.0-1-x86_64.pkg.tar.zst.sig2022-08-12 16:41 119
[PGP]pd-0.52.2-1-x86_64.pkg.tar.zst.sig2022-04-04 11:00 119
[PGP]pd-gem-0.94-10-x86_64.pkg.tar.zst.sig2022-02-19 13:20 119
[PGP]pd-lua-0.10.1-1-x86_64.pkg.tar.zst.sig2020-07-24 23:31 119
[PGP]pdfmod-0.9.1-12-any.pkg.tar.zst.sig2022-04-08 14:25 119
[PGP]peco-0.5.10-4-x86_64.pkg.tar.zst.sig2022-04-29 04:02 119
[PGP]percona-server-8.0.29_21-2-x86_64.pkg.tar.zst.sig2022-09-21 12:58 119
[PGP]percona-server-clients-8.0.29_21-2-x86_64.pkg.tar.zst.sig2022-09-21 12:58 119
[PGP]percona-toolkit-3.4.0-1-x86_64.pkg.tar.zst.sig2022-07-12 19:30 119
[PGP]perf-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]perl-goocanvas2-0.06-5-any.pkg.tar.zst.sig2022-07-11 23:52 119
[PGP]perl-json-maybexs-1.004003-4-any.pkg.tar.zst.sig2022-07-11 23:52 119
[PGP]perl-locale-codes-3.72-1-any.pkg.tar.zst.sig2022-09-05 23:25 119
[PGP]perl-text-unidecode-1.30-3-x86_64.pkg.tar.zst.sig2020-10-10 12:10 119
[PGP]pesign-113-1-x86_64.pkg.tar.zst.sig2020-05-18 23:00 119
[PGP]pgcli-3.5.0-1-any.pkg.tar.zst.sig2022-09-16 03:56 119
[PGP]pgformatter-5.3-1-any.pkg.tar.zst.sig2022-08-08 04:20 119
[PGP]php-grpc-1.48.0-1-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]php-igbinary-3.2.7-2-x86_64.pkg.tar.zst.sig2022-01-19 22:19 119
[PGP]php-imagick-3.7.0-2-x86_64.pkg.tar.zst.sig2022-01-14 20:54 119
[PGP]php-mongodb-1.14.1-1-x86_64.pkg.tar.zst.sig2022-09-12 10:40 119
[PGP]php-redis-5.3.7-1-x86_64.pkg.tar.zst.sig2022-02-16 00:03 119
[PGP]php7-grpc-1.48.0-1-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]php7-igbinary-3.2.7-2-x86_64.pkg.tar.zst.sig2022-01-19 22:19 119
[PGP]php7-imagick-3.7.0-2-x86_64.pkg.tar.zst.sig2022-01-14 20:54 119
[PGP]php7-mongodb-1.14.1-1-x86_64.pkg.tar.zst.sig2022-09-12 10:40 119
[PGP]php7-redis-5.3.7-1-x86_64.pkg.tar.zst.sig2022-02-16 00:03 119
[PGP]picard-2.8.3-1-x86_64.pkg.tar.zst.sig2022-08-23 16:00 119
[PGP]pigz-2.7-2-x86_64.pkg.tar.zst.sig2022-07-11 22:39 119
[PGP]pipe-rename-1.5.0-1-x86_64.pkg.tar.zst.sig2022-07-10 10:48 119
[PGP]pixz-1.0.7-3-x86_64.pkg.tar.zst.sig2022-07-11 22:39 119
[PGP]playerctl-2.4.1-2-x86_64.pkg.tar.zst.sig2022-02-25 10:13 119
[PGP]plowshare-2.1.7-6-any.pkg.tar.zst.sig2020-12-03 14:01 119
[PGP]pngquant-2.17.0-2-x86_64.pkg.tar.zst.sig2022-02-28 12:38 119
[PGP]podman-4.2.1-1-x86_64.pkg.tar.zst.sig2022-09-08 08:55 119
[PGP]podman-compose-1.0.3-2-any.pkg.tar.zst.sig2022-05-06 20:31 119
[PGP]podman-docker-4.2.1-1-x86_64.pkg.tar.zst.sig2022-09-08 08:55 119
[PGP]postfixadmin-3.3.11-1-any.pkg.tar.zst.sig2022-03-10 11:17 119
[PGP]postorius-1.3.6-3-any.pkg.tar.zst.sig2022-02-20 16:14 119
[PGP]prjtrellis-db-r262.f7f8375-2-x86_64.pkg.tar.zst.sig2022-04-23 00:24 119
[PGP]prjxray-db-r225.1a4ee7c-2-x86_64.pkg.tar.zst.sig2022-04-23 00:26 119
[PGP]profile-cleaner-2.44-1-any.pkg.tar.zst.sig2021-11-21 13:32 119
[PGP]profile-sync-daemon-1:6.48-1-any.pkg.tar.zst.sig2022-09-10 16:00 119
[PGP]ps_mem-3.14-2-any.pkg.tar.zst.sig2022-07-11 13:09 119
[PGP]pybind11-2.10.0-1-any.pkg.tar.zst.sig2022-07-16 14:27 119
[PGP]pyenv-2.3.4-1-any.pkg.tar.zst.sig2022-09-04 19:53 119
[PGP]pypiserver-1.5.0-1-any.pkg.tar.zst.sig2022-05-02 14:46 119
[PGP]pythia8-8.3.07-4-x86_64.pkg.tar.zst.sig2022-03-06 11:00 119
[PGP]python-acme-1.30.0-1-any.pkg.tar.zst.sig2022-09-12 00:54 119
[PGP]python-aiobotocore-2.4.0-1-any.pkg.tar.zst.sig2022-08-25 13:58 119
[PGP]python-aioitertools-0.11.0-1-any.pkg.tar.zst.sig2022-09-18 09:23 119
[PGP]python-ansible-compat-2.2.1-1-any.pkg.tar.zst.sig2022-09-24 10:48 119
[PGP]python-antlr4-4.11.1-1-any.pkg.tar.zst.sig2022-09-05 01:02 119
[PGP]python-anyio-3.6.1-1-any.pkg.tar.zst.sig2022-05-14 08:38 119
[PGP]python-apptools-5.2.0-1-any.pkg.tar.zst.sig2022-09-05 04:07 119
[PGP]python-argparse-addons-0.8.0-1-any.pkg.tar.zst.sig2022-04-22 16:23 119
[PGP]python-atpublic-3.1.1-1-any.pkg.tar.zst.sig2022-09-04 20:04 119
[PGP]python-aubio-0.4.9-14-x86_64.pkg.tar.zst.sig2022-06-09 00:53 119
[PGP]python-authheaders-0.15.1-1-any.pkg.tar.zst.sig2022-04-22 16:26 119
[PGP]python-awkward-1.10.1-1-x86_64.pkg.tar.zst.sig2022-09-23 16:20 119
[PGP]python-aws-sam-translator-1.51.0-1-any.pkg.tar.zst.sig2022-09-15 16:55 119
[PGP]python-aws-xray-sdk-2.10.0-1-any.pkg.tar.zst.sig2022-07-02 11:30 119
[PGP]python-babelfish-0.6.0-2-any.pkg.tar.zst.sig2022-09-23 10:49 119
[PGP]python-bincopy-17.14.0-1-any.pkg.tar.zst.sig2022-09-24 13:54 119
[PGP]python-blosc-1.10.6-5-x86_64.pkg.tar.zst.sig2022-04-08 12:57 119
[PGP]python-boolean.py-4.0-1-any.pkg.tar.zst.sig2022-05-07 09:01 119
[PGP]python-boost-histogram-1.3.2-1-x86_64.pkg.tar.zst.sig2022-09-23 16:33 119
[PGP]python-bowler-0.9.0-5-any.pkg.tar.zst.sig2021-12-04 00:50 119
[PGP]python-breathe-4.34.0-1-any.pkg.tar.zst.sig2022-06-25 22:50 119
[PGP]python-buildbot-badges-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-buildbot-console-view-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-buildbot-grid-view-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-buildbot-waterfall-view-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-buildbot-wsgi-dashboards-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-buildbot-www-3.6.1-1-any.pkg.tar.zst.sig2022-09-23 17:03 119
[PGP]python-cachecontrol-1:0.12.11-1-any.pkg.tar.zst.sig2022-09-01 12:37 119
[PGP]python-cbor2-5.4.3-2-x86_64.pkg.tar.zst.sig2022-06-14 14:18 119
[PGP]python-certifi-2022.09.24-1-any.pkg.tar.zst.sig2022-09-25 14:16 119
[PGP]python-cfn-lint-0.65.1-1-any.pkg.tar.zst.sig2022-09-20 17:42 119
[PGP]python-cheetah3-3.3.0a1-1-x86_64.pkg.tar.zst.sig2022-09-26 09:12 119
[PGP]python-cheetah3-docs-3.3.0a1-1-x86_64.pkg.tar.zst.sig2022-09-26 09:12 119
[PGP]python-cheroot-8.6.0-2-any.pkg.tar.zst.sig2022-06-08 12:23 119
[PGP]python-cleo-1.0.0a5-2-any.pkg.tar.zst.sig2022-09-02 18:36 119
[PGP]python-cli_helpers-2.2.1-2-any.pkg.tar.zst.sig2022-04-20 09:59 119
[PGP]python-click-command-tree-1.1.0-1-any.pkg.tar.zst.sig2022-07-31 20:01 119
[PGP]python-click-option-group-0.5.3-2-any.pkg.tar.zst.sig2022-01-20 20:04 119
[PGP]python-cmsis-pack-manager-0.4.0-3-x86_64.pkg.tar.zst.sig2022-02-08 21:40 119
[PGP]python-cookiecutter-2.1.1-1-any.pkg.tar.zst.sig2022-06-07 14:17 119
[PGP]python-coverage-conditional-plugin-0.7.0-1-any.pkg.tar.zst.sig2022-09-26 18:55 119
[PGP]python-cpplint-1.6.1-1-any.pkg.tar.zst.sig2022-08-22 15:16 119
[PGP]python-crcmod-1.7-4-x86_64.pkg.tar.zst.sig2022-01-20 20:34 119
[PGP]python-cuda-11.7.1-1-x86_64.pkg.tar.zst.sig2022-08-06 16:42 119
[PGP]python-cuda-docs-11.7.1-1-x86_64.pkg.tar.zst.sig2022-08-06 16:42 119
[PGP]python-curtsies-0.3.10-2-any.pkg.tar.zst.sig2022-07-11 13:10 119
[PGP]python-cwcwidth-0.1.6-2-x86_64.pkg.tar.zst.sig2022-07-11 13:10 119
[PGP]python-cytoolz-0.12.0-1-x86_64.pkg.tar.zst.sig2022-07-12 21:55 119
[PGP]python-darkdetect-0.7.1-1-any.pkg.tar.zst.sig2022-07-19 05:43 119
[PGP]python-debian-0.1.44-1-any.pkg.tar.zst.sig2022-05-30 09:38 119
[PGP]python-deepmerge-1.0.1-1-any.pkg.tar.zst.sig2022-02-13 20:38 119
[PGP]python-diff-cover-7.0.1-1-any.pkg.tar.zst.sig2022-09-24 11:55 119
[PGP]python-distlib-0.3.6-1-any.pkg.tar.zst.sig2022-08-29 04:24 119
[PGP]python-django-allauth-0.51.0-1-any.pkg.tar.zst.sig2022-06-08 11:04 119
[PGP]python-django-classy-tags-3.0.1-1-any.pkg.tar.zst.sig2022-02-03 10:34 119
[PGP]python-django-compressor-4.1-1-any.pkg.tar.zst.sig2022-08-27 11:56 119
[PGP]python-django-crispy-forms-1.14.0-1-any.pkg.tar.zst.sig2022-01-25 21:18 119
[PGP]python-django-environ-0.9.0-1-any.pkg.tar.zst.sig2022-06-15 23:35 119
[PGP]python-django-filter-22.1-1-any.pkg.tar.zst.sig2022-06-18 17:22 119
[PGP]python-django-haystack-3.2.1-1-any.pkg.tar.zst.sig2022-05-04 19:05 119
[PGP]python-django-mailman3-1.3.7-4-any.pkg.tar.zst.sig2022-02-20 16:06 119
[PGP]python-django-rest-framework-3.13.1-1-any.pkg.tar.zst.sig2021-12-15 20:05 119
[PGP]python-django-sekizai-4.0.0-1-any.pkg.tar.zst.sig2022-07-31 12:56 119
[PGP]python-doit-0.36.0-1-any.pkg.tar.zst.sig2022-04-23 10:48 119
[PGP]python-enrich-1.2.7-1-any.pkg.tar.zst.sig2022-01-12 00:37 119
[PGP]python-falcon-3.1.0-1-x86_64.pkg.tar.zst.sig2022-04-04 21:12 119
[PGP]python-fastapi-0.85.0-1-any.pkg.tar.zst.sig2022-09-15 23:08 119
[PGP]python-fastjsonschema-2.16.2-1-any.pkg.tar.zst.sig2022-09-24 11:16 119
[PGP]python-fido2-1.0.0-1-any.pkg.tar.zst.sig2022-06-20 12:37 119
[PGP]python-findpython-0.2.1-1-any.pkg.tar.zst.sig2022-08-10 09:46 119
[PGP]python-flufl-lock-7.1.1-1-any.pkg.tar.zst.sig2022-09-05 10:09 119
[PGP]python-flufl.i18n-4.1.1-1-any.pkg.tar.zst.sig2022-09-06 09:41 119
[PGP]python-geographiclib-2.0-1-any.pkg.tar.zst.sig2022-04-23 17:04 119
[PGP]python-gitdb-1:4.0.9-1-any.pkg.tar.zst.sig2022-04-06 12:00 119
[PGP]python-gitpython-3.1.27-1-any.pkg.tar.zst.sig2022-04-06 12:11 119
[PGP]python-gnupg-0.5.0-1-any.pkg.tar.zst.sig2022-08-23 19:45 119
[PGP]python-grpcio-1.48.0-1-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]python-guessit-3.4.3-2-any.pkg.tar.zst.sig2022-09-23 11:46 119
[PGP]python-hachoir-3.1.3-1-any.pkg.tar.zst.sig2022-04-13 09:16 119
[PGP]python-hist-2.6.2-1-any.pkg.tar.zst.sig2022-09-23 16:41 119
[PGP]python-histoprint-2.4.0-1-any.pkg.tar.zst.sig2022-06-13 15:41 119
[PGP]python-hsluv-5.0.3-1-any.pkg.tar.zst.sig2022-06-07 15:27 119
[PGP]python-httpcore-0.15.0-1-any.pkg.tar.zst.sig2022-05-18 06:54 119
[PGP]python-httpx-0.23.0-2-any.pkg.tar.zst.sig2022-06-28 12:35 119
[PGP]python-humanfriendly-10.0-3-any.pkg.tar.zst.sig2022-02-13 18:07 119
[PGP]python-hvac-1.0.2-1-any.pkg.tar.zst.sig2022-09-19 17:00 119
[PGP]python-iminuit-2.16.0-1-x86_64.pkg.tar.zst.sig2022-08-22 15:46 119
[PGP]python-iminuit-docs-2.16.0-1-x86_64.pkg.tar.zst.sig2022-08-22 15:46 119
[PGP]python-importlib_resources-5.9.0-1-any.pkg.tar.zst.sig2022-08-16 21:38 119
[PGP]python-inflect-6.0.0-1-any.pkg.tar.zst.sig2022-07-31 13:03 119
[PGP]python-jack-client-0.5.4-1-any.pkg.tar.zst.sig2022-06-07 18:06 119
[PGP]python-jaraco.functools-3.5.1-1-any.pkg.tar.zst.sig2022-07-16 07:20 119
[PGP]python-jaraco.itertools-6.2.1-2-any.pkg.tar.zst.sig2022-06-08 17:59 119
[PGP]python-jaraco.logging-3.1.2-1-any.pkg.tar.zst.sig2022-08-28 15:34 119
[PGP]python-jaraco.stream-3.0.3-2-any.pkg.tar.zst.sig2022-06-08 18:01 119
[PGP]python-jaraco.text-3.9.1-1-any.pkg.tar.zst.sig2022-08-19 06:05 119
[PGP]python-josepy-1.13.0-2-any.pkg.tar.zst.sig2022-03-22 09:45 119
[PGP]python-jsondiff-2.0.0-1-any.pkg.tar.zst.sig2022-04-10 19:02 119
[PGP]python-jwcrypto-1.4.2-1-any.pkg.tar.zst.sig2022-09-15 16:49 119
[PGP]python-keras-2.10.0-1-any.pkg.tar.zst.sig2022-09-04 18:14 119
[PGP]python-keyring-23.9.3-1-any.pkg.tar.zst.sig2022-09-26 11:59 119
[PGP]python-libtmux-0.15.4-1-any.pkg.tar.zst.sig2022-09-24 10:49 119
[PGP]python-libusbsio-2.1.11-1-x86_64.pkg.tar.zst.sig2022-03-09 19:10 119
[PGP]python-license-expression-30.0.0-1-any.pkg.tar.zst.sig2022-05-22 09:38 119
[PGP]python-linux-procfs-0.7.0-1-any.pkg.tar.zst.sig2022-01-10 21:46 119
[PGP]python-llvmlite-0.39.1-1-x86_64.pkg.tar.zst.sig2022-09-05 02:17 119
[PGP]python-loguru-0.6.0-2-any.pkg.tar.zst.sig2022-05-18 17:19 119
[PGP]python-magic-1:0.4.27-1-any.pkg.tar.zst.sig2022-07-12 18:44 119
[PGP]python-milksnake-0.1.5.r3.gef0723e-1-any.pkg.tar.zst.sig2022-02-08 20:05 119
[PGP]python-minio-7.1.11-1-any.pkg.tar.zst.sig2022-07-26 01:58 119
[PGP]python-mistletoe-0.9.0-1-any.pkg.tar.zst.sig2022-08-20 02:44 119
[PGP]python-more-itertools-8.13.0-2-any.pkg.tar.zst.sig2022-07-11 13:14 119
[PGP]python-moto-4.0.5-1-any.pkg.tar.zst.sig2022-09-21 18:39 119
[PGP]python-mpi4py-3.1.3-2-x86_64.pkg.tar.zst.sig2022-06-12 19:14 119
[PGP]python-mplhep-0.3.26-1-any.pkg.tar.zst.sig2022-08-06 16:46 119
[PGP]python-mplhep_data-0.0.3-1-any.pkg.tar.zst.sig2021-12-15 21:28 119
[PGP]python-natsort-8.2.0-1-any.pkg.tar.zst.sig2022-09-02 19:29 119
[PGP]python-nbsphinx-0.8.9-1-any.pkg.tar.zst.sig2022-08-22 14:53 119
[PGP]python-nose2-0.12.0-1-any.pkg.tar.zst.sig2022-07-19 23:03 119
[PGP]python-nrfutil-6.1.6-1-any.pkg.tar.zst.sig2022-08-02 00:42 119
[PGP]python-oauthlib-3.2.0-1-any.pkg.tar.zst.sig2022-02-24 16:19 119
[PGP]python-openapi-schema-validator-0.3.4-1-any.pkg.tar.zst.sig2022-09-14 05:53 119
[PGP]python-openpyxl-3.0.10-1-any.pkg.tar.zst.sig2022-05-30 06:25 119
[PGP]python-orjson-3.8.0-1-x86_64.pkg.tar.zst.sig2022-08-28 15:35 119
[PGP]python-oyaml-1.0-4-any.pkg.tar.zst.sig2022-02-20 07:34 119
[PGP]python-pc-ble-driver-py-0.17.0-1-x86_64.pkg.tar.zst.sig2022-08-01 09:24 119
[PGP]python-pdm-2.1.4-1-any.pkg.tar.zst.sig2022-09-21 15:11 119
[PGP]python-pdm-pep517-1:1.0.4-1-any.pkg.tar.zst.sig2022-08-23 17:47 119
[PGP]python-pg8000-1.29.1-1-any.pkg.tar.zst.sig2022-05-23 05:34 119
[PGP]python-pgpy-0.5.4-2-any.pkg.tar.zst.sig2022-04-12 05:20 119
[PGP]python-pgspecial-2.0.1-1-any.pkg.tar.zst.sig2022-09-16 03:55 119
[PGP]python-piccata-2.0.1-1-any.pkg.tar.zst.sig2022-08-01 09:59 119
[PGP]python-pilkit-2.0-10-any.pkg.tar.zst.sig2022-01-26 10:43 119
[PGP]python-pkginfo-1.8.3-1-any.pkg.tar.zst.sig2022-06-10 09:28 119
[PGP]python-prctl-1.8.1-3-x86_64.pkg.tar.zst.sig2021-12-16 13:25 119
[PGP]python-progressbar-4.0.0-1-any.pkg.tar.zst.sig2022-01-12 00:42 119
[PGP]python-psycopg-3.1.2-1-x86_64.pkg.tar.zst.sig2022-09-24 09:27 119
[PGP]python-psycopg-pool-3.1.2-1-any.pkg.tar.zst.sig2022-09-12 03:24 119
[PGP]python-psycopg2-2.9.3-2-x86_64.pkg.tar.zst.sig2022-07-11 23:29 119
[PGP]python-pyalsa-1.2.7-1-x86_64.pkg.tar.zst.sig2022-06-07 12:19 119
[PGP]python-pybtex-0.24.0-4-any.pkg.tar.zst.sig2022-01-31 23:02 119
[PGP]python-pybtex-docutils-1.0.2-1-any.pkg.tar.zst.sig2022-06-13 15:40 119
[PGP]python-pydantic-1.10.2-1-x86_64.pkg.tar.zst.sig2022-09-06 09:41 119
[PGP]python-pydrive2-1.14.0-1-any.pkg.tar.zst.sig2022-07-23 00:43 119
[PGP]python-pyglet-1.5.26-2-any.pkg.tar.zst.sig2022-07-11 13:48 119
[PGP]python-pylibiio-0.24-1-x86_64.pkg.tar.zst.sig2022-07-09 12:51 119
[PGP]python-pylink-square-0.14.2-1-any.pkg.tar.zst.sig2022-08-13 13:28 119
[PGP]python-pymupdf-1.20.2-1-x86_64.pkg.tar.zst.sig2022-08-13 13:38 119
[PGP]python-pynamodb-5.2.1-1-any.pkg.tar.zst.sig2022-02-17 13:54 119
[PGP]python-pynitrokey-0.4.27-1-any.pkg.tar.zst.sig2022-08-12 23:35 119
[PGP]python-pyocd-0.34.1-1-any.pkg.tar.zst.sig2022-08-27 10:28 119
[PGP]python-pyphen-0.13.0-1-any.pkg.tar.zst.sig2022-09-02 19:22 119
[PGP]python-pypugjs-5.9.12-1-any.pkg.tar.zst.sig2022-07-29 14:30 119
[PGP]python-pyscard-2.0.4-1-x86_64.pkg.tar.zst.sig2022-09-06 08:36 119
[PGP]python-pyspinel-1.0.3-1-any.pkg.tar.zst.sig2022-08-01 12:27 119
[PGP]python-pytest-helpers-namespace-2021.12.29-1-any.pkg.tar.zst.sig2021-12-30 11:59 119
[PGP]python-pytest-httpserver-1.0.6-1-any.pkg.tar.zst.sig2022-09-12 14:04 119
[PGP]python-pytest-metadata-2.0.2-1-any.pkg.tar.zst.sig2022-07-20 10:36 119
[PGP]python-pytest-mpl-0.16.1-1-any.pkg.tar.zst.sig2022-08-06 16:44 119
[PGP]python-pytest-rerunfailures-10.2-4-any.pkg.tar.zst.sig2022-08-02 01:14 119
[PGP]python-pytest-responsemock-1.1.1-1-any.pkg.tar.zst.sig2022-03-13 13:35 119
[PGP]python-pytest-shell-utilities-1.7.0-1-any.pkg.tar.zst.sig2022-09-24 10:28 119
[PGP]python-pytest-skip-markers-1.3.0-1-any.pkg.tar.zst.sig2022-08-02 23:20 119
[PGP]python-pytest-subtesthack-0.2.0-1-any.pkg.tar.zst.sig2022-07-20 11:34 119
[PGP]python-pytest-testinfra-6.8.0-1-any.pkg.tar.zst.sig2022-06-20 10:02 119
[PGP]python-pytest-xprocess-0.20.0-1-any.pkg.tar.zst.sig2022-08-30 10:50 119
[PGP]python-pythia8-8.3.07-4-x86_64.pkg.tar.zst.sig2022-03-06 11:00 119
[PGP]python-pythonfinder-1.3.1-1-any.pkg.tar.zst.sig2022-08-24 16:24 119
[PGP]python-pytorch-1.12.1-4-x86_64.pkg.tar.zst.sig2022-08-25 04:03 119
[PGP]python-pytorch-cuda-1.12.1-4-x86_64.pkg.tar.zst.sig2022-08-25 04:04 119
[PGP]python-pytorch-opt-1.12.1-4-x86_64.pkg.tar.zst.sig2022-08-25 04:04 119
[PGP]python-pytorch-opt-cuda-1.12.1-4-x86_64.pkg.tar.zst.sig2022-08-25 04:05 119
[PGP]python-pywayland-0.4.14-1-x86_64.pkg.tar.zst.sig2022-07-26 10:41 119
[PGP]python-pywlroots-0.15.22-1-x86_64.pkg.tar.zst.sig2022-09-21 15:12 119
[PGP]python-pyzmq-23.2.0-2-x86_64.pkg.tar.zst.sig2022-07-11 13:52 119
[PGP]python-rcssmin-1.1.1-1-x86_64.pkg.tar.zst.sig2022-08-02 01:06 119
[PGP]python-rebulk-3.1.0-2-any.pkg.tar.zst.sig2022-09-23 11:04 119
[PGP]python-requests-unixsocket-0.3.0-1-any.pkg.tar.zst.sig2021-12-24 07:33 119
[PGP]python-requests-wsgi-adapter-0.4.1-1-any.pkg.tar.zst.sig2022-07-21 11:54 119
[PGP]python-rjsmin-1.2.1-1-x86_64.pkg.tar.zst.sig2022-07-31 18:56 119
[PGP]python-rsa-4.9-1-any.pkg.tar.zst.sig2022-07-22 11:02 119
[PGP]python-s3transfer-0.6.0-2-any.pkg.tar.zst.sig2022-07-11 22:40 119
[PGP]python-scikit-hep-testdata-0.4.21-1-any.pkg.tar.zst.sig2022-09-23 16:43 119
[PGP]python-setproctitle-1.3.1-1-x86_64.pkg.tar.zst.sig2022-08-16 15:28 119
[PGP]python-setuptools-declarative-requirements-1.3.0-1-any.pkg.tar.zst.sig2022-08-02 23:30 119
[PGP]python-setuptools-scm-git-archive-1.4-1-any.pkg.tar.zst.sig2022-06-29 20:20 119
[PGP]python-shodan-1.28.0-1-any.pkg.tar.zst.sig2022-07-10 10:51 119
[PGP]python-sly-0.4-1-any.pkg.tar.zst.sig2022-02-13 23:54 119
[PGP]python-snappy-0.6.1-1-x86_64.pkg.tar.zst.sig2022-02-23 03:56 119
[PGP]python-sphinx-click-4.3.0-1-any.pkg.tar.zst.sig2022-07-06 10:03 119
[PGP]python-sphinx-jinja-2.0.2-1-any.pkg.tar.zst.sig2022-07-07 13:44 119
[PGP]python-sphinx-lv2-theme-1.2.0-1-any.pkg.tar.zst.sig2022-07-20 13:46 119
[PGP]python-sphinxcontrib-bibtex-2.5.0-1-any.pkg.tar.zst.sig2022-08-25 19:21 119
[PGP]python-sphinxcontrib-blockdiag-3.0.0-1-any.pkg.tar.zst.sig2021-12-11 03:29 119
[PGP]python-sphinxcontrib-programoutput-0.17-3-any.pkg.tar.zst.sig2022-08-15 10:47 119
[PGP]python-spsdk-1.7.1-1-any.pkg.tar.zst.sig2022-09-24 13:55 119
[PGP]python-starlette-0.21.0-1-any.pkg.tar.zst.sig2022-09-26 21:54 119
[PGP]python-structlog-22.1.0-1-any.pkg.tar.zst.sig2022-07-22 08:53 119
[PGP]python-svglib-1.4.1-1-any.pkg.tar.zst.sig2022-08-06 17:01 119
[PGP]python-tabulate-0.8.10-1-any.pkg.tar.zst.sig2022-06-23 11:03 119
[PGP]python-toolz-0.12.0-1-any.pkg.tar.zst.sig2022-07-10 18:50 119
[PGP]python-treq-22.2.0-1-any.pkg.tar.zst.sig2022-03-03 13:44 119
[PGP]python-tubes-0.2.1-1-any.pkg.tar.zst.sig2022-06-02 08:24 119
[PGP]python-txaio-22.2.1-1-any.pkg.tar.zst.sig2022-02-24 16:20 119
[PGP]python-ujson-5.4.0-1-x86_64.pkg.tar.zst.sig2022-07-09 13:01 119
[PGP]python-unearth-0.6.1-1-any.pkg.tar.zst.sig2022-07-31 13:20 119
[PGP]python-unidiff-0.7.4-1-any.pkg.tar.zst.sig2022-06-27 10:00 119
[PGP]python-uproot-4.3.5-2-any.pkg.tar.zst.sig2022-09-23 17:57 119
[PGP]python-uproot-docs-4.3.5-2-any.pkg.tar.zst.sig2022-09-23 17:57 119
[PGP]python-utils-3.3.3-1-any.pkg.tar.zst.sig2022-06-07 18:36 119
[PGP]python-vector-0.10.0-1-any.pkg.tar.zst.sig2022-09-23 15:50 119
[PGP]python-websocket-client-1.4.1-1-any.pkg.tar.zst.sig2022-09-04 22:40 119
[PGP]python-wsgi-intercept-1.10.0-1-any.pkg.tar.zst.sig2022-05-16 18:24 119
[PGP]python-xlsxwriter-3.0.3-1-any.pkg.tar.zst.sig2022-03-01 21:17 119
[PGP]python-xmltodict-0.13.0-2-any.pkg.tar.zst.sig2022-07-11 13:19 119
[PGP]python-xxhash-3.0.0-1-x86_64.pkg.tar.zst.sig2022-03-08 10:53 119
[PGP]python-yaml-6.0-1-x86_64.pkg.tar.zst.sig2022-02-09 21:52 119
[PGP]python-zita-audiotools-1.3.0-1-x86_64.pkg.tar.zst.sig2022-04-22 16:31 119
[PGP]python-zita-jacktools-1.6.0-1-x86_64.pkg.tar.zst.sig2022-04-22 16:32 119
[PGP]python-zopfli-0.2.1-1-x86_64.pkg.tar.zst.sig2022-03-09 21:35 119
[PGP]qastools-0.23.0-1-x86_64.pkg.tar.zst.sig2020-06-18 23:03 119
[PGP]qbe-1.0-1-x86_64.pkg.tar.zst.sig2022-06-24 00:39 119
[PGP]qcustomplot-2.1.0-1-x86_64.pkg.tar.zst.sig2021-06-11 20:18 119
[PGP]qcustomplot-doc-2.1.0-1-x86_64.pkg.tar.zst.sig2021-06-11 20:18 119
[PGP]qjackctl-0.9.7-2-x86_64.pkg.tar.zst.sig2022-04-28 13:06 119
[PGP]qmidiarp-0.6.5-5-x86_64.pkg.tar.zst.sig2021-02-04 17:47 119
[PGP]qmidictl-0.9.6-3-x86_64.pkg.tar.zst.sig2022-04-28 13:09 119
[PGP]qmidinet-0.9.6-2-x86_64.pkg.tar.zst.sig2022-04-28 13:10 119
[PGP]qmidiroute-0.4.0-8-x86_64.pkg.tar.zst.sig2022-04-28 13:15 119
[PGP]qsampler-0.9.6-2-x86_64.pkg.tar.zst.sig2022-04-28 13:14 119
[PGP]qsynth-0.9.7-2-x86_64.pkg.tar.zst.sig2022-04-28 13:16 119
[PGP]qterminal-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:57 119
[PGP]qtermwidget-1.1.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:53 119
[PGP]qtile-0.22.1-1-x86_64.pkg.tar.zst.sig2022-09-22 15:37 119
[PGP]qtractor-0.9.28-1-x86_64.pkg.tar.zst.sig2022-09-02 23:40 119
[PGP]qtxdg-tools-3.9.1-1-x86_64.pkg.tar.zst.sig2022-05-08 14:05 119
[PGP]quicklisp-20150128-1-any.pkg.tar.zst.sig2022-05-06 12:24 119
[PGP]quilt-0.67-1-any.pkg.tar.zst.sig2022-08-06 12:23 119
[PGP]qxgedit-0.9.6-2-x86_64.pkg.tar.zst.sig2022-04-28 13:18 119
[PGP]racket-8.5-2-x86_64.pkg.tar.zst.sig2022-07-11 13:48 119
[PGP]racket-minimal-8.5-2-x86_64.pkg.tar.zst.sig2022-07-11 13:48 119
[PGP]radcli-1.3.0-1-x86_64.pkg.tar.zst.sig2021-08-12 10:49 119
[PGP]radeontop-1.4-1-x86_64.pkg.tar.zst.sig2021-11-24 18:13 119
[PGP]radicale-3.1.8-1-any.pkg.tar.zst.sig2022-07-19 22:35 119
[PGP]rbw-1.4.3-1-x86_64.pkg.tar.zst.sig2022-02-10 20:03 119
[PGP]realtime-privileges-4-1-any.pkg.tar.zst.sig2022-01-27 19:13 119
[PGP]reapack-1.2.4.1-1-x86_64.pkg.tar.zst.sig2022-08-04 19:55 119
[PGP]reaper-6.68-1-x86_64.pkg.tar.zst.sig2022-09-24 01:43 119
[PGP]rebuild-detector-4.4.1-2-any.pkg.tar.zst.sig2022-02-25 10:14 119
[PGP]redo-python-0.42.d-2-any.pkg.tar.zst.sig2022-02-26 08:26 119
[PGP]redo-sh-4.0.4-2-any.pkg.tar.zst.sig2022-02-26 08:22 119
[PGP]release-cli-0.13.0-1-x86_64.pkg.tar.zst.sig2022-07-18 17:42 119
[PGP]repod-0.2.2-1-any.pkg.tar.zst.sig2022-08-29 22:43 119
[PGP]retext-7.2.3-2-any.pkg.tar.zst.sig2022-07-11 13:02 119
[PGP]reuse-1.0.0-2-any.pkg.tar.zst.sig2022-06-19 21:06 119
[PGP]rev-plugins-0.8.1-1-x86_64.pkg.tar.zst.sig2022-06-29 13:10 119
[PGP]rlwrap-0.45.2-1-x86_64.pkg.tar.zst.sig2021-12-17 20:20 119
[PGP]rng-tools-6.15-1-x86_64.pkg.tar.zst.sig2022-02-10 20:26 119
[PGP]root-6.26.06-4-x86_64.pkg.tar.zst.sig2022-09-04 18:43 119
[PGP]root-cuda-6.26.06-4-x86_64.pkg.tar.zst.sig2022-09-04 18:43 119
[PGP]rootlesskit-1.0.1-1-x86_64.pkg.tar.zst.sig2022-05-02 23:45 119
[PGP]rosegarden-22.06-1-x86_64.pkg.tar.zst.sig2022-06-10 19:02 119
[PGP]roswell-21.10.14.111-2-x86_64.pkg.tar.zst.sig2022-05-23 09:57 119
[PGP]rst2pdf-0.99-2-any.pkg.tar.zst.sig2022-04-28 10:05 119
[PGP]rt-tests-2.4-1-x86_64.pkg.tar.zst.sig2022-07-09 12:15 119
[PGP]rtaudio-5.2.0-1-x86_64.pkg.tar.zst.sig2021-11-18 21:57 119
[PGP]rtaudio-docs-5.2.0-1-x86_64.pkg.tar.zst.sig2021-11-18 21:57 119
[PGP]rtirq-20220923-1-any.pkg.tar.zst.sig2022-09-24 11:23 119
[PGP]rtmidi-5.0.0-1-x86_64.pkg.tar.zst.sig2021-11-18 23:37 119
[PGP]rtmidi-docs-5.0.0-1-x86_64.pkg.tar.zst.sig2021-11-18 23:37 119
[PGP]rtosc-0.3.1-1-x86_64.pkg.tar.zst.sig2022-01-22 19:51 119
[PGP]rtosc-docs-0.3.1-1-x86_64.pkg.tar.zst.sig2022-01-22 19:51 119
[PGP]rubberband-3.0.0-2-x86_64.pkg.tar.zst.sig2022-07-21 12:31 119
[PGP]ruby-activesupport-6.1.4.1-1-any.pkg.tar.zst.sig2021-08-19 22:46 119
[PGP]ruby-bundler-2.3.22-1-any.pkg.tar.zst.sig2022-09-12 03:28 119
[PGP]ruby-ffi-1.15.5-1-x86_64.pkg.tar.zst.sig2022-01-10 21:00 119
[PGP]ruby-gpgme-2.0.20-3-x86_64.pkg.tar.zst.sig2022-01-13 22:30 119
[PGP]ruby-i18n-1.12.0-1-any.pkg.tar.zst.sig2022-07-20 12:31 119
[PGP]ruby-iconv-1.0.8-3-x86_64.pkg.tar.zst.sig2021-09-03 02:19 119
[PGP]ruby-json-2.6.2-1-x86_64.pkg.tar.zst.sig2022-05-16 18:21 119
[PGP]ruby-network_interface-0.0.2-5-x86_64.pkg.tar.zst.sig2022-01-13 22:29 119
[PGP]ruby-pg-1.4.3-1-x86_64.pkg.tar.zst.sig2022-08-10 10:30 119
[PGP]ruby-rb-fsevent-0.11.2-1-any.pkg.tar.zst.sig2022-08-31 04:35 119
[PGP]ruby-rugged-1.5.0.1-1-x86_64.pkg.tar.zst.sig2022-08-16 16:57 119
[PGP]ruby-tzinfo-2.0.5-1-any.pkg.tar.zst.sig2022-07-20 10:29 119
[PGP]ruby-zeitwerk-2.6.0-1-any.pkg.tar.zst.sig2022-06-14 15:56 119
[PGP]rustscan-2.1.0-2-x86_64.pkg.tar.zst.sig2022-06-14 04:15 119
[PGP]sad-0.4.22-1-x86_64.pkg.tar.zst.sig2022-06-18 02:53 119
[PGP]samplv1-0.9.26-1-x86_64.pkg.tar.zst.sig2022-06-07 17:54 119
[PGP]sc3-plugins-3.11.1-2-x86_64.pkg.tar.zst.sig2021-11-19 19:44 119
[PGP]scaleway-cli-2.5.6-2-x86_64.pkg.tar.zst.sig2022-09-17 14:53 119
[PGP]schismtracker-20220905-1-x86_64.pkg.tar.zst.sig2022-09-21 10:36 119
[PGP]screengrab-2.4.0-1-x86_64.pkg.tar.zst.sig2022-04-16 16:59 119
[PGP]sdl_image-1.2.12-7-x86_64.pkg.tar.zst.sig2021-02-27 00:04 119
[PGP]serd-0.30.16-1-x86_64.pkg.tar.zst.sig2022-09-13 14:00 119
[PGP]serd-docs-0.30.16-1-x86_64.pkg.tar.zst.sig2022-09-13 14:00 119
[PGP]serialdv-1.1.4-2-x86_64.pkg.tar.zst.sig2022-04-23 00:37 119
[PGP]setbfree-0.8.11-3-x86_64.pkg.tar.zst.sig2022-02-20 09:37 119
[PGP]sfizz-1.2.0-2-x86_64.pkg.tar.zst.sig2022-07-20 14:38 119
[PGP]sheldon-0.6.6-3-x86_64.pkg.tar.zst.sig2022-03-31 00:05 119
[PGP]sherlock.lv2-0.28.0-1-x86_64.pkg.tar.zst.sig2021-04-15 16:10 119
[PGP]shutter-0.99.2-4-any.pkg.tar.zst.sig2022-07-11 23:52 119
[PGP]sieve-connect-0.90-2-any.pkg.tar.zst.sig2021-06-18 01:34 119
[PGP]sigal-2.3-1-any.pkg.tar.zst.sig2022-04-08 20:39 119
[PGP]simde-0.7.2-1-any.pkg.tar.zst.sig2022-01-16 10:20 119
[PGP]skate-0.2.1-3-x86_64.pkg.tar.zst.sig2022-08-10 09:32 119
[PGP]smplayer-skins-1:20.11.0-1-any.pkg.tar.zst.sig2020-11-17 13:03 119
[PGP]snapper-0.10.3-1-x86_64.pkg.tar.zst.sig2022-09-22 19:31 119
[PGP]snd-22.7-1-x86_64.pkg.tar.zst.sig2022-09-14 12:39 119
[PGP]sndio-1.9.0-1-x86_64.pkg.tar.zst.sig2022-07-28 23:19 119
[PGP]soapyplutosdr-0.2.1-4-x86_64.pkg.tar.zst.sig2022-07-11 17:51 119
[PGP]soft-serve-0.4.0-3-x86_64.pkg.tar.zst.sig2022-09-03 09:45 119
[PGP]softhsm-2.6.1-3-x86_64.pkg.tar.zst.sig2022-02-28 12:49 119
[PGP]solr-8.11.1-1-any.pkg.tar.zst.sig2021-12-16 21:35 119
[PGP]sonic-1.3.5-1-x86_64.pkg.tar.zst.sig2022-07-12 01:07 119
[PGP]sonic-visualiser-4.5-4-x86_64.pkg.tar.zst.sig2022-08-31 11:38 119
[PGP]sonivox-3.6.11-1-x86_64.pkg.tar.zst.sig2022-08-16 21:32 119
[PGP]sorcer-1.1.3-3-x86_64.pkg.tar.zst.sig2020-05-21 17:52 119
[PGP]sord-0.16.14-1-x86_64.pkg.tar.zst.sig2022-09-13 14:03 119
[PGP]sord-docs-0.16.14-1-x86_64.pkg.tar.zst.sig2022-09-13 14:03 119
[PGP]sound-gambit-0.7-1-x86_64.pkg.tar.zst.sig2022-03-23 14:49 119
[PGP]sparsehash-2.0.4-2-any.pkg.tar.zst.sig2022-02-28 12:51 119
[PGP]spdlog-1.10.0-3-x86_64.pkg.tar.zst.sig2022-08-09 13:24 119
[PGP]spectmorph-0.5.2-1-x86_64.pkg.tar.zst.sig2020-09-21 21:12 119
[PGP]spiped-1.6.2-2-x86_64.pkg.tar.zst.sig2022-01-03 22:00 119
[PGP]sqlc-1.15.0-1-x86_64.pkg.tar.zst.sig2022-08-08 04:30 119
[PGP]sqlfluff-1.3.1-1-any.pkg.tar.zst.sig2022-09-12 03:16 119
[PGP]sratom-0.6.14-1-x86_64.pkg.tar.zst.sig2022-09-10 00:08 119
[PGP]sratom-docs-0.6.14-1-x86_64.pkg.tar.zst.sig2022-09-10 00:08 119
[PGP]ssdeep-2.14.1-3-x86_64.pkg.tar.zst.sig2022-02-28 12:53 119
[PGP]ssh-tools-1.7-2-any.pkg.tar.zst.sig2022-02-16 09:15 119
[PGP]sslh-1.22.c-2-x86_64.pkg.tar.zst.sig2022-09-04 16:54 119
[PGP]sslscan-2.0.15-1-x86_64.pkg.tar.zst.sig2022-07-03 21:24 119
[PGP]sssd-2.7.4-2-x86_64.pkg.tar.zst.sig2022-09-20 10:14 119
[PGP]stella-6.7-2-x86_64.pkg.tar.zst.sig2022-07-11 22:41 119
[PGP]stk-4.6.2-1-x86_64.pkg.tar.zst.sig2021-11-19 19:06 119
[PGP]stk-docs-4.6.2-1-x86_64.pkg.tar.zst.sig2021-11-19 19:06 119
[PGP]stone-soup-0.29.0-1-x86_64.pkg.tar.zst.sig2022-08-30 15:10 119
[PGP]stumpwm-22.05-3-x86_64.pkg.tar.zst.sig2022-06-14 03:52 119
[PGP]stunnel-5.66-1-x86_64.pkg.tar.zst.sig2022-09-14 07:16 119
[PGP]suil-0.10.16-3-x86_64.pkg.tar.zst.sig2022-09-02 22:03 119
[PGP]suil-docs-0.10.16-3-x86_64.pkg.tar.zst.sig2022-09-02 22:03 119
[PGP]supermin-5.3.2-1-x86_64.pkg.tar.zst.sig2022-07-11 22:09 119
[PGP]supervisor-4.2.4-2-any.pkg.tar.zst.sig2022-02-28 16:20 119
[PGP]surge-1.9.0-3-x86_64.pkg.tar.zst.sig2021-05-03 09:04 119
[PGP]surge-xt-1.1.1-4-x86_64.pkg.tar.zst.sig2022-09-19 10:41 119
[PGP]sway-1:1.7-9-x86_64.pkg.tar.zst.sig2022-05-20 19:33 119
[PGP]swaybg-1.1.1-1-x86_64.pkg.tar.zst.sig2022-03-10 12:47 119
[PGP]sweep-0.9.3-6-x86_64.pkg.tar.zst.sig2021-09-24 23:12 119
[PGP]sws-2.13.1.0-1-x86_64.pkg.tar.zst.sig2022-08-06 01:43 119
[PGP]synthv1-0.9.26-1-x86_64.pkg.tar.zst.sig2022-06-07 17:54 119
[PGP]sysdig-0.29.3-1-x86_64.pkg.tar.zst.sig2022-08-16 15:41 119
[PGP]sysdig-dkms-0.29.3-1-x86_64.pkg.tar.zst.sig2022-08-16 15:41 119
[PGP]t1utils-1.42-1-x86_64.pkg.tar.zst.sig2020-10-27 16:53 119
[PGP]tap-plugins-1.0.1-1-x86_64.pkg.tar.zst.sig2020-08-02 21:22 119
[PGP]tcplay-3.3-2-x86_64.pkg.tar.zst.sig2021-02-02 21:05 119
[PGP]tcsh-6.24.01-2-x86_64.pkg.tar.zst.sig2022-08-14 20:04 119
[PGP]tea-0.9.0-1-x86_64.pkg.tar.zst.sig2022-09-14 07:26 119
[PGP]tealdeer-1.5.0-1-x86_64.pkg.tar.zst.sig2022-01-01 01:33 119
[PGP]tembro-0.5.1-1-any.pkg.tar.zst.sig2022-07-20 11:52 119
[PGP]texlab-4.2.2-1-x86_64.pkg.tar.zst.sig2022-08-29 02:14 119
[PGP]tig-2.5.7-1-x86_64.pkg.tar.zst.sig2022-08-26 08:27 119
[PGP]tilix-1.9.5-3-x86_64.pkg.tar.zst.sig2022-07-24 16:40 119
[PGP]timescaledb-2.8.0-1-x86_64.pkg.tar.zst.sig2022-09-02 10:18 119
[PGP]timescaledb-old-upgrade-2.7.2-1-x86_64.pkg.tar.zst.sig2022-07-26 01:52 119
[PGP]timescaledb-tune-0.14.1-1-x86_64.pkg.tar.zst.sig2022-09-02 10:11 119
[PGP]tinyproxy-1.11.1-2-x86_64.pkg.tar.zst.sig2022-05-30 04:19 119
[PGP]tmate-2.4.0-3-x86_64.pkg.tar.zst.sig2021-09-01 15:41 119
[PGP]tmon-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]tmuxp-1.15.2-1-any.pkg.tar.zst.sig2022-09-24 18:21 119
[PGP]todoman-4.1.0-1-any.pkg.tar.zst.sig2021-12-13 20:12 119
[PGP]tomlplusplus-3.2.0-1-any.pkg.tar.zst.sig2022-08-30 10:59 119
[PGP]trace-cmd-3.1.2-1-x86_64.pkg.tar.zst.sig2022-07-20 12:27 119
[PGP]transcode-1.1.7-40-x86_64.pkg.tar.zst.sig2022-02-04 23:45 119
[PGP]tt-rss-2:r11370.d47b8c849-1-any.pkg.tar.zst.sig2022-09-12 07:17 119
[PGP]ttc-iosevka-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-aile-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-curly-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-curly-slab-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-etoile-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-slab-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss01-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss02-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss03-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss04-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss05-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss06-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss07-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss08-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss09-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss10-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss11-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss12-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss13-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss14-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss15-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss16-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss17-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttc-iosevka-ss18-16.2.0-1-any.pkg.tar.zst.sig2022-09-23 17:34 119
[PGP]ttf-arphic-ukai-0.2.20080216.2-1-any.pkg.tar.zst.sig2020-11-29 05:29 119
[PGP]ttf-arphic-uming-0.2.20080216.2-1-any.pkg.tar.zst.sig2020-11-29 05:18 119
[PGP]ttf-cascadia-code-2111.01-1-any.pkg.tar.zst.sig2021-12-30 09:34 119
[PGP]ttf-ionicons-6.0.3-1-any.pkg.tar.zst.sig2022-08-28 15:12 119
[PGP]ttf-joypixels-7.0.0-1-any.pkg.tar.zst.sig2022-07-28 22:02 119
[PGP]ttf-monoid-0.61-7-any.pkg.tar.zst.sig2021-06-17 19:30 119
[PGP]ttf-overpass-3.0.5-1-any.pkg.tar.zst.sig2022-01-06 11:45 119
[PGP]ttf-ubuntu-font-family-0.83-8-any.pkg.tar.zst.sig2022-02-28 16:20 119
[PGP]tuna-1:0.18-1-any.pkg.tar.zst.sig2022-07-20 13:56 119
[PGP]tuning-library-1.1.0-1-any.pkg.tar.zst.sig2021-10-10 01:14 119
[PGP]turbostat-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]twolame-0.4.0-2-x86_64.pkg.tar.xz.sig2019-11-12 23:40 119
[PGP]uasm-2.55-2-x86_64.pkg.tar.zst.sig2022-09-23 03:22 119
[PGP]udftools-2.3-1-x86_64.pkg.tar.zst.sig2021-01-06 16:14 119
[PGP]umurmur-0.2.20-1-x86_64.pkg.tar.zst.sig2021-03-22 20:15 119
[PGP]unbound-1.16.3-1-x86_64.pkg.tar.zst.sig2022-09-24 10:31 119
[PGP]unp-2.0.pre9-2-any.pkg.tar.zst.sig2021-03-23 19:54 119
[PGP]unuran-1.9.0-1-x86_64.pkg.tar.zst.sig2022-08-18 02:06 119
[PGP]up-0.4-3-x86_64.pkg.tar.zst.sig2022-04-29 04:09 119
[PGP]urh-2.9.3-2-x86_64.pkg.tar.zst.sig2022-07-11 17:54 119
[PGP]uriparser-0.9.6-1-x86_64.pkg.tar.zst.sig2022-01-06 23:48 119
[PGP]urlscan-0.9.10-1-any.pkg.tar.zst.sig2022-08-04 06:29 119
[PGP]urxvt-perls-2.3-2-any.pkg.tar.zst.sig2022-07-11 22:41 119
[PGP]usbip-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]usbview-3.0-2-x86_64.pkg.tar.zst.sig2022-07-11 22:09 119
[PGP]vamp-plugin-sdk-2.10.0-1-x86_64.pkg.tar.zst.sig2020-05-18 19:28 119
[PGP]vaultwarden-1.25.2-1-x86_64.pkg.tar.zst.sig2022-07-30 10:14 119
[PGP]vaultwarden-web-2022.9.0-1-any.pkg.tar.zst.sig2022-09-12 03:19 119
[PGP]vico-1.2.2-2-x86_64.pkg.tar.zst.sig2021-02-08 21:48 119
[PGP]vim-ansible-3.2-1-any.pkg.tar.zst.sig2021-06-07 20:55 119
[PGP]vim-coverage-highlight-3.5-1-any.pkg.tar.zst.sig2022-02-21 17:51 119
[PGP]vim-csound-0.8.1-1-any.pkg.tar.zst.sig2020-03-01 20:03 119
[PGP]vim-editorconfig-1.1.1-1-any.pkg.tar.zst.sig2020-06-03 21:24 119
[PGP]virtualbox-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]virtualbox-ext-vnc-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]virtualbox-guest-iso-6.1.38-1-any.pkg.tar.zst.sig2022-09-01 21:49 119
[PGP]virtualbox-guest-utils-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]virtualbox-guest-utils-nox-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]virtualbox-host-dkms-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]virtualbox-sdk-6.1.38-1-x86_64.pkg.tar.zst.sig2022-09-01 21:53 119
[PGP]vis-0.7-2-x86_64.pkg.tar.zst.sig2021-03-25 08:42 119
[PGP]vivaldi-5.4.2753.51-1-x86_64.pkg.tar.zst.sig2022-09-16 09:17 119
[PGP]vivaldi-ffmpeg-codecs-104.0.5112.101-1-x86_64.pkg.tar.zst.sig2022-09-03 19:56 119
[PGP]vm.lv2-0.14.0-2-x86_64.pkg.tar.zst.sig2022-06-18 15:41 119
[PGP]vmaf-2.3.1-1-x86_64.pkg.tar.zst.sig2022-04-13 17:15 119
[PGP]vmpk-0.8.8-1-x86_64.pkg.tar.zst.sig2022-09-05 18:36 119
[PGP]vst3sdk-3.7.6_build_18-1-any.pkg.tar.zst.sig2022-09-07 10:44 119
[PGP]wails-2.0.0-2-x86_64.pkg.tar.zst.sig2022-09-24 20:58 119
[PGP]wakatime-1:1.55.1-1-x86_64.pkg.tar.zst.sig2022-09-23 16:22 119
[PGP]wallabag-2.5.1-2-any.pkg.tar.zst.sig2022-09-17 03:05 119
[PGP]waybar-0.9.13-2-x86_64.pkg.tar.zst.sig2022-08-09 16:58 119
[PGP]waylandpp-1.0.0-1-x86_64.pkg.tar.zst.sig2022-04-28 12:40 119
[PGP]waylock-0.3.5-1-x86_64.pkg.tar.zst.sig2022-02-25 17:58 119
[PGP]web-ext-7.2.0-1-any.pkg.tar.zst.sig2022-08-14 03:46 119
[PGP]weston-10.0.2-1-x86_64.pkg.tar.zst.sig2022-09-04 22:56 119
[PGP]wiiuse-0.15.5-1-x86_64.pkg.tar.xz.sig2019-11-24 21:27 119
[PGP]wikicurses-1.4-6-any.pkg.tar.zst.sig2022-01-15 09:05 119
[PGP]wimlib-1.13.6-1-x86_64.pkg.tar.zst.sig2022-09-14 07:09 119
[PGP]wine-gecko-2.47.3-1-x86_64.pkg.tar.zst.sig2022-07-16 05:46 119
[PGP]wine-mono-7.3.0-1-any.pkg.tar.zst.sig2022-06-09 19:42 119
[PGP]wire-desktop-3.28.2946-1-any.pkg.tar.zst.sig2022-07-28 22:13 119
[PGP]wldash-0.3.0-2-x86_64.pkg.tar.zst.sig2022-08-08 17:37 119
[PGP]woff2-cascadia-code-2111.01-1-any.pkg.tar.zst.sig2021-12-30 09:34 119
[PGP]wofi-1.2.4-2-x86_64.pkg.tar.zst.sig2022-02-25 12:55 119
[PGP]wolf-shaper-0.1.8-1-x86_64.pkg.tar.zst.sig2020-10-02 22:07 119
[PGP]woodpecker-agent-0.15.4-1-x86_64.pkg.tar.zst.sig2022-09-12 01:43 119
[PGP]woodpecker-cli-0.15.4-1-x86_64.pkg.tar.zst.sig2022-09-12 01:43 119
[PGP]woodpecker-server-0.15.4-1-x86_64.pkg.tar.zst.sig2022-09-12 01:43 119
[PGP]x11vnc-1:0.9.16-5-x86_64.pkg.tar.zst.sig2022-01-29 16:38 119
[PGP]x42-plugins-20220923-1-x86_64.pkg.tar.zst.sig2022-09-24 10:20 119
[PGP]x86_energy_perf_policy-5.19-1-x86_64.pkg.tar.zst.sig2022-08-07 11:34 119
[PGP]xcur2png-0.7.1-7-x86_64.pkg.tar.zst.sig2020-06-01 22:38 119
[PGP]xcursor-comix-0.9.2-1-any.pkg.tar.zst.sig2020-06-19 21:52 119
[PGP]xdg-desktop-portal-lxqt-0.2.0-1-x86_64.pkg.tar.zst.sig2022-04-18 15:56 119
[PGP]xfce4-whiskermenu-plugin-2.7.1-1-x86_64.pkg.tar.zst.sig2021-12-11 22:29 119
[PGP]xine-lib-1.2.12-3-x86_64.pkg.tar.zst.sig2022-09-14 04:54 119
[PGP]xine-ui-0.99.13-2-x86_64.pkg.tar.zst.sig2022-02-22 22:56 119
[PGP]xjadeo-0.8.11-1-x86_64.pkg.tar.zst.sig2022-04-04 14:36 119
[PGP]xmonk.lv2-0.4-1-x86_64.pkg.tar.xz.sig2019-12-03 19:11 119
[PGP]xsv-0.13.0-2-x86_64.pkg.tar.zst.sig2022-04-08 01:32 119
[PGP]xtrabackup-8.0.29_22-1-x86_64.pkg.tar.zst.sig2022-08-02 14:02 119
[PGP]xwax-1.8-1-x86_64.pkg.tar.zst.sig2021-08-19 21:54 119
[PGP]yad-12.0-1-x86_64.pkg.tar.zst.sig2022-05-03 10:52 119
[PGP]yodl-4.03.03-1-x86_64.pkg.tar.zst.sig2021-08-16 15:42 119
[PGP]yoshimi-2.2.2.1-1-x86_64.pkg.tar.zst.sig2022-09-12 14:05 119
[PGP]yubico-c-client-2.15-5-x86_64.pkg.tar.zst.sig2020-04-15 23:24 119
[PGP]yubikey-personalization-gui-3.1.25-2-x86_64.pkg.tar.zst.sig2020-01-10 21:02 119
[PGP]yubikey-touch-detector-1.10.0-1-x86_64.pkg.tar.zst.sig2022-05-27 01:37 119
[PGP]zam-plugins-3.14-1-x86_64.pkg.tar.zst.sig2020-12-20 22:12 119
[PGP]zerotier-one-1.10.1-1-x86_64.pkg.tar.zst.sig2022-06-30 22:13 119
[PGP]zita-ajbridge-0.8.4-1-x86_64.pkg.tar.zst.sig2020-04-07 00:18 119
[PGP]zita-convolver-4.0.3-2-x86_64.pkg.tar.xz.sig2019-12-15 14:13 119
[PGP]zita-jclient-0.4.2-3-x86_64.pkg.tar.zst.sig2021-02-18 18:46 119
[PGP]zita-njbridge-0.4.8-1-x86_64.pkg.tar.zst.sig2021-04-16 10:24 119
[PGP]zk-0.11.1-1-x86_64.pkg.tar.zst.sig2022-07-19 06:21 119
[PGP]zopfli-1.0.3-2-x86_64.pkg.tar.zst.sig2021-03-14 11:22 119
[PGP]zoxide-0.8.3-1-x86_64.pkg.tar.zst.sig2022-09-03 09:23 119
[PGP]zsa-udev-2.1.3-4-x86_64.pkg.tar.zst.sig2022-05-02 18:33 119
[PGP]zsa-wally-2.1.3-4-x86_64.pkg.tar.zst.sig2022-05-02 18:33 119
[PGP]zsa-wally-cli-2.0.1-4-x86_64.pkg.tar.zst.sig2022-05-02 18:36 119
[PGP]zsh-autosuggestions-0.7.0-1-any.pkg.tar.zst.sig2021-06-07 20:08 119
[PGP]zsh-history-substring-search-1.0.2-1-any.pkg.tar.xz.sig2019-10-27 15:02 119
[PGP]zynaddsubfx-3.0.6-3-x86_64.pkg.tar.zst.sig2022-05-22 10:25 119
[PGP]xfmpc-0.3.0-4-x86_64.pkg.tar.zst.sig2020-11-28 21:26 134
[PGP]gtksourceview3-1:3.24.11+r28+g73e57b57-1-x86_64.pkg.tar.zst.sig2022-07-18 20:52 140
[PGP]open-iscsi-2.1.7-2-x86_64.pkg.tar.zst.sig2022-07-07 10:38 140
[PGP]acpi_call-1.2.2-74-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]awesome-terminal-fonts-1.1.0-4-any.pkg.tar.zst.sig2021-03-28 19:25 141
[PGP]bbswitch-0.8-540-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]bbswitch-dkms-0.8-540-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]broadcom-wl-6.30.223.271-419-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]cdemu-client-3.2.5-1-any.pkg.tar.zst.sig2021-04-19 15:32 141
[PGP]cdemu-daemon-3.2.6-1-x86_64.pkg.tar.zst.sig2021-12-19 18:23 141
[PGP]colorhug-client-0.2.8-3-x86_64.pkg.tar.zst.sig2022-02-12 02:58 141
[PGP]couchdb-3.2.2-3-x86_64.pkg.tar.zst.sig2022-07-03 21:24 141
[PGP]deepin-anything-arch-5.0.18-6-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]deepin-mutter-3.20.38-5-x86_64.pkg.tar.zst.sig2021-04-01 16:52 141
[PGP]dina-font-2.92-10-any.pkg.tar.zst.sig2021-03-28 19:29 141
[PGP]duktape-2.7.0-4-x86_64.pkg.tar.zst.sig2022-07-12 18:59 141
[PGP]evolution-rss-0.3.96-5-x86_64.pkg.tar.zst.sig2021-11-08 22:06 141
[PGP]fractal-4.4.0-2-x86_64.pkg.tar.zst.sig2020-10-02 22:43 141
[PGP]glabels-3.4.1-8-x86_64.pkg.tar.zst.sig2021-04-02 00:18 141
[PGP]gnome-bluetooth-3.34.5-4-x86_64.pkg.tar.zst.sig2022-06-09 18:42 141
[PGP]gnome-boxes-42.3-1-x86_64.pkg.tar.zst.sig2022-07-07 13:16 141
[PGP]gnome-code-assistance-3:3.16.1+r14+gaad6437-1-x86_64.pkg.tar.zst.sig2022-05-18 19:23 141
[PGP]gupnp-tools-0.10.3-1-x86_64.pkg.tar.zst.sig2022-05-20 14:32 141
[PGP]intel-gmmlib-22.1.4-2-x86_64.pkg.tar.zst.sig2022-08-23 00:43 141
[PGP]intel-media-driver-22.4.4-2-x86_64.pkg.tar.zst.sig2022-08-23 00:43 141
[PGP]jruby-9.3.8.0-1-any.pkg.tar.zst.sig2022-09-13 18:48 141
[PGP]js78-78.15.0-4-x86_64.pkg.tar.zst.sig2022-07-13 20:25 141
[PGP]libfdk-aac-2.0.2-1-x86_64.pkg.tar.zst.sig2021-05-02 20:43 141
[PGP]libmirage-3.2.6-1-x86_64.pkg.tar.zst.sig2021-12-19 18:23 141
[PGP]libmusicbrainz5-5.1.0-5-x86_64.pkg.tar.zst.sig2022-07-18 21:13 141
[PGP]libxml++2.6-2.42.1-1-x86_64.pkg.tar.zst.sig2022-09-10 00:50 141
[PGP]libxml++2.6-docs-2.42.1-1-x86_64.pkg.tar.zst.sig2022-09-10 00:50 141
[PGP]mailnag-gnome-shell-40.0-2-x86_64.pkg.tar.zst.sig2021-11-08 22:09 141
[PGP]mate-control-center-1.26.0-3-x86_64.pkg.tar.zst.sig2022-02-12 02:57 141
[PGP]nageru-2.1.0-4-x86_64.pkg.tar.zst.sig2022-06-16 01:26 141
[PGP]neovim-0.7.2-3-x86_64.pkg.tar.zst.sig2022-06-30 08:04 141
[PGP]netfilter-fullconenat-r73.0cf3b48-239-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]networkmanager-fortisslvpn-1.4.0-2-x86_64.pkg.tar.zst.sig2022-04-04 20:34 141
[PGP]pidgin-talkfilters-2.7.0-6-x86_64.pkg.tar.zst.sig2022-03-02 18:37 141
[PGP]pkgdiff-1.7.2-4-any.pkg.tar.zst.sig2022-07-18 21:22 141
[PGP]r8168-8.050.03-28-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]retro-gtk-1.0.2-1-x86_64.pkg.tar.zst.sig2021-03-24 21:18 141
[PGP]sbxkb-0.7.6-5-x86_64.pkg.tar.zst.sig2020-11-09 15:54 141
[PGP]simple-scan-42.1-1-x86_64.pkg.tar.zst.sig2022-04-19 16:03 141
[PGP]sox-14.4.2+r182+g42b3557e-1-x86_64.pkg.tar.zst.sig2022-09-15 01:13 141
[PGP]talkfilters-2.3.8-7-x86_64.pkg.tar.zst.sig2022-03-02 18:51 141
[PGP]terminus-font-4.49.1-2-any.pkg.tar.zst.sig2021-03-28 19:12 141
[PGP]tp_smapi-0.43-427-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]ttf-dejavu-2.37+18+g9b5d1b2f-3-any.pkg.tar.zst.sig2022-04-08 19:32 141
[PGP]ttf-droid-20121017-10-any.pkg.tar.zst.sig2021-03-26 01:57 141
[PGP]ttf-inconsolata-1:3.000-3-any.pkg.tar.zst.sig2021-03-28 19:12 141
[PGP]txt2tags-3.7-7-any.pkg.tar.zst.sig2022-03-02 19:03 141
[PGP]ukui-power-manager-3.0.1-2-x86_64.pkg.tar.zst.sig2022-02-10 23:40 141
[PGP]ukwm-1.2.1-3-x86_64.pkg.tar.zst.sig2022-02-12 03:04 141
[PGP]valabind-1.8.0-3-x86_64.pkg.tar.zst.sig2022-03-17 21:43 141
[PGP]vhba-module-20211218-69-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]vhba-module-dkms-20211218-69-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]virtualbox-host-modules-arch-6.1.38-7-x86_64.pkg.tar.zst.sig2022-09-25 11:23 141
[PGP]wasi-libc-1:0+258+30094b6-1-any.pkg.tar.zst.sig2022-06-17 01:35 141
[PGP]wingpanel-3.0.2-6-x86_64.pkg.tar.zst.sig2022-04-04 01:49 141
[PGP]wqy-bitmapfont-1.0.0RC1-5-any.pkg.tar.zst.sig2021-03-28 23:19 141
[PGP]wqy-microhei-0.2.0_beta-11-any.pkg.tar.zst.sig2021-03-28 23:19 141
[PGP]wqy-zenhei-0.9.45-9-any.pkg.tar.zst.sig2021-03-28 23:33 141
[PGP]yubioath-desktop-5.1.0-3-x86_64.pkg.tar.zst.sig2022-03-05 20:24 141
[PGP]kdiskmark-3.1.2-1-x86_64.pkg.tar.zst.sig2022-09-24 17:58 144
[PGP]libtg_owt-0.git16.442d5bb593c0ae314960308d78f2016ad1f80c3e-1-x86_64.pkg.tar.zst.sig2022-09-23 03:53 144
[PGP]pelican-4.8.0-1-any.pkg.tar.zst.sig2022-08-27 17:18 144
[PGP]plantuml-1.2022.7-1-any.pkg.tar.zst.sig2022-09-24 19:04 144
[PGP]powerline-2.8.3-1-x86_64.pkg.tar.zst.sig2022-09-23 16:58 144
[PGP]powerline-common-2.8.3-1-x86_64.pkg.tar.zst.sig2022-09-23 16:58 144
[PGP]powerline-fonts-2.8.3-1-x86_64.pkg.tar.zst.sig2022-09-23 16:58 144
[PGP]powerline-vim-2.8.3-1-x86_64.pkg.tar.zst.sig2022-09-23 16:58 144
[PGP]python-powerline-2.8.3-1-x86_64.pkg.tar.zst.sig2022-09-23 16:58 144
[PGP]telegram-desktop-4.2.0-1-x86_64.pkg.tar.zst.sig2022-09-23 03:55 144
[PGP]xfsdump-3.1.11-1-x86_64.pkg.tar.zst.sig2022-09-24 19:20 144
[PGP]alltray-0.7.5.1dev-6-x86_64.pkg.tar.zst.sig2020-10-06 17:45 215
[PGP]ansible-lint-6.7.0-1-any.pkg.tar.zst.sig2022-09-24 02:17 215
[PGP]autotiling-rs-0.1.3-1-x86_64.pkg.tar.zst.sig2022-08-23 00:06 215
[PGP]avr-libc-2.1.0-1-any.pkg.tar.zst.sig2022-01-29 16:29 215
[PGP]avrdude-1:7.0-2-x86_64.pkg.tar.zst.sig2022-07-14 15:07 215
[PGP]caprine-2.56.1-2-any.pkg.tar.zst.sig2022-08-23 14:32 215
[PGP]conmon-1:2.1.4-1-x86_64.pkg.tar.zst.sig2022-08-29 17:02 215
[PGP]crun-1.6-1-x86_64.pkg.tar.zst.sig2022-09-07 23:17 215
[PGP]ctop-0.7.7-2-x86_64.pkg.tar.zst.sig2022-04-27 16:44 215
[PGP]draco-1.5.3-1-x86_64.pkg.tar.zst.sig2022-08-12 18:48 215
[PGP]ecb-2.40.1pre-12-any.pkg.tar.zst.sig2020-10-07 22:02 215
[PGP]exfatprogs-1.1.3-1-x86_64.pkg.tar.zst.sig2021-11-17 11:54 215
[PGP]fcgiwrap-1.1.0-8-x86_64.pkg.tar.zst.sig2020-10-06 17:15 215
[PGP]fetchmail-6.4.33-1-x86_64.pkg.tar.zst.sig2022-08-27 13:10 215
[PGP]filezilla-3.61.0-1-x86_64.pkg.tar.zst.sig2022-09-19 13:48 215
[PGP]fwupd-1.8.5-1-x86_64.pkg.tar.zst.sig2022-09-22 16:44 215
[PGP]fwupd-efi-1.3-1-x86_64.pkg.tar.zst.sig2022-04-14 14:27 215
[PGP]gradle-7.5.1-1-any.pkg.tar.zst.sig2022-08-06 16:01 215
[PGP]gradle-doc-7.5.1-1-any.pkg.tar.zst.sig2022-08-06 16:01 215
[PGP]gradle-src-7.5.1-1-any.pkg.tar.zst.sig2022-08-06 16:01 215
[PGP]hashcat-1:6.2.6-1-x86_64.pkg.tar.zst.sig2022-09-09 15:15 215
[PGP]i3status-rust-0.22.0-1-x86_64.pkg.tar.zst.sig2022-06-20 11:59 215
[PGP]imapsync-2.200-1-any.pkg.tar.zst.sig2022-06-06 15:25 215
[PGP]intel-undervolt-1.7-2-x86_64.pkg.tar.zst.sig2020-07-05 01:14 215
[PGP]ispin-6.5.0-2-any.pkg.tar.zst.sig2020-06-30 06:02 215
[PGP]iverilog-11.0-2-x86_64.pkg.tar.zst.sig2022-01-25 00:36 215
[PGP]keycloak-19.0.2-1-any.pkg.tar.zst.sig2022-09-15 14:52 215
[PGP]libaxc-0.3.7-1-x86_64.pkg.tar.zst.sig2022-01-29 20:00 215
[PGP]libfilezilla-1:0.39.1-1-x86_64.pkg.tar.zst.sig2022-09-13 13:36 215
[PGP]libgovirt-2:0.3.8-1-x86_64.pkg.tar.zst.sig2022-09-07 14:43 215
[PGP]libkeccak-1.3.1.2-1-x86_64.pkg.tar.zst.sig2022-02-19 21:15 215
[PGP]libomemo-0.8.1-1-x86_64.pkg.tar.zst.sig2022-04-10 17:41 215
[PGP]libopenraw-0.3.2-1-x86_64.pkg.tar.zst.sig2022-06-27 16:18 215
[PGP]libpurple-lurch-0.7.0-1-x86_64.pkg.tar.zst.sig2021-02-13 23:59 215
[PGP]libslirp-4.7.0-1-x86_64.pkg.tar.zst.sig2022-04-27 11:32 215
[PGP]libvirt-1:8.7.0-1-x86_64.pkg.tar.zst.sig2022-09-01 18:07 215
[PGP]libvirt-python-1:8.7.0-1-x86_64.pkg.tar.zst.sig2022-09-01 18:08 215
[PGP]libvirt-storage-gluster-1:8.7.0-1-x86_64.pkg.tar.zst.sig2022-09-01 18:07 215
[PGP]libvirt-storage-iscsi-direct-1:8.7.0-1-x86_64.pkg.tar.zst.sig2022-09-01 18:07 215
[PGP]lxappearance-0.6.3-4-x86_64.pkg.tar.zst.sig2020-10-06 16:58 215
[PGP]lxappearance-gtk3-0.6.3-4-x86_64.pkg.tar.zst.sig2020-10-06 16:58 215
[PGP]neomutt-20220429-1-x86_64.pkg.tar.zst.sig2022-04-29 14:54 215
[PGP]opensc-0.22.0-1-x86_64.pkg.tar.zst.sig2021-08-10 14:38 215
[PGP]otf-hermit-2.0-2-any.pkg.tar.zst.sig2020-07-06 03:26 215
[PGP]pcsclite-1.9.9-1-x86_64.pkg.tar.zst.sig2022-09-11 18:47 215
[PGP]pdftk-3.3.3-1-any.pkg.tar.zst.sig2022-09-23 00:02 215
[PGP]perl-par-packer-1.056-1-x86_64.pkg.tar.zst.sig2022-09-06 11:49 215
[PGP]profanity-1:0.13.0-1-x86_64.pkg.tar.zst.sig2022-09-13 12:03 215
[PGP]profanity-gtk-1:0.13.0-1-x86_64.pkg.tar.zst.sig2022-09-13 12:03 215
[PGP]ptex-2.4.2-1-x86_64.pkg.tar.zst.sig2022-08-12 19:03 215
[PGP]python-bracex-2.3-1-any.pkg.tar.zst.sig2022-05-30 13:11 215
[PGP]python-hcloud-1.17.0-1-any.pkg.tar.zst.sig2022-08-12 18:58 215
[PGP]python-pre-commit-2.20.0-1-any.pkg.tar.zst.sig2022-07-11 22:01 215
[PGP]python-rich-12.5.1-1-any.pkg.tar.zst.sig2022-07-11 22:04 215
[PGP]python-tensorflow-serving-api-2.9.1-1-any.pkg.tar.zst.sig2022-08-12 20:21 215
[PGP]python-versioningit-2.0.1-1-any.pkg.tar.zst.sig2022-08-02 01:39 215
[PGP]python-wcmatch-8.4.1-1-any.pkg.tar.zst.sig2022-09-20 16:04 215
[PGP]redis-7.0.5-1-x86_64.pkg.tar.zst.sig2022-09-22 01:17 215
[PGP]ripgrep-all-0.9.6-3-x86_64.pkg.tar.zst.sig2021-12-15 15:05 215
[PGP]robin-map-1.0.1-1-x86_64.pkg.tar.zst.sig2022-08-12 20:23 215
[PGP]runc-1.1.4-1-x86_64.pkg.tar.zst.sig2022-08-26 01:18 215
[PGP]sequoia-sop-0.27.1-1-x86_64.pkg.tar.zst.sig2022-07-20 23:26 215
[PGP]sequoia-sq-0.27.0-1-x86_64.pkg.tar.zst.sig2022-07-14 17:11 215
[PGP]sha3sum-1.2.2-1-x86_64.pkg.tar.zst.sig2022-03-25 17:20 215
[PGP]sigutils-0.1.0-4-x86_64.pkg.tar.zst.sig2021-07-17 14:35 215
[PGP]skopeo-1.9.2-1-x86_64.pkg.tar.zst.sig2022-08-02 20:17 215
[PGP]slirp4netns-1.2.0-1-x86_64.pkg.tar.zst.sig2022-05-02 13:55 215
[PGP]solaar-1.1.5-1-any.pkg.tar.zst.sig2022-09-15 01:26 215
[PGP]spin-6.5.2-4-x86_64.pkg.tar.zst.sig2020-06-30 05:58 215
[PGP]spotifyd-0.3.3-1-x86_64.pkg.tar.zst.sig2021-12-07 22:05 215
[PGP]streamlink-5.0.1-1-any.pkg.tar.zst.sig2022-09-22 16:46 215
[PGP]tensorboard-2.10.0-1-x86_64.pkg.tar.zst.sig2022-08-12 21:38 215
[PGP]thermald-2.5.1-1-x86_64.pkg.tar.zst.sig2022-09-20 16:05 215
[PGP]ttf-eurof-1.0-2-any.pkg.tar.zst.sig2020-07-06 03:53 215
[PGP]ttf-monofur-1.0-7-any.pkg.tar.zst.sig2020-07-06 03:47 215
[PGP]upterm-0.9.0-1-x86_64.pkg.tar.zst.sig2022-08-12 21:47 215
[PGP]vim-syntastic-3.10.0-2-any.pkg.tar.zst.sig2020-09-14 16:54 215
[PGP]virt-install-4.1.0-1-any.pkg.tar.zst.sig2022-08-05 14:17 215
[PGP]virt-manager-4.1.0-1-any.pkg.tar.zst.sig2022-08-05 14:17 215
[PGP]virt-viewer-11.0-1-x86_64.pkg.tar.zst.sig2021-11-23 22:20 215
[PGP]wasmtime-1.0.1-1-x86_64.pkg.tar.zst.sig2022-09-27 00:04 215
[PGP]xss-lock-0.3.0.g1e158fb20108-4-x86_64.pkg.tar.zst.sig2020-09-13 12:07 215
[PGP]geckodriver-0.30.0-1-x86_64.pkg.tar.zst.sig2021-10-03 21:55 309
[PGP]parole-4.16.0-1-x86_64.pkg.tar.zst.sig2021-01-22 20:43 309
[PGP]perl-encode-imaputf7-1.05-6-any.pkg.tar.zst.sig2022-05-29 13:53 309
[PGP]perl-term-progressbar-2.22-6-any.pkg.tar.zst.sig2022-05-29 14:04 309
[PGP]python-botocore-1.27.80-1-any.pkg.tar.zst.sig2022-09-24 09:44 309
[PGP]python-editables-0.3-2-any.pkg.tar.zst.sig2022-05-17 21:15 309
[PGP]python-jedi-0.18.1-1-any.pkg.tar.zst.sig2021-12-04 12:33 309
[PGP]python-py-1.11.0-1-any.pkg.tar.zst.sig2021-12-15 10:00 309
[PGP]python-shtab-1.5.5-1-any.pkg.tar.zst.sig2022-06-19 16:18 309
[PGP]texmaker-5.1.3-1-x86_64.pkg.tar.zst.sig2022-04-28 19:24 309
[PGP]wit-3.04a-2-x86_64.pkg.tar.zst.sig2022-03-06 17:08 309
[PGP]acme-user-1.0.1-1-any.pkg.tar.zst.sig2022-04-09 22:27 310
[PGP]acpi-1.7-3-x86_64.pkg.tar.zst.sig2020-05-06 23:35 310
[PGP]acpi_call-lts-1.2.2-75-x86_64.pkg.tar.zst.sig2022-09-23 18:30 310
[PGP]acpica-20220331-1-x86_64.pkg.tar.zst.sig2022-04-02 15:45 310
[PGP]acsccid-1.1.8-2-x86_64.pkg.tar.zst.sig2022-05-20 18:51 310
[PGP]activity-log-manager-0.9.7-9-x86_64.pkg.tar.zst.sig2022-04-25 08:49 310
[PGP]adapta-gtk-theme-3.95.0.11-2-any.pkg.tar.zst.sig2021-07-18 19:47 310
[PGP]adios2-2.8.3-1-x86_64.pkg.tar.zst.sig2022-08-03 01:41 310
[PGP]adwaita-qt5-1.4.2-1-x86_64.pkg.tar.zst.sig2022-09-20 16:15 310
[PGP]adwaita-qt6-1.4.2-1-x86_64.pkg.tar.zst.sig2022-09-20 16:15 310
[PGP]afl-2.57b-11-x86_64.pkg.tar.zst.sig2022-06-25 13:31 310
[PGP]alembic-1.8.3-3-x86_64.pkg.tar.zst.sig2022-05-20 20:03 310
[PGP]ali-0.7.5-2-x86_64.pkg.tar.zst.sig2022-04-27 18:23 310
[PGP]alicloud-vault-1.3.4-2-x86_64.pkg.tar.zst.sig2022-04-27 18:24 310
[PGP]allegro4-4.4.3.1-3-x86_64.pkg.tar.zst.sig2020-05-29 07:13 310
[PGP]almanah-0.12.3-4-x86_64.pkg.tar.zst.sig2022-04-25 08:56 310
[PGP]alure-1.2-8-x86_64.pkg.tar.zst.sig2022-05-02 22:53 310
[PGP]amtk-5.5.1-1-x86_64.pkg.tar.zst.sig2022-06-11 10:42 310
[PGP]amule-1:2.3.3-5-x86_64.pkg.tar.zst.sig2022-07-07 19:48 310
[PGP]android-file-transfer-4.2-2-x86_64.pkg.tar.zst.sig2022-05-02 22:58 310
[PGP]ansible-bender-0.9.0-2-any.pkg.tar.zst.sig2021-12-03 01:13 310
[PGP]antic-0.2.5-1-x86_64.pkg.tar.zst.sig2022-06-24 16:32 310
[PGP]apitrace-10.0-1-x86_64.pkg.tar.zst.sig2021-05-29 12:17 310
[PGP]apper-1.0.0-5-x86_64.pkg.tar.zst.sig2022-02-22 08:37 310
[PGP]appmenu-gtk-module-0.7.6-1-x86_64.pkg.tar.zst.sig2020-10-28 22:22 310
[PGP]arb-2.23.0-1-x86_64.pkg.tar.zst.sig2022-06-29 17:52 310
[PGP]arc-icon-theme-20161122-3-any.pkg.tar.zst.sig2020-07-07 21:10 310
[PGP]archey3-0.5-12-any.pkg.tar.zst.sig2021-12-03 02:29 310
[PGP]archlinux-repro-20220805-1-any.pkg.tar.zst.sig2022-08-05 15:07 310
[PGP]archlinux-xdg-menu-0.7.6.3-2-any.pkg.tar.zst.sig2020-01-06 16:52 310
[PGP]arduino-builder-1.6.1-2-x86_64.pkg.tar.zst.sig2022-04-27 18:58 310
[PGP]argyllcms-2.3.1-1-x86_64.pkg.tar.zst.sig2022-06-29 19:28 310
[PGP]asciidoctor-2.0.17-1-any.pkg.tar.zst.sig2022-01-09 18:17 310
[PGP]aspell-hu-0.99.4.2-6-x86_64.pkg.tar.zst.sig2020-07-07 21:10 310
[PGP]aspell-it-2.4_20070901-1-any.pkg.tar.zst.sig2020-06-14 10:28 310
[PGP]atril-1.26.0-2-x86_64.pkg.tar.zst.sig2022-09-22 20:08 310
[PGP]audaspace-1.3.0-6-x86_64.pkg.tar.zst.sig2021-12-03 01:45 310
[PGP]audex-0.79+160+gaa00d81-1-x86_64.pkg.tar.zst.sig2020-07-07 22:53 310
[PGP]audio-convert-0.3.1.1-9-any.pkg.tar.zst.sig2020-07-07 21:31 310
[PGP]augeas-1.13.0-1-x86_64.pkg.tar.zst.sig2022-08-31 20:51 310
[PGP]auto-multiple-choice-1.5.2-3-x86_64.pkg.tar.zst.sig2022-06-06 08:05 310
[PGP]autocutsel-0.10.1-1-x86_64.pkg.tar.zst.sig2021-04-23 23:03 310
[PGP]aws-cli-1.25.81-1-any.pkg.tar.zst.sig2022-09-24 09:45 310
[PGP]aws-vault-6.6.0-2-x86_64.pkg.tar.zst.sig2022-04-27 16:15 310
[PGP]axel-2.17.11-1-x86_64.pkg.tar.zst.sig2021-12-20 04:22 310
[PGP]ayatana-ido-0.9.2-1-x86_64.pkg.tar.zst.sig2022-06-04 10:00 310
[PGP]backuppc-4.4.0-5-x86_64.pkg.tar.zst.sig2022-05-29 14:04 310
[PGP]balsa-2.6.3-2-x86_64.pkg.tar.zst.sig2021-11-13 21:22 310
[PGP]bandit-1.7.4-1-any.pkg.tar.zst.sig2022-07-03 17:34 310
[PGP]barcode-0.99-5-x86_64.pkg.tar.zst.sig2020-07-07 23:21 310
[PGP]bctoolbox-5.1.61-1-x86_64.pkg.tar.zst.sig2022-09-16 16:18 310
[PGP]bcunit-3.0.2+12+g3c720fb-1-x86_64.pkg.tar.xz.sig2019-12-09 22:01 310
[PGP]benzene-20130630-2-x86_64.pkg.tar.zst.sig2020-05-08 09:20 310
[PGP]bettercap-2.32.0-2-x86_64.pkg.tar.zst.sig2022-04-27 16:16 310
[PGP]bigsh0t-2.5.1-2-x86_64.pkg.tar.zst.sig2022-06-13 10:16 310
[PGP]binwalk-2.3.3-3-any.pkg.tar.zst.sig2021-12-03 01:12 310
[PGP]blackbox-0.77-1-x86_64.pkg.tar.zst.sig2021-05-15 12:50 310
[PGP]bladerf-2021.10-1-x86_64.pkg.tar.zst.sig2022-04-23 10:16 310
[PGP]blanket-0.6.0-2-any.pkg.tar.zst.sig2022-05-07 19:52 310
[PGP]bliss-0.77-2-x86_64.pkg.tar.zst.sig2021-12-26 14:22 310
[PGP]blueberry-1.4.8-1-any.pkg.tar.zst.sig2022-07-26 22:57 310
[PGP]blueman-2.3.2-1-x86_64.pkg.tar.zst.sig2022-08-27 19:06 310
[PGP]blueprint-compiler-0.4.0-1-any.pkg.tar.zst.sig2022-09-05 20:49 310
[PGP]bochs-2.7-2-x86_64.pkg.tar.zst.sig2022-04-23 10:19 310
[PGP]bpython-0.22.1-3-any.pkg.tar.zst.sig2021-12-27 11:39 310
[PGP]brial-1.2.11-1-x86_64.pkg.tar.zst.sig2022-07-29 16:07 310
[PGP]browserpass-3.0.10-2-x86_64.pkg.tar.zst.sig2022-04-27 18:13 310
[PGP]bsd-games-3.2-1-x86_64.pkg.tar.zst.sig2022-05-04 07:49 310
[PGP]bsdiff-4.3-11-x86_64.pkg.tar.zst.sig2022-04-23 10:23 310
[PGP]btfs-2.24-2-x86_64.pkg.tar.zst.sig2022-01-10 18:12 310
[PGP]bti-034-4-x86_64.pkg.tar.zst.sig2020-04-25 17:02 310
[PGP]btrfs-heatmap-9-2-any.pkg.tar.zst.sig2022-04-23 13:29 310
[PGP]buckygen-1.1-2-x86_64.pkg.tar.zst.sig2021-09-03 20:56 310
[PGP]budgie-extras-1.4.0-1-x86_64.pkg.tar.zst.sig2022-06-12 09:26 310
[PGP]budgie-screensaver-5.0.2-1-x86_64.pkg.tar.zst.sig2022-06-11 09:33 310
[PGP]buho-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:12 310
[PGP]buoh-0.8.2-15-x86_64.pkg.tar.zst.sig2022-04-25 08:59 310
[PGP]busybox-1.34.1-1-x86_64.pkg.tar.zst.sig2021-11-09 22:37 310
[PGP]bwm-ng-0.6.3-2-x86_64.pkg.tar.zst.sig2022-04-23 10:33 310
[PGP]byobu-5.133-3-any.pkg.tar.zst.sig2022-04-25 22:04 310
[PGP]bzrtp-5.1.61-1-x86_64.pkg.tar.zst.sig2022-09-16 16:21 310
[PGP]c-xsc-2.5.4-2-x86_64.pkg.tar.zst.sig2020-05-08 09:52 310
[PGP]calc-2.14.0.8-2-x86_64.pkg.tar.zst.sig2022-04-23 10:35 310
[PGP]cantata-2.5.0-1-x86_64.pkg.tar.zst.sig2022-03-02 21:41 310
[PGP]canto-curses-0.9.9-4-x86_64.pkg.tar.zst.sig2021-12-03 02:11 310
[PGP]capstone-4.0.2-6-x86_64.pkg.tar.zst.sig2022-04-28 20:07 310
[PGP]cataclysm-dda-0.F.3-2-x86_64.pkg.tar.zst.sig2022-04-23 10:44 310
[PGP]cataclysm-dda-tiles-0.F.3-2-x86_64.pkg.tar.zst.sig2022-04-23 10:44 310
[PGP]catch2-2.13.9-1-any.pkg.tar.zst.sig2022-05-05 00:06 310
[PGP]catfish-4.16.4-1-any.pkg.tar.zst.sig2022-07-18 22:43 310
[PGP]cawbird-1.5-1-x86_64.pkg.tar.zst.sig2022-05-04 12:36 310
[PGP]cbatticon-1.6.13-1-x86_64.pkg.tar.zst.sig2022-06-11 10:37 310
[PGP]cddlib-1:0.94m-1-x86_64.pkg.tar.zst.sig2020-12-08 16:11 310
[PGP]celluloid-0.24-1-x86_64.pkg.tar.zst.sig2022-09-03 22:57 310
[PGP]cereal-1.3.2-1-any.pkg.tar.zst.sig2022-03-15 23:03 310
[PGP]cgal-5.5-1-any.pkg.tar.zst.sig2022-07-26 14:02 310
[PGP]cgasm-1.0.0-4-x86_64.pkg.tar.zst.sig2022-05-01 14:25 310
[PGP]cgns-4.3.0-3-x86_64.pkg.tar.zst.sig2022-05-18 22:53 310
[PGP]choqok-1.7.0-4-x86_64.pkg.tar.zst.sig2022-06-21 20:03 310
[PGP]chromium-bsu-0.9.16.1-1-x86_64.pkg.tar.zst.sig2020-04-22 17:53 310
[PGP]cinnamon-5.4.12-1-x86_64.pkg.tar.zst.sig2022-09-10 16:13 310
[PGP]cinnamon-control-center-5.4.7-1-x86_64.pkg.tar.zst.sig2022-09-10 16:09 310
[PGP]cinnamon-desktop-5.4.2-1-x86_64.pkg.tar.zst.sig2022-07-20 22:15 310
[PGP]cinnamon-menus-5.4.0-1-x86_64.pkg.tar.zst.sig2022-06-18 11:47 310
[PGP]cinnamon-screensaver-5.4.4-1-x86_64.pkg.tar.zst.sig2022-09-10 16:14 310
[PGP]cinnamon-session-5.4.0-1-x86_64.pkg.tar.zst.sig2022-06-18 12:44 310
[PGP]cinnamon-settings-daemon-5.4.5-1-x86_64.pkg.tar.zst.sig2022-09-10 16:07 310
[PGP]cinnamon-translations-5.4.2-1-any.pkg.tar.zst.sig2022-07-24 16:56 310
[PGP]cjs-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:15 310
[PGP]cjson-1.7.15-1-x86_64.pkg.tar.zst.sig2021-11-01 13:38 310
[PGP]clamtk-6.14-1-any.pkg.tar.zst.sig2021-12-25 12:42 310
[PGP]cli11-2.2.0-1-any.pkg.tar.zst.sig2022-04-03 20:04 310
[PGP]clinfo-3.0.21.02.21-1-x86_64.pkg.tar.zst.sig2021-03-07 15:57 310
[PGP]clipgrab-3.9.7-2-x86_64.pkg.tar.zst.sig2021-10-27 00:13 310
[PGP]cliquer-1.22-1-x86_64.pkg.tar.zst.sig2020-09-13 18:39 310
[PGP]cloc-1.94-1-any.pkg.tar.zst.sig2022-07-05 11:42 310
[PGP]cmake-fedora-2.9.3-7-any.pkg.tar.zst.sig2021-12-16 15:48 310
[PGP]cmatrix-2.0-2-x86_64.pkg.tar.zst.sig2020-06-29 20:57 310
[PGP]cockatrice-2.8.0-9-x86_64.pkg.tar.zst.sig2022-06-11 17:15 310
[PGP]codeblocks-20.03-4-x86_64.pkg.tar.zst.sig2022-07-12 23:54 310
[PGP]coin-or-asl-2.0.0-1-x86_64.pkg.tar.zst.sig2022-02-02 08:32 310
[PGP]coin-or-cbc-2.10.8-1-x86_64.pkg.tar.zst.sig2022-05-06 08:33 310
[PGP]coin-or-cgl-0.60.6-1-x86_64.pkg.tar.zst.sig2022-05-05 08:45 310
[PGP]coin-or-clp-1.17.7-2-x86_64.pkg.tar.zst.sig2022-02-02 08:37 310
[PGP]coin-or-coinutils-2.11.6-1-x86_64.pkg.tar.zst.sig2022-01-10 22:16 310
[PGP]coin-or-csdp-6.2.0-3-x86_64.pkg.tar.xz.sig2019-11-06 22:13 310
[PGP]coin-or-data-sample-1.2.12-1-any.pkg.tar.zst.sig2022-01-08 19:34 310
[PGP]coin-or-mp-1.8.4-4-x86_64.pkg.tar.zst.sig2022-02-02 10:22 310
[PGP]coin-or-osi-0.108.7-1-x86_64.pkg.tar.zst.sig2022-01-09 22:30 310
[PGP]communicator-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:12 310
[PGP]contractor-0.3.5-2-x86_64.pkg.tar.zst.sig2022-03-06 16:50 310
[PGP]converseen-0.9.9.7-1-x86_64.pkg.tar.zst.sig2022-09-03 23:05 310
[PGP]coxeter-git.20180226-3-x86_64.pkg.tar.zst.sig2020-05-08 10:15 310
[PGP]cozy-desktop-3.36.1b1-1-x86_64.pkg.tar.zst.sig2022-08-04 13:00 310
[PGP]cozy-stack-1:1.5.7-1-x86_64.pkg.tar.zst.sig2022-07-01 14:52 310
[PGP]ctemplate-2.4-2-x86_64.pkg.tar.zst.sig2021-07-20 21:20 310
[PGP]cuneiform-1.1.0-22-x86_64.pkg.tar.zst.sig2022-03-21 09:06 310
[PGP]curator-5.7.6-7-x86_64.pkg.tar.zst.sig2021-12-03 00:32 310
[PGP]curlie-1.6.9-2-x86_64.pkg.tar.zst.sig2022-04-27 18:15 310
[PGP]curtail-1.3.1-1-any.pkg.tar.zst.sig2022-07-18 22:39 310
[PGP]cxxtest-4.4-9-any.pkg.tar.zst.sig2021-12-03 00:43 310
[PGP]cython-0.29.32-2-x86_64.pkg.tar.zst.sig2022-08-20 14:38 310
[PGP]dblatex-0.3.12-3-any.pkg.tar.zst.sig2021-12-03 02:11 310
[PGP]dbus-c++-0.9.0-10-x86_64.pkg.tar.zst.sig2022-05-15 18:53 310
[PGP]deepin-calculator-5.7.21-3-x86_64.pkg.tar.zst.sig2022-09-08 14:41 310
[PGP]deepin-dock-5.5.67-2-x86_64.pkg.tar.zst.sig2022-09-08 14:41 310
[PGP]deepin-draw-5.11.3-2-x86_64.pkg.tar.zst.sig2022-09-08 14:41 310
[PGP]deepin-file-manager-1:5.6.4-2-x86_64.pkg.tar.zst.sig2022-09-08 14:42 310
[PGP]deepin-image-viewer-5.9.3-2-x86_64.pkg.tar.zst.sig2022-09-08 14:43 310
[PGP]deepin-menu-5.0.1-8-x86_64.pkg.tar.zst.sig2022-09-08 14:42 310
[PGP]deepin-qt-dbus-factory-5.5.22-5-x86_64.pkg.tar.zst.sig2022-09-08 14:42 310
[PGP]devede-4.17.0-1-any.pkg.tar.zst.sig2022-03-13 19:50 310
[PGP]devil-1.8.0-6-x86_64.pkg.tar.zst.sig2022-05-13 09:37 310
[PGP]diffoscope-222-1-x86_64.pkg.tar.zst.sig2022-09-23 14:43 310
[PGP]diffuse-0.7.5-1-any.pkg.tar.zst.sig2022-06-11 10:08 310
[PGP]dillo-3.0.5-11-x86_64.pkg.tar.zst.sig2022-04-25 09:13 310
[PGP]disorderfs-0.5.11-1-x86_64.pkg.tar.zst.sig2021-01-23 12:09 310
[PGP]displaycal-3.9.6-2-x86_64.pkg.tar.zst.sig2022-07-21 22:43 310
[PGP]dnf-4.14.0-1-any.pkg.tar.zst.sig2022-09-12 14:18 310
[PGP]docbook2x-0.8.8-18-x86_64.pkg.tar.zst.sig2021-04-01 15:57 310
[PGP]docker-compose-2.11.1-1-x86_64.pkg.tar.zst.sig2022-09-20 23:50 310
[PGP]doge-3.5.0-7-any.pkg.tar.zst.sig2021-12-03 01:42 310
[PGP]dosemu-1:1.4.0.8+753+g18f6f5cd-3-x86_64.pkg.tar.zst.sig2020-07-08 00:08 310
[PGP]drawing-1.0.1-1-any.pkg.tar.zst.sig2022-05-04 14:07 310
[PGP]dsdp-5.8-6-x86_64.pkg.tar.zst.sig2022-04-24 18:54 310
[PGP]dtkwm-2.0.12-15-x86_64.pkg.tar.zst.sig2022-09-08 14:44 310
[PGP]dvdauthor-0.7.2-11-x86_64.pkg.tar.zst.sig2021-05-31 22:20 310
[PGP]dvdbackup-0.4.2-6-x86_64.pkg.tar.zst.sig2020-04-05 13:14 310
[PGP]dvdstyler-3.2.1-1-x86_64.pkg.tar.zst.sig2022-07-07 23:01 310
[PGP]e-antic-1.2.1-2-x86_64.pkg.tar.zst.sig2022-06-24 16:36 310
[PGP]e3-2.82-6-x86_64.pkg.tar.zst.sig2022-04-25 22:11 310
[PGP]echoping-6.0.2-10-x86_64.pkg.tar.zst.sig2021-11-13 21:19 310
[PGP]ecryptfs-utils-111-5-x86_64.pkg.tar.zst.sig2021-11-14 09:42 310
[PGP]element-desktop-1.11.4-1-x86_64.pkg.tar.zst.sig2022-08-31 18:15 310
[PGP]element-web-1.11.4-1-x86_64.pkg.tar.zst.sig2022-08-31 18:15 310
[PGP]elementary-wallpapers-6.1.0-2-any.pkg.tar.zst.sig2022-03-06 16:46 310
[PGP]elinks-0.15.1-1-x86_64.pkg.tar.zst.sig2022-07-31 14:42 310
[PGP]emovix-0.9.0-8-any.pkg.tar.zst.sig2020-05-08 10:18 310
[PGP]enblend-enfuse-4.2.r1524+h4c30a326b3f4-2-x86_64.pkg.tar.zst.sig2021-12-12 13:00 310
[PGP]encfs-1.9.5-5-x86_64.pkg.tar.zst.sig2021-06-14 16:08 310
[PGP]engrampa-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:01 310
[PGP]entityx-1.3.0-3-x86_64.pkg.tar.zst.sig2022-04-25 22:16 310
[PGP]eom-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:03 310
[PGP]eslint_d-12.1.0-2-any.pkg.tar.zst.sig2022-05-12 20:53 310
[PGP]esptool-4.2.1-1-any.pkg.tar.zst.sig2022-08-13 23:32 310
[PGP]etl-1.4.2-1-any.pkg.tar.zst.sig2021-07-30 13:46 310
[PGP]evemu-2.7.0-8-x86_64.pkg.tar.zst.sig2021-12-03 02:17 310
[PGP]evtest-1.35-1-x86_64.pkg.tar.zst.sig2022-05-20 12:08 310
[PGP]facter-3.14.24-2-x86_64.pkg.tar.zst.sig2022-09-18 06:57 310
[PGP]fail2ban-0.11.2-3-any.pkg.tar.zst.sig2021-12-04 02:08 310
[PGP]fasm-1.73.30-1-x86_64.pkg.tar.zst.sig2022-05-04 11:49 310
[PGP]fastjet-3.4.0-1-x86_64.pkg.tar.zst.sig2021-12-25 13:55 310
[PGP]fatresize-1.1.0-1-x86_64.pkg.tar.zst.sig2020-04-05 13:46 310
[PGP]fbgrab-1.5-2-x86_64.pkg.tar.zst.sig2022-04-23 10:45 310
[PGP]fbida-2.14-3-x86_64.pkg.tar.zst.sig2021-03-24 19:43 310
[PGP]fcitx-mozc-2.26.4360.102.gca82d39-2-x86_64.pkg.tar.zst.sig2022-04-23 14:21 310
[PGP]fcitx-qt5-1.2.7-6-x86_64.pkg.tar.zst.sig2022-09-08 14:44 310
[PGP]fcitx-qt6-1.2.7-6-x86_64.pkg.tar.zst.sig2022-09-08 14:44 310
[PGP]fcitx5-mozc-2.26.4632.102.g4d2e3bd-2-x86_64.pkg.tar.zst.sig2022-04-23 13:34 310
[PGP]feathernotes-1.0.0-1-x86_64.pkg.tar.zst.sig2022-09-03 21:12 310
[PGP]featherpad-1.3.1-1-x86_64.pkg.tar.zst.sig2022-08-03 20:27 310
[PGP]fflas-ffpack-2.5.0-1-x86_64.pkg.tar.zst.sig2021-12-14 18:22 310
[PGP]filemanager-actions-3.4-6-x86_64.pkg.tar.zst.sig2022-04-25 09:16 310
[PGP]firefox-developer-edition-106.0b4-1-x86_64.pkg.tar.zst.sig2022-09-26 03:52 310
[PGP]firefox-developer-edition-i18n-ach-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-af-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-an-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-ar-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-ast-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-az-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-be-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-bg-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-bn-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-br-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:57 310
[PGP]firefox-developer-edition-i18n-bs-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ca-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ca-valencia-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-cak-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-cs-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-cy-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-da-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-de-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-dsb-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-el-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-en-ca-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-en-gb-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-en-us-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-eo-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-es-ar-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-es-cl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-es-es-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-es-mx-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-et-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-eu-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-fa-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ff-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-fi-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-fr-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-fy-nl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ga-ie-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-gd-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-gl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-gn-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-gu-in-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-he-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-hi-in-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-hr-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-hsb-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-hu-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-hy-am-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ia-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-id-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-is-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-it-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ja-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ka-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-kab-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-kk-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-km-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-kn-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ko-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-lij-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-lt-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-lv-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-mk-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-mr-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ms-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-my-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-nb-no-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ne-np-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-nl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-nn-no-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-oc-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-pa-in-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-pl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-pt-br-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-pt-pt-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-rm-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ro-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ru-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-si-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-sk-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-sl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-son-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-sq-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-sr-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-sv-se-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ta-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-te-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-th-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-tl-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-tr-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-trs-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-uk-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-ur-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-uz-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-vi-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-xh-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-zh-cn-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]firefox-developer-edition-i18n-zh-tw-106.0b4-1-any.pkg.tar.zst.sig2022-09-26 03:58 310
[PGP]fish-3.5.1-1-x86_64.pkg.tar.zst.sig2022-07-29 00:15 310
[PGP]flake8-1:5.0.4-1-any.pkg.tar.zst.sig2022-09-18 16:06 310
[PGP]flashrom-1.2-4-x86_64.pkg.tar.zst.sig2022-05-20 18:45 310
[PGP]flatbuffers-2.0.8-1-x86_64.pkg.tar.zst.sig2022-08-30 09:30 310
[PGP]flickcurl-1.26-12-x86_64.pkg.tar.zst.sig2021-10-17 01:37 310
[PGP]flint-2.9.0-1-x86_64.pkg.tar.zst.sig2022-06-24 16:29 310
[PGP]flite-2.2-1-x86_64.pkg.tar.zst.sig2021-02-10 23:11 310
[PGP]focuswriter-1.8.2-1-x86_64.pkg.tar.zst.sig2022-09-03 21:19 310
[PGP]fop-2.7-1-any.pkg.tar.zst.sig2022-02-12 00:04 310
[PGP]fplll-5.4.2-1-x86_64.pkg.tar.zst.sig2022-05-24 20:51 310
[PGP]fragments-2.0.2-1-x86_64.pkg.tar.zst.sig2022-02-13 00:19 310
[PGP]freecad-0.20.1-7-x86_64.pkg.tar.zst.sig2022-09-18 04:47 310
[PGP]freedesktop-docs-20181113-2-any.pkg.tar.zst.sig2022-03-11 21:23 310
[PGP]freedroid-1.2.1-2-x86_64.pkg.tar.zst.sig2022-04-23 10:47 310
[PGP]freeradius-3.2.0-2-x86_64.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]frei0r-plugins-1.8.0-2-x86_64.pkg.tar.zst.sig2022-06-06 08:12 310
[PGP]frescobaldi-3.2-1-any.pkg.tar.zst.sig2022-05-14 21:19 310
[PGP]frogatto-1.3.1-39-x86_64.pkg.tar.zst.sig2022-09-18 04:27 310
[PGP]fscrypt-0.3.3-2-x86_64.pkg.tar.zst.sig2022-04-27 18:04 310
[PGP]fstrm-0.6.1-1-x86_64.pkg.tar.zst.sig2021-04-10 17:17 310
[PGP]fwknop-2.6.10-2-x86_64.pkg.tar.zst.sig2020-07-07 23:28 310
[PGP]gajim-1.4.7-2-any.pkg.tar.zst.sig2022-08-03 21:04 310
[PGP]gambas3-dev-tools-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-args-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-cairo-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-chart-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-clipper-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-complex-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-compress-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-crypt-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-data-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-form-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-mysql-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-odbc-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-postgresql-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-db-sqlite3-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-dbus-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-desktop-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-desktop-gnome-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-desktop-x11-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-eval-highlight-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-dialog-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-editor-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-htmlview-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-mdi-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-stock-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-form-terminal-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-gmp-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-gsl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-gtk3-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-gtk3-opengl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-httpd-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-image-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-image-effect-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-image-imlib-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-image-io-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-inotify-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-libxml-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-logging-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-map-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-markdown-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-media-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-media-form-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-memcached-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-mime-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-mysql-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-ncurses-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-net-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-net-curl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-net-pop3-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-net-smtp-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-openal-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-opengl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-opengl-glsl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-opengl-glu-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-opengl-sge-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-openssl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-option-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-pcre-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-poppler-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-qt5-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-qt5-opengl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-qt5-webkit-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-report-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-scanner-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-sdl-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-sdl-sound-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-sdl2-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-sdl2-audio-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-settings-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-signal-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-term-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-util-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-util-web-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-v4l-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-vb-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-web-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-web-feed-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-web-form-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-web-gui-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-xml-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-xml-html-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-xml-rpc-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-gb-xml-xslt-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-ide-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-runtime-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gambas3-script-3.17.3-3-x86_64.pkg.tar.zst.sig2022-09-02 10:15 310
[PGP]gammaray-2.11.3-1-x86_64.pkg.tar.zst.sig2021-10-18 09:00 310
[PGP]gap-4.12.0-2-x86_64.pkg.tar.zst.sig2022-08-29 00:17 310
[PGP]gap-doc-4.12.0-2-x86_64.pkg.tar.zst.sig2022-08-29 00:17 310
[PGP]gap-packages-4.12.0-2-x86_64.pkg.tar.zst.sig2022-08-29 00:17 310
[PGP]gaupol-1.11-1-any.pkg.tar.zst.sig2022-04-04 19:40 310
[PGP]gbrainy-1:2.4.5-1-any.pkg.tar.zst.sig2022-09-03 04:18 310
[PGP]gcompris-qt-2.4-2-x86_64.pkg.tar.zst.sig2022-05-07 13:23 310
[PGP]gcovr-5.2-1-any.pkg.tar.zst.sig2022-08-07 15:06 310
[PGP]gdal-3.5.1-3-x86_64.pkg.tar.zst.sig2022-09-02 09:05 310
[PGP]gearmand-1.1.19.1-3-x86_64.pkg.tar.zst.sig2022-09-18 04:24 310
[PGP]gendesk-1.0.9-3-x86_64.pkg.tar.zst.sig2022-05-01 14:26 310
[PGP]geogebra-6.0.732.0-1-x86_64.pkg.tar.zst.sig2022-09-26 21:44 310
[PGP]geos-3.11.0-1-x86_64.pkg.tar.zst.sig2022-07-07 12:29 310
[PGP]gerbv-2.8.1-2-x86_64.pkg.tar.zst.sig2022-04-07 20:33 310
[PGP]getdns-1.7.0-1-x86_64.pkg.tar.zst.sig2021-07-20 13:59 310
[PGP]gf2x-1.3.0-2-x86_64.pkg.tar.zst.sig2021-11-15 21:58 310
[PGP]gfan-0.6.2-2-x86_64.pkg.tar.zst.sig2020-05-08 11:24 310
[PGP]gfeeds-0.16.2-4-any.pkg.tar.zst.sig2021-12-03 02:11 310
[PGP]gftp-2.9.1b-2-x86_64.pkg.tar.zst.sig2022-04-23 11:14 310
[PGP]ghdl-gcc-1.0.0-6-x86_64.pkg.tar.zst.sig2022-06-23 01:17 310
[PGP]ghdl-llvm-1.0.0-6-x86_64.pkg.tar.zst.sig2022-06-23 01:17 310
[PGP]ghdl-mcode-1.0.0-6-x86_64.pkg.tar.zst.sig2022-06-23 01:17 310
[PGP]ghostwriter-2.1.4-1-x86_64.pkg.tar.zst.sig2022-06-20 23:35 310
[PGP]giac-1.9.0.21-1-x86_64.pkg.tar.zst.sig2022-09-05 22:31 310
[PGP]gimagereader-common-3.4.0-4-x86_64.pkg.tar.zst.sig2022-05-04 22:19 310
[PGP]gimagereader-gtk-3.4.0-4-x86_64.pkg.tar.zst.sig2022-05-04 22:19 310
[PGP]gimagereader-qt-3.4.0-4-x86_64.pkg.tar.zst.sig2022-05-04 22:19 310
[PGP]gimp-plugin-gmic-3.1.6-1-x86_64.pkg.tar.zst.sig2022-08-31 17:16 310
[PGP]gitea-1.17.2-1-x86_64.pkg.tar.zst.sig2022-09-13 00:44 310
[PGP]givaro-4.2.0-1-x86_64.pkg.tar.zst.sig2021-12-14 18:01 310
[PGP]glide-0.5.9-2-x86_64.pkg.tar.zst.sig2022-04-25 20:33 310
[PGP]global-6.6.8-2-x86_64.pkg.tar.zst.sig2022-04-25 22:22 310
[PGP]gloobus-preview-0.4.5.336-4-x86_64.pkg.tar.zst.sig2022-09-22 20:11 310
[PGP]gmic-3.1.6-1-x86_64.pkg.tar.zst.sig2022-08-31 17:16 310
[PGP]gmp-ecm-7.0.5-1-x86_64.pkg.tar.zst.sig2022-05-17 22:14 310
[PGP]gmt-6.4.0-1-x86_64.pkg.tar.zst.sig2022-06-28 02:06 310
[PGP]gmt-doc-6.4.0-1-x86_64.pkg.tar.zst.sig2022-06-28 02:07 310
[PGP]gnome-applets-3.44.0-1-x86_64.pkg.tar.zst.sig2022-05-04 16:05 310
[PGP]gnome-break-timer-2.1.0-1-x86_64.pkg.tar.zst.sig2022-01-25 22:25 310
[PGP]gnome-connections-42.1.2-1-x86_64.pkg.tar.zst.sig2022-05-04 13:01 310
[PGP]gnome-firmware-42.2-1-x86_64.pkg.tar.zst.sig2022-05-26 11:44 310
[PGP]gnome-flashback-3.44.0-1-x86_64.pkg.tar.zst.sig2022-05-04 15:58 310
[PGP]gnome-games-40.0-3-x86_64.pkg.tar.zst.sig2022-04-25 20:38 310
[PGP]gnome-initial-setup-42.2-1-x86_64.pkg.tar.zst.sig2022-06-09 22:44 310
[PGP]gnome-latex-3.40.0-1-x86_64.pkg.tar.zst.sig2022-05-22 11:02 310
[PGP]gnome-panel-3.44.0-1-x86_64.pkg.tar.zst.sig2022-05-04 16:01 310
[PGP]gnome-passwordsafe-6.5-2-any.pkg.tar.zst.sig2022-07-04 20:27 310
[PGP]gnome-podcasts-0.5.1-1-x86_64.pkg.tar.zst.sig2022-02-12 21:44 310
[PGP]gnome-recipes-2.0.4-3-x86_64.pkg.tar.zst.sig2022-04-25 20:48 310
[PGP]gnome-subtitles-1.7.2-1-x86_64.pkg.tar.zst.sig2021-11-03 17:27 310
[PGP]gnome-tour-42.0-1-x86_64.pkg.tar.zst.sig2022-05-04 13:11 310
[PGP]gnomon-1.5.0-3-any.pkg.tar.zst.sig2021-02-06 18:03 310
[PGP]gnubg-1.06.002-7-x86_64.pkg.tar.zst.sig2021-12-03 16:30 310
[PGP]gnuradio-3.10.2.0-8-x86_64.pkg.tar.zst.sig2022-09-18 01:54 310
[PGP]gnuradio-companion-3.10.2.0-8-x86_64.pkg.tar.zst.sig2022-09-18 01:54 310
[PGP]gnuradio-iqbal-0.38.2-7-x86_64.pkg.tar.zst.sig2022-05-04 20:16 310
[PGP]gnuradio-osmosdr-0.2.3-12-x86_64.pkg.tar.zst.sig2022-09-18 01:55 310
[PGP]gnustep-make-2.9.0-1-x86_64.pkg.tar.zst.sig2021-05-06 18:34 310
[PGP]go-bindata-4.0.0-2-x86_64.pkg.tar.zst.sig2022-04-27 18:37 310
[PGP]go-bindata-assetfs-1.0.1-3-x86_64.pkg.tar.zst.sig2022-04-27 16:49 310
[PGP]go-bindata-hashicorp-3.0.7+bf7910af-5-x86_64.pkg.tar.zst.sig2022-04-27 16:49 310
[PGP]gocr-0.52-2-x86_64.pkg.tar.zst.sig2020-07-07 22:05 310
[PGP]goimapnotify-2.3.7-3-x86_64.pkg.tar.zst.sig2022-04-27 18:16 310
[PGP]google-glog-0.6.0-1-x86_64.pkg.tar.zst.sig2022-04-27 22:26 310
[PGP]gopass-summon-provider-1.12.0-2-x86_64.pkg.tar.zst.sig2022-04-27 17:00 310
[PGP]gortr-0.14.7-7-x86_64.pkg.tar.zst.sig2022-05-01 14:18 310
[PGP]gottengeography-2.5-12-any.pkg.tar.zst.sig2021-12-11 07:31 310
[PGP]gox-1.0.1-6-x86_64.pkg.tar.zst.sig2022-04-27 18:38 310
[PGP]gpodder-3.11.0-1-any.pkg.tar.zst.sig2022-08-03 20:30 310
[PGP]gprolog-1.5.0-2-x86_64.pkg.tar.zst.sig2022-04-23 11:23 310
[PGP]gpsbabel-1.8.0-1-x86_64.pkg.tar.zst.sig2022-03-13 14:41 310
[PGP]gpsd-3.24-1-x86_64.pkg.tar.zst.sig2022-04-28 08:47 310
[PGP]gpsprune-22.1-1-any.pkg.tar.zst.sig2022-09-03 21:16 310
[PGP]gputils-1.5.2-1-x86_64.pkg.tar.zst.sig2022-02-12 00:48 310
[PGP]gpxsee-11.4-1-x86_64.pkg.tar.zst.sig2022-09-08 15:33 310
[PGP]gqrx-2.15.9-2-x86_64.pkg.tar.zst.sig2022-05-04 23:56 310
[PGP]grafana-9.1.6-1-x86_64.pkg.tar.zst.sig2022-09-21 19:21 310
[PGP]gramps-2:5.1.5-1-any.pkg.tar.zst.sig2022-02-13 00:22 310
[PGP]granite-6.2.0-2-x86_64.pkg.tar.zst.sig2022-03-06 16:57 310
[PGP]griffith-0.19-1-any.pkg.tar.zst.sig2021-12-23 13:10 310
[PGP]groovy-4.0.3-1-any.pkg.tar.zst.sig2022-06-06 19:00 310
[PGP]groovy-docs-3.0.9-1-any.pkg.tar.zst.sig2021-10-12 20:59 310
[PGP]grsync-1.3.0-1-x86_64.pkg.tar.zst.sig2020-12-26 00:00 310
[PGP]gsimplecal-2.4.1-1-x86_64.pkg.tar.zst.sig2022-08-23 09:33 310
[PGP]gtest-1.12.1-1-x86_64.pkg.tar.zst.sig2022-07-19 08:36 310
[PGP]gtkdatabox-1.0.0-1-x86_64.pkg.tar.zst.sig2021-07-28 17:08 310
[PGP]gtkspell3-3.0.10-2-x86_64.pkg.tar.xz.sig2019-12-10 10:06 310
[PGP]gtkwave-3.3.111-1-x86_64.pkg.tar.zst.sig2021-12-28 10:21 310
[PGP]guake-3.9.0-2-any.pkg.tar.zst.sig2022-06-16 08:57 310
[PGP]gufw-22.04-1-any.pkg.tar.zst.sig2022-03-30 20:45 310
[PGP]guitarix-0.44.1-3-x86_64.pkg.tar.zst.sig2022-09-18 04:28 310
[PGP]gummi-2:0.8.3-1-x86_64.pkg.tar.zst.sig2022-06-11 09:51 310
[PGP]guvcview-2.0.8-1-x86_64.pkg.tar.zst.sig2022-06-18 19:26 310
[PGP]guvcview-common-2.0.8-1-x86_64.pkg.tar.zst.sig2022-06-18 19:26 310
[PGP]guvcview-qt-2.0.8-1-x86_64.pkg.tar.zst.sig2022-06-18 19:26 310
[PGP]hackrf-2021.03.1-2-x86_64.pkg.tar.zst.sig2022-04-23 11:25 310
[PGP]hamlib-4.4-1-x86_64.pkg.tar.zst.sig2022-06-12 10:05 310
[PGP]handbrake-1.5.1-2-x86_64.pkg.tar.zst.sig2022-01-23 19:26 310
[PGP]handbrake-cli-1.5.1-2-x86_64.pkg.tar.zst.sig2022-01-23 19:26 310
[PGP]haruna-0.9.1-1-x86_64.pkg.tar.zst.sig2022-08-27 09:14 310
[PGP]hatari-2.4.0-1-x86_64.pkg.tar.zst.sig2022-08-11 16:05 310
[PGP]hcxkeys-6.2.1-1-x86_64.pkg.tar.zst.sig2022-05-04 11:44 310
[PGP]hdf5-1.12.2-1-x86_64.pkg.tar.zst.sig2022-05-15 22:20 310
[PGP]hdf5-openmpi-1.12.2-3-x86_64.pkg.tar.zst.sig2022-07-21 22:27 310
[PGP]hedgedoc-1.9.4-1-any.pkg.tar.zst.sig2022-07-11 09:47 310
[PGP]herbstluftwm-0.9.5-1-x86_64.pkg.tar.zst.sig2022-08-10 20:15 310
[PGP]hexchat-2.16.1-2-x86_64.pkg.tar.zst.sig2022-05-29 14:00 310
[PGP]hexer-hobu-1.4.0-8-x86_64.pkg.tar.zst.sig2022-07-22 15:32 310
[PGP]hey-0.1.4-5-x86_64.pkg.tar.zst.sig2022-04-27 15:24 310
[PGP]hiawatha-10.12-2-x86_64.pkg.tar.zst.sig2021-12-28 12:21 310
[PGP]higan-110-2-x86_64.pkg.tar.zst.sig2022-03-06 17:03 310
[PGP]hoel-1.4.25-1-x86_64.pkg.tar.zst.sig2022-06-18 20:56 310
[PGP]htmlmin-0.1.12-8-any.pkg.tar.zst.sig2021-12-02 16:20 310
[PGP]httrack-3.49.2-3-x86_64.pkg.tar.zst.sig2020-07-07 21:31 310
[PGP]hunspell-el-0.9-7-any.pkg.tar.zst.sig2021-10-01 21:10 310
[PGP]hunspell-fr-7.0-2-any.pkg.tar.zst.sig2021-10-01 21:31 310
[PGP]hunspell-hu-1.7-4-any.pkg.tar.zst.sig2022-04-21 21:01 310
[PGP]hunspell-it-2.4-10-any.pkg.tar.zst.sig2021-10-01 21:39 310
[PGP]hunspell-nl-2.20.19-2-any.pkg.tar.zst.sig2021-10-01 21:41 310
[PGP]hunspell-pl-20210731-2-any.pkg.tar.zst.sig2021-10-01 21:43 310
[PGP]hunspell-ro-3.3.10-6-any.pkg.tar.zst.sig2021-10-01 21:45 310
[PGP]hypercorn-0.13.2-2-any.pkg.tar.zst.sig2022-03-06 17:07 310
[PGP]hyphen-fr-3.0-5-any.pkg.tar.zst.sig2020-10-12 18:14 310
[PGP]hyphen-hu-20110815-2-any.pkg.tar.zst.sig2022-04-21 21:03 310
[PGP]hyphen-it-20071127-5-any.pkg.tar.zst.sig2021-05-08 11:41 310
[PGP]i3lock-2.14.1-1-x86_64.pkg.tar.zst.sig2022-06-22 16:10 310
[PGP]i3status-2.14-1-x86_64.pkg.tar.zst.sig2021-11-11 18:40 310
[PGP]iaito-5.7.0-2-x86_64.pkg.tar.zst.sig2022-08-27 19:24 310
[PGP]icoutils-0.32.3-3-x86_64.pkg.tar.zst.sig2020-07-07 22:19 310
[PGP]iec16022-0.3.1-1-x86_64.pkg.tar.zst.sig2022-09-03 21:21 310
[PGP]igraph-0.10.1-1-x86_64.pkg.tar.zst.sig2022-09-08 19:09 310
[PGP]igsc-0.6.0-1-x86_64.pkg.tar.zst.sig2022-05-12 14:26 310
[PGP]img2pdf-0.4.4-1-any.pkg.tar.zst.sig2022-04-11 20:49 310
[PGP]imwheel-1.0.0pre12-6-x86_64.pkg.tar.zst.sig2021-05-13 23:06 310
[PGP]index-fm-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]intel-compute-runtime-22.30.23789-1-x86_64.pkg.tar.zst.sig2022-08-02 20:17 310
[PGP]intel-gpu-tools-1.26-1-x86_64.pkg.tar.zst.sig2021-05-03 21:33 310
[PGP]intel-graphics-compiler-1:1.0.11485-8-x86_64.pkg.tar.zst.sig2022-07-21 13:46 310
[PGP]intel-opencl-clang-14.0.0.r3+g5dd5031-1-x86_64.pkg.tar.zst.sig2022-07-07 18:50 310
[PGP]iodine-0.7.0-5-x86_64.pkg.tar.zst.sig2021-05-13 00:34 310
[PGP]iotop-0.6-9-any.pkg.tar.zst.sig2021-12-03 01:08 310
[PGP]iptux-0.8.3-3-x86_64.pkg.tar.zst.sig2022-04-27 22:56 310
[PGP]isomd5sum-1.2.3-7-x86_64.pkg.tar.zst.sig2022-05-04 11:00 310
[PGP]ispc-1.18.0-3-x86_64.pkg.tar.zst.sig2022-06-27 12:42 310
[PGP]istio-1.13.0-2-x86_64.pkg.tar.zst.sig2022-04-27 17:13 310
[PGP]ivy-2.5.0-1-any.pkg.tar.xz.sig2019-12-10 17:30 310
[PGP]iwd-1.30-1-x86_64.pkg.tar.zst.sig2022-09-08 15:52 310
[PGP]jack_mixer-17-2-x86_64.pkg.tar.zst.sig2021-12-03 01:22 310
[PGP]jami-daemon-20220722-4-x86_64.pkg.tar.zst.sig2022-08-20 22:42 310
[PGP]jami-qt-20220726-1-x86_64.pkg.tar.zst.sig2022-07-28 12:52 310
[PGP]java-batik-1.14-1-any.pkg.tar.zst.sig2021-03-13 10:46 310
[PGP]java-commons-io-2.11.0-1-any.pkg.tar.zst.sig2022-01-04 12:59 310
[PGP]java-rxtx-2.2pre2-8-x86_64.pkg.tar.zst.sig2022-04-25 20:54 310
[PGP]java-xmlgraphics-commons-2.7-1-any.pkg.tar.zst.sig2022-02-15 09:59 310
[PGP]jbigkit-2.1-6-x86_64.pkg.tar.zst.sig2021-12-24 12:16 310
[PGP]jedi-language-server-0.37.0-1-any.pkg.tar.zst.sig2022-08-31 19:21 310
[PGP]jhead-3.06.0.1-1-x86_64.pkg.tar.zst.sig2021-09-30 23:05 310
[PGP]jlatexmath-1.0.7-2-any.pkg.tar.zst.sig2022-04-23 15:33 310
[PGP]jmol-14.32.75-1-any.pkg.tar.zst.sig2022-09-20 16:18 310
[PGP]jpegoptim-1.5.0-1-x86_64.pkg.tar.zst.sig2022-09-18 16:12 310
[PGP]jsmol-14.32.75-1-any.pkg.tar.zst.sig2022-09-20 16:18 310
[PGP]julia-2:1.8.1-1-x86_64.pkg.tar.zst.sig2022-09-06 22:29 310
[PGP]jupyter-jsmol-2022.1.0-1-any.pkg.tar.zst.sig2022-01-12 19:32 310
[PGP]jupyter-nbclassic-0.4.3-1-any.pkg.tar.zst.sig2022-07-12 15:50 310
[PGP]jupyter-nbclient-0.6.8-1-any.pkg.tar.zst.sig2022-09-09 16:29 310
[PGP]jupyter-nbconvert-7.0.0-2-any.pkg.tar.zst.sig2022-08-27 11:28 310
[PGP]jupyter-nbformat-5.6.1-1-any.pkg.tar.zst.sig2022-09-26 21:45 310
[PGP]jupyter-notebook-6.4.12-1-any.pkg.tar.zst.sig2022-06-07 19:17 310
[PGP]jupyter-notebook-shim-0.1.0-1-any.pkg.tar.zst.sig2022-03-03 08:48 310
[PGP]jupyter-retrolab-0.3.21-1-any.pkg.tar.zst.sig2022-05-04 10:18 310
[PGP]jupyter-server-1.19.0-1-any.pkg.tar.zst.sig2022-09-26 21:48 310
[PGP]jupyter-server-mathjax-0.2.6-1-any.pkg.tar.zst.sig2022-07-14 22:25 310
[PGP]jupyter-widgetsnbextension-1:4.0.3-1-any.pkg.tar.zst.sig2022-09-03 00:32 310
[PGP]jupyterlab-3.4.7-1-any.pkg.tar.zst.sig2022-09-13 22:56 310
[PGP]jupyterlab-widgets-3.0.3-1-any.pkg.tar.zst.sig2022-09-03 00:35 310
[PGP]jupyterlab_pygments-0.2.2-1-any.pkg.tar.zst.sig2022-05-04 11:32 310
[PGP]jxrlib-0.2.4-1-x86_64.pkg.tar.zst.sig2022-02-07 18:10 310
[PGP]kaffeine-2.0.18-3-x86_64.pkg.tar.zst.sig2022-01-06 12:36 310
[PGP]kasync-0.3.0-3-x86_64.pkg.tar.zst.sig2021-07-19 08:57 310
[PGP]kbibtex-1:0.9.2-7-x86_64.pkg.tar.zst.sig2022-04-15 00:12 310
[PGP]kcm-wacomtablet-1:3.2.0-5-x86_64.pkg.tar.zst.sig2022-01-17 20:33 310
[PGP]kdav2-0.4.0-1-x86_64.pkg.tar.zst.sig2021-07-19 08:50 310
[PGP]kdbg-3.0.1-1-x86_64.pkg.tar.zst.sig2020-01-01 22:45 310
[PGP]kde-development-environment-meta-20220422-2-any.pkg.tar.zst.sig2022-04-22 18:42 310
[PGP]kdesrc-build-22.07-1-any.pkg.tar.zst.sig2022-07-18 09:34 310
[PGP]keepassxc-2.7.1-1-x86_64.pkg.tar.zst.sig2022-04-06 19:57 310
[PGP]kernel-headers-musl-4.19.88-2-x86_64.pkg.tar.zst.sig2021-11-10 19:56 310
[PGP]keycloak-metrics-spi-2.5.3-2-any.pkg.tar.zst.sig2022-03-24 17:44 310
[PGP]keynav-0.20180821.0-2-x86_64.pkg.tar.zst.sig2022-04-23 11:29 310
[PGP]keystone-0.9.2-3-x86_64.pkg.tar.zst.sig2022-05-04 11:15 310
[PGP]kimap2-0.4.0-1-x86_64.pkg.tar.zst.sig2021-07-19 08:46 310
[PGP]kjots-5.1.0-3-x86_64.pkg.tar.zst.sig2022-04-22 16:36 310
[PGP]klavaro-3.13-2-x86_64.pkg.tar.zst.sig2021-10-18 12:25 310
[PGP]kmymoney-5.1.3-2-x86_64.pkg.tar.zst.sig2022-09-08 14:44 310
[PGP]knot-3.1.8-1-x86_64.pkg.tar.zst.sig2022-04-30 15:00 310
[PGP]kompose-1.26.0-2-x86_64.pkg.tar.zst.sig2022-04-27 17:24 310
[PGP]kpeoplevcard-0.1-1-x86_64.pkg.tar.xz.sig2019-12-09 16:22 310
[PGP]kphotoalbum-5.9.1-1-x86_64.pkg.tar.zst.sig2022-09-08 10:56 310
[PGP]kquickimageeditor-0.2.0-1-x86_64.pkg.tar.zst.sig2021-10-02 10:46 310
[PGP]krename-5.0.2-1-x86_64.pkg.tar.zst.sig2022-09-01 08:58 310
[PGP]kresus-0.18.1-1-x86_64.pkg.tar.zst.sig2022-06-27 15:26 310
[PGP]krita-plugin-gmic-3.1.6.1-1-x86_64.pkg.tar.zst.sig2022-09-16 21:52 310
[PGP]kshutdown-5.2-1-x86_64.pkg.tar.zst.sig2020-01-01 22:30 310
[PGP]ksnip-1.10.0-1-x86_64.pkg.tar.zst.sig2022-05-23 16:51 310
[PGP]kstars-1:3.6.0-1-x86_64.pkg.tar.zst.sig2022-07-29 16:05 310
[PGP]ktikz-0.13.2-1-x86_64.pkg.tar.zst.sig2021-09-30 22:37 310
[PGP]ktimetracker-5.0.1-1-x86_64.pkg.tar.xz.sig2019-12-21 11:34 310
[PGP]kube-0.9.0-2-x86_64.pkg.tar.zst.sig2021-07-19 10:34 310
[PGP]kubectl-ingress-nginx-1.0.4-2-x86_64.pkg.tar.zst.sig2022-04-27 17:29 310
[PGP]kupfer-321-2-any.pkg.tar.zst.sig2021-12-03 00:42 310
[PGP]kvantum-1.0.5-1-x86_64.pkg.tar.zst.sig2022-09-20 22:15 310
[PGP]kvantum-theme-materia-20220823-1-any.pkg.tar.zst.sig2022-08-29 20:15 310
[PGP]kvirc-5.0.0-6-x86_64.pkg.tar.zst.sig2022-05-29 13:54 310
[PGP]labplot-2.9.0-2-x86_64.pkg.tar.zst.sig2022-05-16 08:50 310
[PGP]languagetool-5.8-1-any.pkg.tar.zst.sig2022-07-18 23:27 310
[PGP]laszip2-2.2.0-1-x86_64.pkg.tar.zst.sig2020-10-13 18:44 310
[PGP]latte-dock-0.10.8-1-x86_64.pkg.tar.zst.sig2022-01-25 11:47 310
[PGP]latte-integrale-1.7.6-2-x86_64.pkg.tar.zst.sig2021-06-21 09:43 310
[PGP]lcalc-2.0.5-1-x86_64.pkg.tar.zst.sig2021-12-19 19:04 310
[PGP]ld-lsb-3-8-x86_64.pkg.tar.zst.sig2021-05-13 00:58 310
[PGP]leatherman-1.12.8-3-x86_64.pkg.tar.zst.sig2022-09-18 00:40 310
[PGP]level-zero-headers-1.8.1-1-x86_64.pkg.tar.zst.sig2022-05-27 11:24 310
[PGP]level-zero-loader-1.8.1-1-x86_64.pkg.tar.zst.sig2022-05-27 11:24 310
[PGP]leveldb-1.23-3-x86_64.pkg.tar.zst.sig2021-04-28 18:03 310
[PGP]lhasa-0.3.1-3-x86_64.pkg.tar.zst.sig2020-07-07 21:22 310
[PGP]libaec-1.0.6-1-x86_64.pkg.tar.zst.sig2021-10-16 18:48 310
[PGP]libalkimia-8.1.1-1-x86_64.pkg.tar.zst.sig2022-05-04 10:22 310
[PGP]libantlr3c-3.5.3-1-x86_64.pkg.tar.zst.sig2022-06-11 09:48 310
[PGP]libavif-0.10.1-2-x86_64.pkg.tar.zst.sig2022-06-12 11:01 310
[PGP]libayatana-appindicator-0.5.91-2-x86_64.pkg.tar.zst.sig2022-05-05 20:52 310
[PGP]libayatana-indicator-0.9.2-1-x86_64.pkg.tar.zst.sig2022-09-15 20:42 310
[PGP]libblastrampoline-5.1.1-1-x86_64.pkg.tar.zst.sig2022-06-16 21:35 310
[PGP]libbraiding-1.1-1-x86_64.pkg.tar.zst.sig2020-09-12 22:14 310
[PGP]libc++-14.0.6-1-x86_64.pkg.tar.zst.sig2022-06-26 00:19 310
[PGP]libc++abi-14.0.6-1-x86_64.pkg.tar.zst.sig2022-06-26 00:19 310
[PGP]libc++experimental-14.0.6-1-x86_64.pkg.tar.zst.sig2022-06-26 00:19 310
[PGP]libcgif-0.3.0-1-x86_64.pkg.tar.zst.sig2022-04-27 22:19 310
[PGP]libcomps-0.1.19-1-x86_64.pkg.tar.zst.sig2022-09-18 16:35 310
[PGP]libcrossguid-1:0.2.2-3-x86_64.pkg.tar.zst.sig2022-05-04 11:29 310
[PGP]libdbusmenu-glib-16.04.0-5-x86_64.pkg.tar.zst.sig2022-04-25 20:59 310
[PGP]libdbusmenu-gtk2-16.04.0-5-x86_64.pkg.tar.zst.sig2022-04-25 20:59 310
[PGP]libdbusmenu-gtk3-16.04.0-5-x86_64.pkg.tar.zst.sig2022-04-25 20:59 310
[PGP]libdiscid-0.6.2-3-x86_64.pkg.tar.zst.sig2022-03-30 09:13 310
[PGP]libdnf-0.69.0-1-x86_64.pkg.tar.zst.sig2022-09-12 14:14 310
[PGP]libdvdcss-1.4.3-1-x86_64.pkg.tar.zst.sig2022-03-30 09:14 310
[PGP]libesmtp-1.1.0-1-x86_64.pkg.tar.zst.sig2021-06-19 09:04 310
[PGP]libev-4.33-1-x86_64.pkg.tar.zst.sig2020-03-22 10:45 310
[PGP]libfabric-1.15.1-1-x86_64.pkg.tar.zst.sig2022-05-14 20:57 310
[PGP]libfaketime-0.9.10-1-x86_64.pkg.tar.zst.sig2022-03-10 19:40 310
[PGP]libfilteraudio-0.0.1-5-x86_64.pkg.tar.zst.sig2020-07-07 21:52 310
[PGP]libfm-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:17 310
[PGP]libfm-extra-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:17 310
[PGP]libfm-gtk2-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:17 310
[PGP]libfm-gtk3-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:17 310
[PGP]libfm-qt-1.1.0-4-x86_64.pkg.tar.zst.sig2022-09-08 14:44 310
[PGP]libftdi-compat-0.20-8-x86_64.pkg.tar.zst.sig2020-07-07 22:04 310
[PGP]libgcrypt15-1.5.6-6-x86_64.pkg.tar.zst.sig2022-03-06 16:39 310
[PGP]libgeotiff-1.7.1-1-x86_64.pkg.tar.zst.sig2022-06-27 23:32 310
[PGP]libgexiv2-0.14.0-3-x86_64.pkg.tar.zst.sig2021-12-02 23:25 310
[PGP]libgsystem-2015.2+4+gd606bec-3-x86_64.pkg.tar.zst.sig2021-05-18 16:44 310
[PGP]libhx-4.6-1-x86_64.pkg.tar.zst.sig2022-07-31 22:38 310
[PGP]libidn11-1.33-2-x86_64.pkg.tar.zst.sig2020-07-07 22:02 310
[PGP]libindi-1.9.7-1-x86_64.pkg.tar.zst.sig2022-07-29 16:14 310
[PGP]libindicator-gtk2-12.10.1-10-x86_64.pkg.tar.zst.sig2022-04-25 21:01 310
[PGP]libindicator-gtk3-12.10.1-10-x86_64.pkg.tar.zst.sig2022-04-25 21:01 310
[PGP]libinsane-1.0.9-1-x86_64.pkg.tar.zst.sig2021-03-14 09:48 310
[PGP]libjcat-0.1.11-1-x86_64.pkg.tar.zst.sig2022-04-22 21:25 310
[PGP]libkkc-data-0.2.7-3-x86_64.pkg.tar.zst.sig2021-05-13 18:42 310
[PGP]libldm-0.2.5-2-x86_64.pkg.tar.zst.sig2022-03-06 16:29 310
[PGP]libmaa-1.4.7-2-x86_64.pkg.tar.zst.sig2022-03-11 21:27 310
[PGP]libmatekbd-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:06 310
[PGP]libmatemixer-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:10 310
[PGP]libmateweather-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:12 310
[PGP]libmatio-1.5.23-2-x86_64.pkg.tar.zst.sig2022-05-16 08:48 310
[PGP]libmemcached-awesome-1.1.2-1-x86_64.pkg.tar.zst.sig2022-08-11 11:57 310
[PGP]libmodulemd-2.14.0-1-x86_64.pkg.tar.zst.sig2022-02-04 19:47 310
[PGP]libnest2d-0.4-2-x86_64.pkg.tar.zst.sig2021-12-24 12:05 310
[PGP]libnfc-1.8.0-2-x86_64.pkg.tar.zst.sig2022-03-18 16:21 310
[PGP]libnih-1.0.3-4-x86_64.pkg.tar.zst.sig2020-07-07 23:29 310
[PGP]libopenshot-0.2.7-12-x86_64.pkg.tar.zst.sig2022-06-11 17:08 310
[PGP]libopensmtpd-0.7-1-x86_64.pkg.tar.zst.sig2021-10-17 21:10 310
[PGP]libopusenc-0.2.1-3-x86_64.pkg.tar.zst.sig2022-04-29 08:50 310
[PGP]liborigin-3.0.1-1-x86_64.pkg.tar.zst.sig2022-05-02 20:29 310
[PGP]libosinfo-1.10.0-1-x86_64.pkg.tar.zst.sig2022-03-12 23:25 310
[PGP]libpano13-2.9.21-1-x86_64.pkg.tar.zst.sig2022-01-22 23:22 310
[PGP]libpgm-5.3.128-2-x86_64.pkg.tar.zst.sig2022-04-23 11:34 310
[PGP]libptytty-2.0-4-x86_64.pkg.tar.zst.sig2022-07-18 22:16 310
[PGP]libqtshadowsocks-2.1.0-14-x86_64.pkg.tar.zst.sig2022-01-20 09:45 310
[PGP]libqtxdg-3.9.1-4-x86_64.pkg.tar.zst.sig2022-09-08 14:45 310
[PGP]libquotient-0.6.11-1-x86_64.pkg.tar.zst.sig2021-10-06 20:53 310
[PGP]libreoffice-extension-texmaths-0.49-1-any.pkg.tar.zst.sig2021-03-14 20:36 310
[PGP]librepo-1.14.5-1-x86_64.pkg.tar.zst.sig2022-09-12 16:29 310
[PGP]libressl-3.5.3-1-x86_64.pkg.tar.zst.sig2022-05-19 13:50 310
[PGP]libretls-3.5.2-1-x86_64.pkg.tar.zst.sig2022-05-19 13:50 310
[PGP]libretro-blastem-2052-2-x86_64.pkg.tar.zst.sig2022-03-06 16:42 310
[PGP]libretro-bsnes2014-1:577-2-x86_64.pkg.tar.zst.sig2022-03-06 16:32 310
[PGP]libretro-duckstation-2105-2-x86_64.pkg.tar.zst.sig2022-03-12 20:23 310
[PGP]libretro-kronos-7016-2-x86_64.pkg.tar.zst.sig2022-03-06 17:13 310
[PGP]libretro-mesen-2903-2-x86_64.pkg.tar.zst.sig2022-03-06 16:43 310
[PGP]libretro-mesen-s-916-3-x86_64.pkg.tar.zst.sig2022-03-06 17:05 310
[PGP]libretro-retrodream-1104-2-x86_64.pkg.tar.zst.sig2022-03-12 13:57 310
[PGP]libretro-sameboy-1720-2-x86_64.pkg.tar.zst.sig2022-03-06 16:30 310
[PGP]librime-1:1.7.3-13-x86_64.pkg.tar.zst.sig2022-09-18 04:55 310
[PGP]librsync-1:2.3.2-1-x86_64.pkg.tar.zst.sig2021-04-10 10:41 310
[PGP]librttopo-1.1.0-5-x86_64.pkg.tar.zst.sig2022-06-27 18:12 310
[PGP]libsecp256k1-20220630+1625+g43756da-1-x86_64.pkg.tar.zst.sig2022-06-30 13:48 310
[PGP]libsemigroups-2.2.3-1-x86_64.pkg.tar.zst.sig2022-09-22 17:13 310
[PGP]libsignal-protocol-c-2.3.3-1-x86_64.pkg.tar.zst.sig2020-04-08 20:03 310
[PGP]libsigrok-0.5.2-10-x86_64.pkg.tar.zst.sig2021-12-10 15:56 310
[PGP]libsigrokdecode-0.5.3-5-x86_64.pkg.tar.zst.sig2021-12-10 17:28 310
[PGP]libsolv-0.7.22-2-x86_64.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]libspatialite-5.0.1-3-x86_64.pkg.tar.zst.sig2022-06-27 18:17 310
[PGP]libu2f-server-1.1.0-4-x86_64.pkg.tar.zst.sig2020-04-25 17:02 310
[PGP]libuhd-firmware-4.2.0.0-1-any.pkg.tar.zst.sig2022-05-05 08:59 310
[PGP]libva-utils-2.15.0-1-x86_64.pkg.tar.zst.sig2022-07-01 10:06 310
[PGP]libvips-8.13.1-2-x86_64.pkg.tar.zst.sig2022-09-21 22:39 310
[PGP]libvolk-2:2.5.0-4-x86_64.pkg.tar.zst.sig2022-04-28 22:51 310
[PGP]libwhereami-0.5.0-14-x86_64.pkg.tar.zst.sig2022-09-18 00:48 310
[PGP]libwhich-1.1.0-1-x86_64.pkg.tar.zst.sig2021-12-02 18:26 310
[PGP]libwnck-2.31.0-3-x86_64.pkg.tar.xz.sig2019-12-10 09:39 310
[PGP]libxdg-basedir-1.2.3-1-x86_64.pkg.tar.zst.sig2021-04-22 22:40 310
[PGP]libxmlb-0.3.9-1-x86_64.pkg.tar.zst.sig2022-05-26 11:45 310
[PGP]libxmlbird-1.2.12-2-x86_64.pkg.tar.zst.sig2022-04-25 21:03 310
[PGP]libxpresent-1.0.0-2-x86_64.pkg.tar.xz.sig2019-12-19 19:48 310
[PGP]libyuv-r2322+3aebf69d-1-x86_64.pkg.tar.zst.sig2022-04-07 22:43 310
[PGP]limesuite-20.10.0-4-x86_64.pkg.tar.zst.sig2022-07-08 08:08 310
[PGP]linbox-1.7.0-1-x86_64.pkg.tar.zst.sig2021-12-14 18:27 310
[PGP]linenoise-ng-1.0.1-2-x86_64.pkg.tar.zst.sig2022-04-28 22:44 310
[PGP]linssid-3.6-10-x86_64.pkg.tar.zst.sig2021-10-10 18:42 310
[PGP]liquidshell-1.8.1-1-x86_64.pkg.tar.zst.sig2022-07-27 15:48 310
[PGP]livewallpaper-0.5.0.333-3-x86_64.pkg.tar.zst.sig2020-04-25 18:51 310
[PGP]lmms-1.2.2-11-x86_64.pkg.tar.zst.sig2022-09-08 14:45 310
[PGP]lockdev-1.0.3_1.6-6-x86_64.pkg.tar.zst.sig2020-05-07 15:26 310
[PGP]lrcalc-2.1-3-x86_64.pkg.tar.zst.sig2021-12-01 22:38 310
[PGP]lrs-072-1-x86_64.pkg.tar.zst.sig2022-03-31 08:46 310
[PGP]ls++-1:0.36-7-any.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]lsdvd-0.17-4-x86_64.pkg.tar.zst.sig2020-04-05 13:16 310
[PGP]lxhotkey-0.1.1-1-x86_64.pkg.tar.zst.sig2021-02-20 14:01 310
[PGP]lxhotkey-gtk3-0.1.1-1-x86_64.pkg.tar.zst.sig2021-02-20 14:01 310
[PGP]lxpanel-0.10.1-1-x86_64.pkg.tar.zst.sig2021-02-13 22:29 310
[PGP]lxpanel-gtk3-0.10.1-1-x86_64.pkg.tar.zst.sig2021-02-20 13:50 310
[PGP]lxsession-1:0.5.5-1-x86_64.pkg.tar.zst.sig2020-03-08 01:11 310
[PGP]lxsession-gtk3-1:0.5.5-1-x86_64.pkg.tar.zst.sig2020-03-08 01:11 310
[PGP]lxtask-0.1.10-2-x86_64.pkg.tar.zst.sig2022-04-25 21:04 310
[PGP]lxtask-gtk3-0.1.10-2-x86_64.pkg.tar.zst.sig2022-04-25 21:04 310
[PGP]lxterminal-0.4.0-1-x86_64.pkg.tar.zst.sig2021-02-20 14:06 310
[PGP]lzip-1.23-2-x86_64.pkg.tar.zst.sig2022-04-23 15:36 310
[PGP]m4ri-20200125-2-x86_64.pkg.tar.zst.sig2021-11-15 23:30 310
[PGP]m4rie-20200125-2-x86_64.pkg.tar.zst.sig2021-11-15 23:46 310
[PGP]magic-wormhole-0.12.0-7-any.pkg.tar.zst.sig2021-12-03 00:30 310
[PGP]magnum-2020.06-3-x86_64.pkg.tar.zst.sig2022-04-28 22:16 310
[PGP]magnum-plugins-2020.06-3-x86_64.pkg.tar.zst.sig2022-02-06 22:15 310
[PGP]mailman3-hyperkitty-1.2.0-2-any.pkg.tar.zst.sig2021-12-03 02:12 310
[PGP]maliit-framework-2.3.0-1-x86_64.pkg.tar.zst.sig2022-07-06 18:32 310
[PGP]maliit-keyboard-2.3.1-1-x86_64.pkg.tar.zst.sig2022-07-22 08:14 310
[PGP]mandoc-1.14.6-1-x86_64.pkg.tar.zst.sig2021-09-30 20:59 310
[PGP]mandown-0.1.2-1-x86_64.pkg.tar.zst.sig2021-01-08 00:20 310
[PGP]manuskript-0.14.0-1-any.pkg.tar.zst.sig2022-06-15 23:11 310
[PGP]marco-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:14 310
[PGP]marker-2020.04.04.2-5-x86_64.pkg.tar.zst.sig2022-04-25 21:37 310
[PGP]massif-visualizer-0.7.0-3-x86_64.pkg.tar.zst.sig2020-05-09 12:37 310
[PGP]mate-applet-dock-21.10.0-2-any.pkg.tar.zst.sig2021-12-03 02:18 310
[PGP]mate-backgrounds-1.26.0-1-any.pkg.tar.zst.sig2021-08-08 20:33 310
[PGP]mate-calc-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:30 310
[PGP]mate-common-1.26.0-1-any.pkg.tar.zst.sig2021-08-08 19:47 310
[PGP]mate-desktop-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:18 310
[PGP]mate-icon-theme-1.26.0-1-any.pkg.tar.zst.sig2021-08-08 20:26 310
[PGP]mate-media-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:23 310
[PGP]mate-menus-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:19 310
[PGP]mate-netbook-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 22:29 310
[PGP]mate-notification-daemon-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 21:41 310
[PGP]mate-panel-1.26.2-1-x86_64.pkg.tar.zst.sig2022-02-01 18:40 310
[PGP]mate-polkit-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:20 310
[PGP]mate-power-manager-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 22:25 310
[PGP]mate-screensaver-1.26.1-1-x86_64.pkg.tar.zst.sig2021-11-16 08:50 310
[PGP]mate-sensors-applet-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 21:27 310
[PGP]mate-session-manager-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:22 310
[PGP]mate-settings-daemon-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:35 310
[PGP]mate-system-monitor-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 22:27 310
[PGP]mate-terminal-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 20:38 310
[PGP]mate-themes-3.22.23-1-any.pkg.tar.zst.sig2021-09-11 10:58 310
[PGP]mate-user-guide-1.26.0-1-any.pkg.tar.zst.sig2021-08-08 21:14 310
[PGP]mate-user-share-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 21:16 310
[PGP]mate-utils-1.26.0-1-x86_64.pkg.tar.zst.sig2021-08-08 21:25 310
[PGP]materia-gtk-theme-20210322-2-any.pkg.tar.zst.sig2021-04-10 18:30 310
[PGP]materia-kde-20220823-1-any.pkg.tar.zst.sig2022-08-29 20:15 310
[PGP]mathjax-3.2.2-1-any.pkg.tar.zst.sig2022-06-08 21:53 310
[PGP]mathjax2-2.7.9-1-any.pkg.tar.zst.sig2020-08-27 23:01 310
[PGP]mathomatic-16.0.5-8-x86_64.pkg.tar.zst.sig2022-04-23 11:39 310
[PGP]mattermost-desktop-5.1.1-3-x86_64.pkg.tar.zst.sig2022-08-04 12:38 310
[PGP]maui-clip-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:13 310
[PGP]maui-nota-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:12 310
[PGP]maui-pix-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:12 310
[PGP]maui-shelf-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:13 310
[PGP]maui-station-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:13 310
[PGP]mauikit-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]mauikit-accounts-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]mauikit-filebrowsing-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]mauikit-imagetools-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]mauikit-texteditor-2.2.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:11 310
[PGP]mauiman-1.0.0-1-x86_64.pkg.tar.zst.sig2022-08-30 18:00 310
[PGP]mayavi-4.8.0-1-x86_64.pkg.tar.zst.sig2022-07-26 22:23 310
[PGP]mbedtls-2.28.0-1-x86_64.pkg.tar.zst.sig2021-12-28 11:20 310
[PGP]mcabber-1.1.2-2-x86_64.pkg.tar.zst.sig2022-03-11 21:39 310
[PGP]mcqd-1.0.0-3-x86_64.pkg.tar.zst.sig2021-11-16 18:48 310
[PGP]mdf2iso-0.3.1-4-x86_64.pkg.tar.zst.sig2021-02-18 14:49 310
[PGP]mediaelch-2.8.16-3-x86_64.pkg.tar.zst.sig2022-05-23 17:59 310
[PGP]mediainfo-22.06-2-x86_64.pkg.tar.zst.sig2022-07-08 08:11 310
[PGP]mediainfo-gui-22.06-2-x86_64.pkg.tar.zst.sig2022-07-08 08:11 310
[PGP]mediastreamer-5.1.61-1-x86_64.pkg.tar.zst.sig2022-09-16 16:33 310
[PGP]meek-0.37.0-2-x86_64.pkg.tar.zst.sig2022-05-01 18:31 310
[PGP]megaglest-3.13.0-8-x86_64.pkg.tar.zst.sig2022-07-08 08:35 310
[PGP]meilisearch-0.28.1-1-x86_64.pkg.tar.zst.sig2022-08-09 20:49 310
[PGP]memconf-3.15-2-any.pkg.tar.zst.sig2022-04-23 11:40 310
[PGP]menumaker-0.99.14-2-any.pkg.tar.zst.sig2021-12-14 20:24 310
[PGP]merkaartor-0.19.0-3-x86_64.pkg.tar.zst.sig2022-07-22 15:37 310
[PGP]meshbird-2.3-6-x86_64.pkg.tar.zst.sig2022-05-01 18:32 310
[PGP]meson-python-0.8.1-1-any.pkg.tar.zst.sig2022-08-04 09:55 310
[PGP]metacity-3.44.0-1-x86_64.pkg.tar.zst.sig2022-05-04 16:09 310
[PGP]mfoc-0.10.7+38+gba072f1-1-x86_64.pkg.tar.zst.sig2020-10-13 01:21 310
[PGP]mg-20210314-2-x86_64.pkg.tar.zst.sig2022-04-23 11:41 310
[PGP]mgard-1.0.0-1-x86_64.pkg.tar.zst.sig2022-04-02 22:11 310
[PGP]mimetic-0.9.8-2-x86_64.pkg.tar.zst.sig2020-05-09 12:43 310
[PGP]minder-1.14.0-1-x86_64.pkg.tar.zst.sig2022-02-12 22:36 310
[PGP]minetest-5.6.0-1-x86_64.pkg.tar.zst.sig2022-08-11 09:41 310
[PGP]minetest-common-5.6.0-1-x86_64.pkg.tar.zst.sig2022-08-11 09:41 310
[PGP]minetest-server-5.6.0-1-x86_64.pkg.tar.zst.sig2022-08-11 09:41 310
[PGP]miniupnpc-2.2.3-1-x86_64.pkg.tar.zst.sig2022-03-30 21:01 310
[PGP]minizip-ng-3.0.6-3-x86_64.pkg.tar.zst.sig2022-04-29 19:12 310
[PGP]mk-configure-0.37.0-3-any.pkg.tar.zst.sig2022-03-11 21:26 310
[PGP]mktorrent-1.1-5-x86_64.pkg.tar.zst.sig2022-07-21 19:47 310
[PGP]mlt6-6.26.1-10-x86_64.pkg.tar.zst.sig2022-06-06 08:17 310
[PGP]mmtf-cpp-1.0.0-4-any.pkg.tar.zst.sig2021-08-31 20:34 310
[PGP]modem-manager-gui-0.0.20-2-x86_64.pkg.tar.zst.sig2021-07-18 22:11 310
[PGP]modest-0.0.6.d021b90-3-x86_64.pkg.tar.zst.sig2022-04-28 20:46 310
[PGP]monkeytype-20.5.0-3-any.pkg.tar.zst.sig2021-12-03 00:49 310
[PGP]moserial-3.0.21-1-x86_64.pkg.tar.zst.sig2021-12-23 13:57 310
[PGP]mosquitto-2.0.15-1-x86_64.pkg.tar.zst.sig2022-08-25 21:16 310
[PGP]motion-4.4.0-2-x86_64.pkg.tar.zst.sig2022-01-29 11:04 310
[PGP]mozo-1.26.1-2-any.pkg.tar.zst.sig2021-12-03 02:13 310
[PGP]mpfi-1.5.4-4-x86_64.pkg.tar.zst.sig2021-10-06 09:13 310
[PGP]mpop-1.4.17-1-x86_64.pkg.tar.zst.sig2022-09-03 20:54 310
[PGP]mpv-1:0.34.1-5-x86_64.pkg.tar.zst.sig2022-07-26 23:18 310
[PGP]mtd-utils-2.1.4-1-x86_64.pkg.tar.zst.sig2022-03-30 20:42 310
[PGP]muffin-5.4.7-1-x86_64.pkg.tar.zst.sig2022-09-10 16:16 310
[PGP]multitail-6.5.1-1-x86_64.pkg.tar.zst.sig2022-04-23 11:46 310
[PGP]mutter6-3.36.9-2-x86_64.pkg.tar.zst.sig2022-01-17 20:43 310
[PGP]mythes-fr-2.3-4-any.pkg.tar.zst.sig2020-10-12 18:14 310
[PGP]mythes-hu-1:1.0-2-any.pkg.tar.zst.sig2022-04-25 21:38 310
[PGP]mythes-nl-20140818-3-any.pkg.tar.zst.sig2020-06-30 18:32 310
[PGP]mythes-pl-1:0.8.67-2-any.pkg.tar.zst.sig2021-05-07 20:13 310
[PGP]mythes-ro-3.3-7-any.pkg.tar.zst.sig2021-05-08 11:42 310
[PGP]namazu-2.0.21-4-x86_64.pkg.tar.zst.sig2020-07-07 22:32 310
[PGP]nauty-27r4-1-x86_64.pkg.tar.zst.sig2022-07-01 19:31 310
[PGP]navit-0.5.6-4-x86_64.pkg.tar.zst.sig2022-04-28 20:36 310
[PGP]ncompress-5.0-2-x86_64.pkg.tar.zst.sig2021-11-10 20:07 310
[PGP]nebula-1.6.0-1-x86_64.pkg.tar.zst.sig2022-08-02 00:16 310
[PGP]neko-2.3.0-6-x86_64.pkg.tar.zst.sig2021-12-28 12:27 310
[PGP]nemo-5.4.3-1-x86_64.pkg.tar.zst.sig2022-09-10 16:18 310
[PGP]nemo-audio-tab-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-emblems-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-fileroller-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-image-converter-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-pastebin-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-preview-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-python-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-seahorse-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-share-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]nemo-terminal-5.4.1-1-x86_64.pkg.tar.zst.sig2022-07-18 23:18 310
[PGP]neochat-22.06-1-x86_64.pkg.tar.zst.sig2022-06-24 18:36 310
[PGP]netcdf-4.9.0-3-x86_64.pkg.tar.zst.sig2022-06-29 18:55 310
[PGP]netcdf-cxx-4.3.1-3-x86_64.pkg.tar.zst.sig2021-10-16 17:56 310
[PGP]netcdf-fortran-4.6.0-1-x86_64.pkg.tar.zst.sig2022-08-03 02:28 310
[PGP]netcdf-fortran-openmpi-4.6.0-1-x86_64.pkg.tar.zst.sig2022-08-03 02:40 310
[PGP]netcdf-openmpi-4.9.0-3-x86_64.pkg.tar.zst.sig2022-06-29 21:51 310
[PGP]nethogs-0.8.7-1-x86_64.pkg.tar.zst.sig2022-04-17 19:32 310
[PGP]netperf-2.7.0-6-x86_64.pkg.tar.zst.sig2020-07-07 23:22 310
[PGP]netsniff-ng-0.6.8-4-x86_64.pkg.tar.zst.sig2022-03-11 21:49 310
[PGP]netwatch-1.3.1_2-3-x86_64.pkg.tar.zst.sig2022-03-11 22:02 310
[PGP]newsflash-1.5.1-1-x86_64.pkg.tar.zst.sig2022-03-12 22:52 310
[PGP]nextcloud-client-2:3.6.0-2-x86_64.pkg.tar.zst.sig2022-09-13 08:33 310
[PGP]nextcloud-client-cloudproviders-2:3.6.0-2-x86_64.pkg.tar.zst.sig2022-09-13 08:33 310
[PGP]ngircd-26.1-2-x86_64.pkg.tar.zst.sig2022-04-23 11:47 310
[PGP]nickle-2.86-1-x86_64.pkg.tar.zst.sig2021-11-03 22:21 310
[PGP]nicotine+-3.2.5-1-any.pkg.tar.zst.sig2022-08-31 08:57 310
[PGP]nitrocli-0.4.1-2-x86_64.pkg.tar.zst.sig2022-03-06 16:34 310
[PGP]nload-0.7.4-7-x86_64.pkg.tar.zst.sig2021-05-11 22:18 310
[PGP]nlopt-2.7.1-3-x86_64.pkg.tar.zst.sig2022-07-30 23:36 310
[PGP]nltk-data-3.6.4-2-any.pkg.tar.zst.sig2022-04-25 23:34 310
[PGP]nodejs-emojione-4.5.0-3-any.pkg.tar.zst.sig2021-02-06 18:07 310
[PGP]nodejs-lts-fermium-14.20.0-1-x86_64.pkg.tar.zst.sig2022-07-08 15:10 310
[PGP]nodejs-lts-gallium-16.16.0-1-x86_64.pkg.tar.zst.sig2022-07-08 15:13 310
[PGP]noise-suppression-for-voice-1.03-1-x86_64.pkg.tar.zst.sig2022-07-28 18:46 310
[PGP]nomacs-1:3.17.2206-8-x86_64.pkg.tar.zst.sig2022-06-06 08:20 310
[PGP]normaliz-3.9.4-1-x86_64.pkg.tar.zst.sig2022-08-27 15:30 310
[PGP]notes-up-2.0.6-1-x86_64.pkg.tar.zst.sig2021-12-23 13:52 310
[PGP]nrpe-4.1.0-1-x86_64.pkg.tar.zst.sig2022-09-24 09:33 310
[PGP]nsd-4.6.0-1-x86_64.pkg.tar.zst.sig2022-07-07 00:38 310
[PGP]ntl-11.5.1-1-x86_64.pkg.tar.zst.sig2021-06-24 08:45 310
[PGP]nullmailer-2.2-3-x86_64.pkg.tar.zst.sig2020-10-14 17:28 310
[PGP]obconf-2.0.4-7-x86_64.pkg.tar.zst.sig2020-07-07 22:29 310
[PGP]obs-studio-28.0.2-1-x86_64.pkg.tar.zst.sig2022-09-24 10:29 310
[PGP]ocrad-0.28-2-x86_64.pkg.tar.zst.sig2022-04-28 20:31 310
[PGP]ocrfeeder-0.8.5-1-any.pkg.tar.zst.sig2022-09-03 21:24 310
[PGP]octave-7.2.0-2-x86_64.pkg.tar.zst.sig2022-08-27 18:47 310
[PGP]ogmtools-1.5-9-x86_64.pkg.tar.zst.sig2020-04-05 13:25 310
[PGP]openbve-1.8.4.1-1-any.pkg.tar.zst.sig2022-09-03 21:07 310
[PGP]opencsg-1.4.2-3-x86_64.pkg.tar.zst.sig2020-04-25 13:08 310
[PGP]openimageio-2.3.19.0-3-x86_64.pkg.tar.zst.sig2022-09-18 04:21 310
[PGP]openlibm-0.8.1-1-x86_64.pkg.tar.zst.sig2022-01-20 08:27 310
[PGP]openmotif-2.3.8-3-x86_64.pkg.tar.zst.sig2020-09-27 22:45 310
[PGP]openmw-0.47.0-8-x86_64.pkg.tar.zst.sig2022-09-18 04:31 310
[PGP]openntpd-6.8p1-3-x86_64.pkg.tar.zst.sig2022-04-26 16:11 310
[PGP]openscad-2021.01-6-x86_64.pkg.tar.zst.sig2022-09-18 04:49 310
[PGP]openscenegraph-3.6.5-14-x86_64.pkg.tar.zst.sig2022-07-22 15:47 310
[PGP]openshadinglanguage-1.11.17.0-5-x86_64.pkg.tar.zst.sig2022-09-18 04:23 310
[PGP]opensmtpd-6.8.0p2-3-x86_64.pkg.tar.zst.sig2022-04-26 16:13 310
[PGP]opensmtpd-filter-dkimsign-0.5-2-x86_64.pkg.tar.zst.sig2021-10-17 21:18 310
[PGP]opensmtpd-filter-rspamd-0.1.7-3-x86_64.pkg.tar.zst.sig2022-04-27 18:47 310
[PGP]opentimelineio-0.15-1-x86_64.pkg.tar.zst.sig2022-09-26 23:08 310
[PGP]opentoonz-1.6.0-2-x86_64.pkg.tar.zst.sig2022-06-06 08:25 310
[PGP]openttd-opengfx-7.1-1-any.pkg.tar.zst.sig2021-10-19 10:09 310
[PGP]openttd-opensfx-1.0.3-1-any.pkg.tar.zst.sig2021-12-18 12:21 310
[PGP]openvdb-9.1.0-2-x86_64.pkg.tar.zst.sig2022-09-18 00:39 310
[PGP]openzwave-1.6-5-x86_64.pkg.tar.zst.sig2022-03-12 13:33 310
[PGP]orcania-2.3.0-1-x86_64.pkg.tar.zst.sig2022-06-18 20:43 310
[PGP]ortp-5.1.61-1-x86_64.pkg.tar.zst.sig2022-09-16 16:27 310
[PGP]osbuild-67-1-any.pkg.tar.zst.sig2022-09-14 16:09 310
[PGP]osinfo-db-20220830-1-any.pkg.tar.zst.sig2022-09-03 23:10 310
[PGP]osinfo-db-tools-1.10.0-1-x86_64.pkg.tar.zst.sig2022-03-12 23:24 310
[PGP]osm-gps-map-1.2.0-1-x86_64.pkg.tar.zst.sig2021-02-07 19:27 310
[PGP]otf-cormorant-3.609-1-any.pkg.tar.zst.sig2020-10-13 01:07 310
[PGP]otf-ipaexfont-004.01-2-any.pkg.tar.zst.sig2020-06-29 12:09 310
[PGP]otf-ipafont-003.03-8-any.pkg.tar.zst.sig2020-06-29 12:16 310
[PGP]otf-ipamjfont-006.01-2-any.pkg.tar.zst.sig2020-06-29 12:23 310
[PGP]otf-latin-modern-2.004-4-any.pkg.tar.zst.sig2020-06-29 12:25 310
[PGP]otf-latinmodern-math-1.959-4-any.pkg.tar.zst.sig2020-06-29 12:26 310
[PGP]otter-browser-1.0.03-1-x86_64.pkg.tar.zst.sig2022-03-13 19:34 310
[PGP]owncloud-client-2.11.1.8438-1-x86_64.pkg.tar.zst.sig2022-09-01 17:52 310
[PGP]oxipng-6.0.1-1-x86_64.pkg.tar.zst.sig2022-09-11 17:54 310
[PGP]packagekit-qt5-1.0.2-1-x86_64.pkg.tar.zst.sig2020-02-21 00:29 310
[PGP]packeth-2.1-2-x86_64.pkg.tar.zst.sig2020-07-07 23:18 310
[PGP]pacoloco-1.2-2-x86_64.pkg.tar.zst.sig2022-04-27 18:05 310
[PGP]pacparser-1.4.0-1-x86_64.pkg.tar.zst.sig2022-07-31 00:24 310
[PGP]palp-1:2.20-1-x86_64.pkg.tar.zst.sig2020-10-19 20:18 310
[PGP]pam_mount-2.19-1-x86_64.pkg.tar.zst.sig2022-07-31 20:17 310
[PGP]pan-0.151-1-x86_64.pkg.tar.zst.sig2022-08-27 18:59 310
[PGP]pantheon-geoclue2-agent-1.0.5-2-x86_64.pkg.tar.zst.sig2022-03-06 16:51 310
[PGP]pantheon-screenshot-6.0.2-2-x86_64.pkg.tar.zst.sig2022-03-06 17:45 310
[PGP]pantheon-session-6.0.0-3-any.pkg.tar.zst.sig2022-03-06 17:04 310
[PGP]pantheon-sideload-6.0.2-2-x86_64.pkg.tar.zst.sig2022-03-06 17:03 310
[PGP]paperwork-2.1.1-2-any.pkg.tar.zst.sig2022-08-03 12:52 310
[PGP]paraview-5.10.1-9-x86_64.pkg.tar.zst.sig2022-07-01 15:01 310
[PGP]pari-2.13.4-1-x86_64.pkg.tar.zst.sig2022-04-05 19:11 310
[PGP]pari-elldata-20210301-1-any.pkg.tar.zst.sig2021-03-01 16:29 310
[PGP]pari-galdata-20080411-3-any.pkg.tar.zst.sig2020-07-07 21:13 310
[PGP]pari-galpol-20180625-2-any.pkg.tar.zst.sig2020-03-29 14:51 310
[PGP]pari-seadata-20090618-2-any.pkg.tar.zst.sig2020-03-29 14:52 310
[PGP]pari-seadata-small-20090618-3-any.pkg.tar.zst.sig2020-07-07 21:33 310
[PGP]partimage-0.6.9-13-x86_64.pkg.tar.zst.sig2020-05-30 22:23 310
[PGP]patchelf-0.15.0-1-x86_64.pkg.tar.zst.sig2022-07-26 22:59 310
[PGP]paxtest-0.9.15-3-x86_64.pkg.tar.zst.sig2020-07-07 22:36 310
[PGP]pbzip2-1.1.13-3-x86_64.pkg.tar.zst.sig2020-07-07 22:26 310
[PGP]pcb-1:4.3.0-2-x86_64.pkg.tar.zst.sig2022-04-23 11:54 310
[PGP]pcbdraw-0.6.1-3-any.pkg.tar.zst.sig2021-12-03 00:58 310
[PGP]pcmanfm-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:24 310
[PGP]pcmanfm-gtk3-1.3.2-1-x86_64.pkg.tar.zst.sig2021-02-13 22:27 310
[PGP]pcsc-perl-1.4.14-13-x86_64.pkg.tar.zst.sig2022-05-29 13:58 310
[PGP]pdfarranger-1.9.1-1-any.pkg.tar.zst.sig2022-09-24 23:19 310
[PGP]pdfmixtool-1.1-2-x86_64.pkg.tar.zst.sig2022-09-13 16:47 310
[PGP]pdfpc-4.5.0-2-x86_64.pkg.tar.zst.sig2022-04-16 21:36 310
[PGP]pdfslicer-1.8.8-2-x86_64.pkg.tar.zst.sig2022-09-13 17:12 310
[PGP]pdftricks-0.4.1-1-x86_64.pkg.tar.zst.sig2021-11-23 22:59 310
[PGP]peda-1.2-2-any.pkg.tar.zst.sig2021-12-03 01:23 310
[PGP]pencil2d-0.6.6-1-x86_64.pkg.tar.zst.sig2021-02-27 20:46 310
[PGP]perl-algorithm-diff-1:1.201-3-any.pkg.tar.zst.sig2022-05-29 11:32 310
[PGP]perl-alien-cmake3-0.08-3-any.pkg.tar.zst.sig2022-05-29 13:28 310
[PGP]perl-anyevent-i3-0.17-8-any.pkg.tar.zst.sig2022-05-29 14:04 310
[PGP]perl-app-borgrestore-3.4.4-3-any.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-app-cli-0.52-3-any.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-authen-sasl-2.16-10-any.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]perl-cairo-gobject-1.004-12-x86_64.pkg.tar.zst.sig2022-05-29 13:05 310
[PGP]perl-canary-stability-2013-5-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-cgi-fast-2.16-2-any.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]perl-cgi-session-4.48-9-any.pkg.tar.zst.sig2022-05-29 11:27 310
[PGP]perl-class-tiny-1.008-3-any.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-color-calc-1.074-8-any.pkg.tar.zst.sig2022-05-29 13:59 310
[PGP]perl-cpanel-json-xs-4.29-2-x86_64.pkg.tar.zst.sig2022-05-29 14:11 310
[PGP]perl-cpanplus-0.9914-2-any.pkg.tar.zst.sig2022-05-29 13:13 310
[PGP]perl-crypt-des-2.07-13-x86_64.pkg.tar.zst.sig2022-05-29 11:32 310
[PGP]perl-crypt-openssl-dsa-0.20-3-x86_64.pkg.tar.zst.sig2022-05-29 11:26 310
[PGP]perl-crypt-smbhash-0.12-10-any.pkg.tar.zst.sig2022-05-29 13:51 310
[PGP]perl-cwd-guard-0.05-8-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-data-dump-1.25-3-any.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]perl-data-hierarchy-0.34-13-any.pkg.tar.zst.sig2022-05-29 13:57 310
[PGP]perl-data-munge-0.097-5-any.pkg.tar.zst.sig2022-05-29 12:19 310
[PGP]perl-data-structure-util-0.16-12-x86_64.pkg.tar.zst.sig2022-05-29 13:55 310
[PGP]perl-data-uuid-1.226-3-x86_64.pkg.tar.zst.sig2022-05-29 14:00 310
[PGP]perl-data-validate-ip-0.27-6-any.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]perl-datetime-cron-simple-0.2-13-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-datetime-event-recurrence-0.19-8-any.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]perl-dbd-sqlite2-0.38-6-x86_64.pkg.tar.zst.sig2022-05-29 13:55 310
[PGP]perl-dbi-shell-11.97-3-any.pkg.tar.zst.sig2022-05-29 13:56 310
[PGP]perl-devel-checkcompiler-0.07-8-any.pkg.tar.zst.sig2022-05-29 13:30 310
[PGP]perl-devel-leak-0.03-12-x86_64.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-devel-stacktrace-2.04-2-any.pkg.tar.zst.sig2022-05-29 11:34 310
[PGP]perl-digest-bubblebabble-0.02-8-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-djabberd-rosterstorage-sqlite-1.00-11-any.pkg.tar.zst.sig2022-05-29 14:03 310
[PGP]perl-extutils-config-0.008-8-any.pkg.tar.zst.sig2022-05-29 11:30 310
[PGP]perl-extutils-helpers-0.026-8-any.pkg.tar.zst.sig2022-05-29 11:30 310
[PGP]perl-file-path-expand-1.02-15-any.pkg.tar.zst.sig2022-05-29 14:03 310
[PGP]perl-file-pushd-1.016-5-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-file-sharedir-projectdistdir-1.000009-5-any.pkg.tar.zst.sig2022-05-29 13:54 310
[PGP]perl-file-tail-1.3-8-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-file-type-0.22-13-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-font-afm-1.20-11-any.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-function-parameters-2.001003-6-x86_64.pkg.tar.zst.sig2022-05-29 13:06 310
[PGP]perl-glib-object-introspection-0.049-3-x86_64.pkg.tar.zst.sig2022-05-29 13:12 310
[PGP]perl-gnupg-interface-1.02-3-any.pkg.tar.zst.sig2022-05-29 13:51 310
[PGP]perl-goocanvas2-cairotypes-0.001-6-x86_64.pkg.tar.zst.sig2022-05-29 13:55 310
[PGP]perl-hook-lexwrap-0.26-5-any.pkg.tar.zst.sig2022-05-29 12:30 310
[PGP]perl-html-formatter-2.16-8-any.pkg.tar.zst.sig2022-05-29 14:03 310
[PGP]perl-html-highlight-0.20-13-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-html-strip-2.10-10-x86_64.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]perl-html-tableextract-2.15-6-any.pkg.tar.zst.sig2022-05-29 13:22 310
[PGP]perl-ical-parser-1.21-8-any.pkg.tar.zst.sig2022-05-29 14:04 310
[PGP]perl-image-sane-5-4-x86_64.pkg.tar.zst.sig2022-05-29 14:02 310
[PGP]perl-inline-c-0.82-2-any.pkg.tar.zst.sig2022-05-29 13:13 310
[PGP]perl-inline-cpp-0.80-5-any.pkg.tar.zst.sig2022-05-29 13:58 310
[PGP]perl-io-all-0.87-5-any.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]perl-io-multiplex-1.16-8-any.pkg.tar.zst.sig2022-05-29 14:03 310
[PGP]perl-lingua-en-inflect-1.905-3-any.pkg.tar.zst.sig2022-05-29 11:34 310
[PGP]perl-log-any-adapter-tap-0.003003-5-any.pkg.tar.zst.sig2022-05-29 12:31 310
[PGP]perl-log-message-0.08-8-any.pkg.tar.zst.sig2022-05-29 11:27 310
[PGP]perl-mail-box-parser-c-3.010-3-x86_64.pkg.tar.zst.sig2022-05-29 13:59 310
[PGP]perl-mail-spf-query-1.999.1-13-any.pkg.tar.zst.sig2022-05-29 13:53 310
[PGP]perl-mime-base32-1.303-8-any.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-mime-tools-5.509-10-any.pkg.tar.zst.sig2022-05-29 13:21 310
[PGP]perl-module-build-tiny-0.039-8-any.pkg.tar.zst.sig2022-05-29 13:07 310
[PGP]perl-module-implementation-0.09-8-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-module-install-1.19-6-any.pkg.tar.zst.sig2022-05-29 13:33 310
[PGP]perl-moox-handlesvia-0.001009-3-any.pkg.tar.zst.sig2022-05-29 13:47 310
[PGP]perl-moox-late-0.100-3-any.pkg.tar.zst.sig2022-05-29 13:48 310
[PGP]perl-moox-types-mooselike-0.29-8-any.pkg.tar.zst.sig2022-05-29 13:35 310
[PGP]perl-namespace-clean-0.27-8-any.pkg.tar.zst.sig2022-05-29 13:34 310
[PGP]perl-net-dropbox-api-1.9-11-x86_64.pkg.tar.zst.sig2022-05-29 14:05 310
[PGP]perl-net-idn-encode-2.500-5-any.pkg.tar.zst.sig2022-05-29 14:03 310
[PGP]perl-net-ipv4addr-0.10-14-any.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-net-xmpp-1.05-8-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-number-bytes-human-0.11-6-any.pkg.tar.zst.sig2022-05-29 11:34 310
[PGP]perl-number-misc-1.2-6-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-object-accessor-0.48-8-any.pkg.tar.zst.sig2022-05-29 11:28 310
[PGP]perl-package-constants-0.06-8-any.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-package-stash-0.40-2-any.pkg.tar.zst.sig2022-05-29 13:34 310
[PGP]perl-padwalker-2.5-3-x86_64.pkg.tar.zst.sig2022-05-29 11:27 310
[PGP]perl-par-1.017-3-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-par-dist-0.51-3-any.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-parallel-forkmanager-2.02-4-any.pkg.tar.zst.sig2022-05-29 14:01 310
[PGP]perl-params-validate-1.30-3-x86_64.pkg.tar.zst.sig2022-05-29 13:33 310
[PGP]perl-params-validationcompiler-0.30-5-any.pkg.tar.zst.sig2022-05-29 13:22 310
[PGP]perl-parse-yapp-1.21-5-any.pkg.tar.zst.sig2022-05-29 11:36 310
[PGP]perl-path-class-0.37-8-any.pkg.tar.zst.sig2022-05-29 13:30 310
[PGP]perl-path-finddev-0.5.3-5-any.pkg.tar.zst.sig2022-05-29 13:34 310
[PGP]perl-pegex-0.75-3-any.pkg.tar.zst.sig2022-05-29 13:05 310
[PGP]perl-perl-minimumversion-1.40-3-any.pkg.tar.zst.sig2022-05-29 13:22 310
[PGP]perl-pkgconfig-libpkgconf-0.11-4-x86_64.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-poe-component-client-dns-1.054-8-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-poe-component-client-http-0.949-8-any.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-poe-component-client-keepalive-0.272-9-any.pkg.tar.zst.sig2022-05-29 13:33 310
[PGP]perl-ppix-utilities-1.001000-5-any.pkg.tar.zst.sig2022-05-29 13:21 310
[PGP]perl-ppix-utils-0.003-3-any.pkg.tar.zst.sig2022-05-29 13:21 310
[PGP]perl-regexp-common-2017060201-5-any.pkg.tar.zst.sig2022-05-29 11:30 310
[PGP]perl-search-xapian-1.2.25.5-2-x86_64.pkg.tar.zst.sig2022-05-29 12:29 310
[PGP]perl-shell-guess-0.09-5-any.pkg.tar.zst.sig2022-05-29 11:34 310
[PGP]perl-soap-lite-1.27-7-any.pkg.tar.zst.sig2022-05-29 13:56 310
[PGP]perl-sort-naturally-1.03-8-any.pkg.tar.zst.sig2022-05-29 13:57 310
[PGP]perl-sub-exporter-progressive-0.001013-8-any.pkg.tar.zst.sig2022-05-29 11:32 310
[PGP]perl-sub-info-0.002-9-any.pkg.tar.zst.sig2022-05-29 12:19 310
[PGP]perl-sub-install-0.928-8-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-sub-name-0.26-4-x86_64.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]perl-sub-override-0.09-4-any.pkg.tar.zst.sig2022-05-29 13:07 310
[PGP]perl-super-1.20190531-5-any.pkg.tar.zst.sig2022-05-29 13:04 310
[PGP]perl-switch-2.17-8-any.pkg.tar.zst.sig2022-05-29 14:01 310
[PGP]perl-sys-meminfo-0.99-4-x86_64.pkg.tar.zst.sig2022-05-29 13:59 310
[PGP]perl-sys-syscall-0.25-9-any.pkg.tar.zst.sig2022-05-29 11:30 310
[PGP]perl-sys-virt-8.5.0-1-x86_64.pkg.tar.zst.sig2022-07-27 22:37 310
[PGP]perl-term-extendedcolor-0.504-4-any.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-term-readline-gnu-1.42-2-x86_64.pkg.tar.zst.sig2022-05-29 11:37 310
[PGP]perl-test-exit-0.11-5-any.pkg.tar.zst.sig2022-05-29 13:13 310
[PGP]perl-test-fatal-0.016-3-any.pkg.tar.zst.sig2022-05-29 12:19 310
[PGP]perl-test-file-1.992-2-any.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-test-inter-1.09-5-any.pkg.tar.zst.sig2022-05-29 13:04 310
[PGP]perl-test-minimumversion-0.101082-5-any.pkg.tar.zst.sig2022-05-29 13:23 310
[PGP]perl-test-mockmodule-0.177.0-3-any.pkg.tar.zst.sig2022-05-29 13:28 310
[PGP]perl-test-most-0.37-5-any.pkg.tar.zst.sig2022-05-29 13:05 310
[PGP]perl-test-needs-0.002009-3-any.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-test-number-delta-1.06-7-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-test-object-0.08-5-any.pkg.tar.zst.sig2022-05-29 11:30 310
[PGP]perl-test-output-1.033-3-any.pkg.tar.zst.sig2022-05-29 13:12 310
[PGP]perl-test-requiresinternet-0.05-8-any.pkg.tar.zst.sig2022-05-29 11:27 310
[PGP]perl-test-script-1.29-3-any.pkg.tar.zst.sig2022-05-29 13:13 310
[PGP]perl-test-yaml-1.07-6-any.pkg.tar.zst.sig2022-05-29 11:31 310
[PGP]perl-text-charwidth-0.04-21-x86_64.pkg.tar.zst.sig2022-05-29 13:58 310
[PGP]perl-text-markdown-1.000031-12-any.pkg.tar.zst.sig2022-05-29 13:52 310
[PGP]perl-text-soundex-3.05-10-x86_64.pkg.tar.zst.sig2022-05-29 11:32 310
[PGP]perl-tie-cphash-2.000-8-any.pkg.tar.zst.sig2022-05-29 13:55 310
[PGP]perl-time-human-1.03-13-any.pkg.tar.zst.sig2022-05-29 13:55 310
[PGP]perl-unicode-stringprep-1.105-8-any.pkg.tar.zst.sig2022-05-29 13:29 310
[PGP]perl-unix-syslog-1.1-16-x86_64.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-version-compare-0.14-6-any.pkg.tar.zst.sig2022-05-29 11:33 310
[PGP]perl-xml-libxml-prettyprint-0.006-7-any.pkg.tar.zst.sig2022-05-29 13:50 310
[PGP]perl-xml-smart-1.79-9-any.pkg.tar.zst.sig2022-05-29 13:59 310
[PGP]perl-yaml-tiny-1.73-6-any.pkg.tar.zst.sig2022-05-29 12:30 310
[PGP]perlio-via-dynamic-0.14-8-any.pkg.tar.zst.sig2022-05-29 11:35 310
[PGP]permlib-0.2.9-1-any.pkg.tar.xz.sig2019-11-19 17:16 310
[PGP]persepolis-3.2.0-7-any.pkg.tar.zst.sig2021-12-03 00:58 310
[PGP]pgadmin4-4.30-4-x86_64.pkg.tar.zst.sig2022-05-24 15:31 310
[PGP]photoflare-1.6.10-1-x86_64.pkg.tar.zst.sig2022-05-22 10:56 310
[PGP]php-geoip-1.1.1-7-x86_64.pkg.tar.zst.sig2022-01-04 18:53 310
[PGP]php-memcache-8.0-2-x86_64.pkg.tar.zst.sig2022-01-04 19:11 310
[PGP]php-memcached-3.2.0-1-x86_64.pkg.tar.zst.sig2022-03-25 12:46 310
[PGP]php7-geoip-1.1.1-7-x86_64.pkg.tar.zst.sig2022-01-04 18:53 310
[PGP]php7-memcache-8.0-2-x86_64.pkg.tar.zst.sig2022-01-04 19:11 310
[PGP]php7-memcached-3.2.0-1-x86_64.pkg.tar.zst.sig2022-03-25 12:46 310
[PGP]phppgadmin-7.13.0-2-any.pkg.tar.zst.sig2021-01-23 11:13 310
[PGP]physfs-3.0.2-2-x86_64.pkg.tar.zst.sig2020-05-22 22:08 310
[PGP]picom-9.1-3-x86_64.pkg.tar.zst.sig2022-04-25 23:00 310
[PGP]pidgin-otr-4.0.2-3-x86_64.pkg.tar.zst.sig2020-07-07 21:41 310
[PGP]pigar-1.0.0-1-any.pkg.tar.zst.sig2022-07-31 14:27 310
[PGP]pinfo-0.6.13-2-x86_64.pkg.tar.zst.sig2022-04-23 12:09 310
[PGP]pinta-2.0.2-1-any.pkg.tar.zst.sig2022-06-11 18:30 310
[PGP]pitivi-2022.06-1-x86_64.pkg.tar.zst.sig2022-07-03 22:24 310
[PGP]pius-3.0.0-4-any.pkg.tar.zst.sig2021-12-03 00:34 310
[PGP]planarity-3.0.2.0-1-x86_64.pkg.tar.zst.sig2022-02-25 23:39 310
[PGP]plantri-5.3-2-x86_64.pkg.tar.zst.sig2022-08-27 15:53 310
[PGP]plantuml-ascii-math-20171116-3-any.pkg.tar.zst.sig2022-04-23 15:41 310
[PGP]plasma-pass-1.2.0-1-x86_64.pkg.tar.zst.sig2021-02-15 22:58 310
[PGP]plasma5-applets-thermal-monitor-1.3.0-2-any.pkg.tar.zst.sig2021-10-16 21:53 310
[PGP]plasma5-applets-window-buttons-0.11.1-1-x86_64.pkg.tar.zst.sig2022-02-12 17:53 310
[PGP]playitslowly-1.5.1-10-any.pkg.tar.zst.sig2021-12-11 07:22 310
[PGP]plfit-0.9.4-1-x86_64.pkg.tar.zst.sig2022-08-27 15:38 310
[PGP]pnetcdf-openmpi-1.12.3-3-x86_64.pkg.tar.zst.sig2022-06-28 00:02 310
[PGP]pocl-3.0-2-x86_64.pkg.tar.zst.sig2022-06-22 23:59 310
[PGP]podofo-0.9.8-1-x86_64.pkg.tar.zst.sig2022-05-04 22:11 310
[PGP]polyclipping-6.4.2-4-x86_64.pkg.tar.zst.sig2020-08-03 21:20 310
[PGP]polymake-4.7-1-x86_64.pkg.tar.zst.sig2022-07-17 18:32 310
[PGP]polyml-5.9-3-x86_64.pkg.tar.zst.sig2022-04-28 20:29 310
[PGP]postgis-3.2.1-2-x86_64.pkg.tar.zst.sig2022-06-29 15:50 310
[PGP]povray-2:3.7.0.10-4-x86_64.pkg.tar.zst.sig2022-09-18 04:26 310
[PGP]powerdns-4.6.3-2-x86_64.pkg.tar.zst.sig2022-09-18 05:02 310
[PGP]ppl-1.2-4-x86_64.pkg.tar.xz.sig2019-12-16 21:50 310
[PGP]pptpd-1.4.0-3-x86_64.pkg.tar.zst.sig2020-07-07 22:20 310
[PGP]presage-0.9.1-1-x86_64.pkg.tar.zst.sig2021-04-02 20:51 310
[PGP]primecount-7.4-1-x86_64.pkg.tar.zst.sig2022-07-06 15:28 310
[PGP]primesieve-8.0-1-x86_64.pkg.tar.zst.sig2022-07-05 16:16 310
[PGP]primus_vk-1.6.2-1-x86_64.pkg.tar.zst.sig2022-07-22 12:59 310
[PGP]procinfo-ng-2.0.304-8-x86_64.pkg.tar.xz.sig2021-05-08 11:46 310
[PGP]proj-9.0.1-1-x86_64.pkg.tar.zst.sig2022-06-27 17:49 310
[PGP]pugixml-1.12.1-1-x86_64.pkg.tar.zst.sig2022-03-18 00:51 310
[PGP]puzzles-20220802-1-x86_64.pkg.tar.zst.sig2022-09-05 07:14 310
[PGP]pwndbg-2022.01.05-1-any.pkg.tar.zst.sig2022-01-06 10:40 310
[PGP]pyannotate-1.2.0-5-any.pkg.tar.zst.sig2021-12-03 01:07 310
[PGP]python-aaf2-1.6.0-1-any.pkg.tar.zst.sig2022-07-17 18:52 310
[PGP]python-adblock-0.6.0-1-x86_64.pkg.tar.zst.sig2022-08-01 09:48 310
[PGP]python-aiohttp-3.8.1-4-x86_64.pkg.tar.zst.sig2021-12-02 18:03 310
[PGP]python-aiohttp-apispec-2.2.3-1-any.pkg.tar.zst.sig2022-06-18 22:53 310
[PGP]python-aiosignal-1.2.0-3-any.pkg.tar.zst.sig2021-12-01 22:45 310
[PGP]python-aiosqlite-0.17.0-4-any.pkg.tar.zst.sig2022-08-01 09:37 310
[PGP]python-ansicolors-1.1.8-5-any.pkg.tar.zst.sig2021-12-03 00:40 310
[PGP]python-ansiwrap-0.8.4-5-any.pkg.tar.zst.sig2021-12-01 22:42 310
[PGP]python-anyjson-0.3.3-16-any.pkg.tar.zst.sig2021-12-01 22:50 310
[PGP]python-apipkg-3.0.1-1-any.pkg.tar.zst.sig2022-07-31 13:51 310
[PGP]python-apscheduler-3.9.1-1-any.pkg.tar.zst.sig2022-07-31 13:10 310
[PGP]python-apsw-3.38.5-1-x86_64.pkg.tar.zst.sig2022-07-04 18:28 310
[PGP]python-argon2-cffi-bindings-21.2.0-2-x86_64.pkg.tar.zst.sig2022-02-12 23:15 310
[PGP]python-argon2_cffi-21.3.0-1-x86_64.pkg.tar.zst.sig2022-02-12 23:17 310
[PGP]python-arpeggio-2.0.0-1-any.pkg.tar.zst.sig2022-07-27 22:55 310
[PGP]python-async_generator-1.10-7-any.pkg.tar.zst.sig2021-12-01 22:37 310
[PGP]python-asynctest-0.13.0-6-any.pkg.tar.zst.sig2021-12-03 01:12 310
[PGP]python-authlib-1.0.1-3-any.pkg.tar.zst.sig2022-06-27 00:08 310
[PGP]python-autopage-0.5.1-1-any.pkg.tar.zst.sig2022-06-26 23:26 310
[PGP]python-awesomeversion-22.9.0-1-any.pkg.tar.zst.sig2022-09-17 17:36 310
[PGP]python-axolotl-curve25519-0.4.1.2-8-x86_64.pkg.tar.zst.sig2021-12-01 22:56 310
[PGP]python-beautifulsoup4-4.11.1-1-any.pkg.tar.zst.sig2022-07-27 22:46 310
[PGP]python-beniget-0.4.1-3-any.pkg.tar.zst.sig2021-12-03 01:32 310
[PGP]python-biopython-1.79-3-x86_64.pkg.tar.zst.sig2021-12-03 01:25 310
[PGP]python-biscuits-0.3.0-1-x86_64.pkg.tar.zst.sig2021-12-25 14:41 310
[PGP]python-bitstring-3.1.9-3-any.pkg.tar.zst.sig2021-12-01 22:53 310
[PGP]python-bleach-5.0.1-2-any.pkg.tar.zst.sig2022-07-23 16:57 310
[PGP]python-boto3-1.24.80-1-any.pkg.tar.zst.sig2022-09-24 09:45 310
[PGP]python-bottleneck-1.3.5-1-x86_64.pkg.tar.zst.sig2022-07-07 00:34 310
[PGP]python-browserid-0.14.0-11-any.pkg.tar.zst.sig2021-12-02 13:05 310
[PGP]python-btchip-0.1.32-2-any.pkg.tar.zst.sig2021-12-03 01:15 310
[PGP]python-cachelib-0.9.0-1-any.pkg.tar.zst.sig2022-08-03 09:10 310
[PGP]python-caja-1.26.0-2-x86_64.pkg.tar.zst.sig2021-12-03 02:13 310
[PGP]python-calmjs-3.4.2-3-any.pkg.tar.zst.sig2021-12-03 01:15 310
[PGP]python-capstone-4.0.2-6-x86_64.pkg.tar.zst.sig2022-04-28 20:07 310
[PGP]python-cbor-1.0.0-8-x86_64.pkg.tar.zst.sig2021-12-01 22:56 310
[PGP]python-cfgv-3.3.1-3-any.pkg.tar.zst.sig2021-12-01 22:46 310
[PGP]python-cftime-1.6.1-1-x86_64.pkg.tar.zst.sig2022-06-30 17:47 310
[PGP]python-cjkwrap-2.2-9-any.pkg.tar.zst.sig2021-12-01 22:40 310
[PGP]python-click-completion-0.5.2-6-any.pkg.tar.zst.sig2021-12-03 01:46 310
[PGP]python-click-default-group-1.2.2-5-any.pkg.tar.zst.sig2021-12-02 13:31 310
[PGP]python-click-repl-0.2.0-3-any.pkg.tar.zst.sig2021-12-02 16:20 310
[PGP]python-click-threading-0.5.0-3-any.pkg.tar.zst.sig2021-12-02 13:07 310
[PGP]python-clint-0.5.1-11-any.pkg.tar.zst.sig2021-12-01 22:33 310
[PGP]python-cloudpickle-2.1.0-1-any.pkg.tar.zst.sig2022-06-16 20:19 310
[PGP]python-colander-1.8.3-2-any.pkg.tar.zst.sig2021-12-03 00:24 310
[PGP]python-collada-0.7.2-1-any.pkg.tar.zst.sig2022-03-18 08:06 310
[PGP]python-colorcet-3.0.0-1-any.pkg.tar.zst.sig2021-12-05 13:43 310
[PGP]python-colored-traceback-0.3.0-3-any.pkg.tar.zst.sig2021-12-01 22:37 310
[PGP]python-colour-0.1.5-10-any.pkg.tar.zst.sig2021-12-02 13:02 310
[PGP]python-configobj-5.0.6.r110.g3e2f4cc-3-any.pkg.tar.zst.sig2021-12-01 22:51 310
[PGP]python-connexion-2.9.0-2-any.pkg.tar.zst.sig2021-12-03 02:04 310
[PGP]python-contextlib2-21.6.0-1-any.pkg.tar.zst.sig2022-06-12 11:13 310
[PGP]python-css-parser-1.0.7-1-any.pkg.tar.zst.sig2022-06-26 23:38 310
[PGP]python-cvxopt-1.3.0-1-x86_64.pkg.tar.zst.sig2022-03-07 23:09 310
[PGP]python-cymem-2.0.6-3-x86_64.pkg.tar.zst.sig2021-12-02 20:18 310
[PGP]python-cypari2-2.1.2-7-x86_64.pkg.tar.zst.sig2021-12-16 08:12 310
[PGP]python-cysignals-1.11.2-1-x86_64.pkg.tar.zst.sig2021-12-15 21:41 310
[PGP]python-dask-2022.7.1-1-any.pkg.tar.zst.sig2022-08-03 17:21 310
[PGP]python-database-cubic-hecke-2022.4.4-1-any.pkg.tar.zst.sig2022-08-31 23:51 310
[PGP]python-database-knotinfo-2022.7.1-1-any.pkg.tar.zst.sig2022-07-02 10:03 310
[PGP]python-dateutil-2.8.2-4-any.pkg.tar.zst.sig2021-12-02 20:26 310
[PGP]python-dbapi-compliance-1.15.0-1-any.pkg.tar.zst.sig2021-12-25 14:08 310
[PGP]python-dbus-deviation-0.6.1-4-any.pkg.tar.zst.sig2021-12-02 19:44 310
[PGP]python-debugpy-1.6.3-1-x86_64.pkg.tar.zst.sig2022-08-27 16:06 310
[PGP]python-decorator-5.1.1-1-any.pkg.tar.zst.sig2022-01-24 14:28 310
[PGP]python-deprecation-2.1.0-6-any.pkg.tar.zst.sig2021-12-04 21:43 310
[PGP]python-dictpath-0.1.3-2-any.pkg.tar.zst.sig2022-04-07 09:10 310
[PGP]python-dill-0.3.4-3-any.pkg.tar.zst.sig2021-12-01 22:45 310
[PGP]python-distributed-2022.7.1-1-x86_64.pkg.tar.zst.sig2022-08-03 16:18 310
[PGP]python-distutils-extra-2.39-10-any.pkg.tar.zst.sig2021-12-01 23:11 310
[PGP]python-django-appconf-1.0.5-3-any.pkg.tar.zst.sig2021-12-02 16:15 310
[PGP]python-django-debug-toolbar-3.5-1-any.pkg.tar.zst.sig2022-06-29 16:22 310
[PGP]python-django-gravatar-1.4.4-5-any.pkg.tar.zst.sig2021-12-02 16:22 310
[PGP]python-dnspython-1:2.2.1-1-any.pkg.tar.zst.sig2022-04-26 08:49 310
[PGP]python-dockerpty-0.4.1-9-any.pkg.tar.zst.sig2021-12-03 02:24 310
[PGP]python-docstring-to-markdown-0.10-1-any.pkg.tar.zst.sig2022-06-27 08:24 310
[PGP]python-doctest-ignore-unicode-0.1.2-5-any.pkg.tar.zst.sig2021-12-03 00:24 310
[PGP]python-dotenv-0.21.0-1-any.pkg.tar.zst.sig2022-09-07 23:48 310
[PGP]python-dpcontracts-0.6.0-9-any.pkg.tar.zst.sig2021-12-03 01:07 310
[PGP]python-dropbox-11.33.0-1-any.pkg.tar.zst.sig2022-07-18 22:45 310
[PGP]python-easyprocess-1.1-1-any.pkg.tar.zst.sig2022-03-20 15:45 310
[PGP]python-elasticsearch-curator-5.7.6-7-x86_64.pkg.tar.zst.sig2021-12-03 00:32 310
[PGP]python-empy-3.3.4-7-any.pkg.tar.zst.sig2021-12-01 22:48 310
[PGP]python-entrypoint2-1.1-1-any.pkg.tar.zst.sig2022-06-29 17:10 310
[PGP]python-entrypoints-0.4-2-any.pkg.tar.zst.sig2022-04-16 22:21 310
[PGP]python-euclid3-0.01-5-any.pkg.tar.zst.sig2021-12-01 22:31 310
[PGP]python-eventlet-0.33.1-1-any.pkg.tar.zst.sig2022-07-19 23:29 310
[PGP]python-ewmh-0.1.6-4-any.pkg.tar.zst.sig2021-12-03 01:19 310
[PGP]python-exam-0.10.6-10-any.pkg.tar.zst.sig2021-12-03 01:18 310
[PGP]python-expects-0.9.0-8-any.pkg.tar.zst.sig2021-12-01 22:46 310
[PGP]python-fakeredis-1.7.0-2-any.pkg.tar.zst.sig2021-12-06 21:46 310
[PGP]python-fastpbkdf2-0.2-8-x86_64.pkg.tar.zst.sig2021-12-03 00:27 310
[PGP]python-fields-5.0.0-13-any.pkg.tar.zst.sig2021-12-02 04:20 310
[PGP]python-fiona-1.8.21-2-x86_64.pkg.tar.zst.sig2022-06-28 02:08 310
[PGP]python-fire-0.4.0-3-any.pkg.tar.zst.sig2021-12-02 12:57 310
[PGP]python-fissix-21.11.13-1-any.pkg.tar.zst.sig2022-06-26 23:31 310
[PGP]python-fixtures-4.0.1-1-any.pkg.tar.zst.sig2022-07-31 19:37 310
[PGP]python-flake8-typing-imports-1.10.1-2-any.pkg.tar.zst.sig2021-12-03 00:33 310
[PGP]python-flaky-3.7.0-6-any.pkg.tar.zst.sig2021-12-03 00:26 310
[PGP]python-flask-babelex-0.9.4-5-any.pkg.tar.zst.sig2021-12-02 19:43 310
[PGP]python-flask-caching-2.0.1-2-any.pkg.tar.zst.sig2022-08-03 09:15 310
[PGP]python-flask-dance-6.1.0-1-any.pkg.tar.zst.sig2022-08-31 19:01 310
[PGP]python-flask-gravatar-0.5.0-7-any.pkg.tar.zst.sig2021-12-02 23:25 310
[PGP]python-flask-htmlmin-2.2.0-1-any.pkg.tar.zst.sig2022-07-19 22:34 310
[PGP]python-flask-migrate-3.1.0-1-any.pkg.tar.zst.sig2022-07-19 23:01 310